From 993fc5c301cf40569a5a780f1e9b0af457711c67 Mon Sep 17 00:00:00 2001
From: Bill Burke <bburke@redhat.com>
Date: Sat, 10 Aug 2013 08:13:39 -0400
Subject: [PATCH] required creds

---
 .../org/keycloak/AbstractOAuthClient.java     |    2 +-
 .../idm/CredentialRepresentation.java         |   14 +-
 .../idm/RealmRepresentation.java              |   18 +-
 .../idm/RequiredCredentialRepresentation.java |   39 -
 .../idm/ResourceRepresentation.java           |    3 +-
 .../idm/UserRepresentation.java               |   30 +-
 .../main/resources/META-INF/testrealm.json    |  152 +-
 .../src/main/webapp/saas/admin/index.html     |   10 +-
 .../src/main/webapp/saas/admin/js/app.js      |    7 +-
 .../main/webapp/saas/admin/js/controllers.js  |   23 +-
 .../webapp/saas/admin/lib/angular/select2.js  |  195 +
 .../saas/admin/lib/select2-3.4.1/LICENSE      |   18 +
 .../saas/admin/lib/select2-3.4.1/README.md    |   83 +
 .../admin/lib/select2-3.4.1/component.json    |    8 +
 .../saas/admin/lib/select2-3.4.1/release.sh   |   69 +
 .../lib/select2-3.4.1/select2-spinner.gif     |  Bin 0 -> 1849 bytes
 .../saas/admin/lib/select2-3.4.1/select2.css  |  680 ++++
 .../lib/select2-3.4.1/select2.jquery.json     |   36 +
 .../saas/admin/lib/select2-3.4.1/select2.js   | 3137 +++++++++++++++++
 .../admin/lib/select2-3.4.1/select2.min.js    |   22 +
 .../saas/admin/lib/select2-3.4.1/select2.png  |  Bin 0 -> 613 bytes
 .../lib/select2-3.4.1/select2_locale_ar.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_ca.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_cs.js    |   49 +
 .../lib/select2-3.4.1/select2_locale_da.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_de.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_el.js    |   17 +
 .../select2_locale_en.js.template             |   17 +
 .../lib/select2-3.4.1/select2_locale_es.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_et.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_eu.js    |   43 +
 .../lib/select2-3.4.1/select2_locale_fi.js    |   28 +
 .../lib/select2-3.4.1/select2_locale_fr.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_gl.js    |   43 +
 .../lib/select2-3.4.1/select2_locale_he.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_hr.js    |   42 +
 .../lib/select2-3.4.1/select2_locale_hu.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_id.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_is.js    |   16 +
 .../lib/select2-3.4.1/select2_locale_it.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_ja.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_ko.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_lt.js    |   29 +
 .../lib/select2-3.4.1/select2_locale_lv.js    |   16 +
 .../lib/select2-3.4.1/select2_locale_mk.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_nl.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_no.js    |   18 +
 .../lib/select2-3.4.1/select2_locale_pl.js    |   37 +
 .../lib/select2-3.4.1/select2_locale_pt-BR.js |   15 +
 .../lib/select2-3.4.1/select2_locale_pt-PT.js |   15 +
 .../lib/select2-3.4.1/select2_locale_ro.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_ru.js    |   15 +
 .../lib/select2-3.4.1/select2_locale_sk.js    |   48 +
 .../lib/select2-3.4.1/select2_locale_sv.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_tr.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_ua.js    |   17 +
 .../lib/select2-3.4.1/select2_locale_vi.js    |   18 +
 .../lib/select2-3.4.1/select2_locale_zh-CN.js |   14 +
 .../lib/select2-3.4.1/select2_locale_zh-TW.js |   14 +
 .../admin/lib/select2-3.4.1/select2x2.png     |  Bin 0 -> 845 bytes
 .../saas/admin/partials/application-menu.html |    4 +-
 .../saas/admin/partials/realm-detail.html     |   97 +-
 .../saas/admin/partials/realm-menu.html       |   19 +-
 .../adapters/as7/ServletOAuthLogin.java       |    4 +-
 .../main/java/org/keycloak/sdk/LoginBean.java |    8 +-
 .../managers/AuthenticationManager.java       |   16 +-
 .../services/managers/RealmManager.java       |   79 +-
 .../keycloak/services/models/RealmModel.java  |   13 +-
 .../models/RequiredCredentialModel.java       |   49 +-
 .../services/models/UserCredentialModel.java  |    9 +
 .../keycloak/services/models/UserModel.java   |   12 +
 .../models/picketlink/RealmAdapter.java       |   44 +-
 .../models/picketlink/UserAdapter.java        |   34 +
 .../RequiredCredentialRelationship.java       |   10 +
 .../services/resources/SaasService.java       |   33 +-
 .../resources/admin/RealmAdminResource.java   |   14 +-
 .../java/org/keycloak/test/AdapterTest.java   |   38 +-
 .../java/org/keycloak/test/ImportTest.java    |   25 +
 .../org/keycloak/test/RealmCreationTest.java  |    8 +-
 .../src/test/resources/testrealm-demo.json    |   86 +
 services/src/test/resources/testrealm.json    |  222 +-
 81 files changed, 5771 insertions(+), 400 deletions(-)
 delete mode 100755 core/src/main/java/org/keycloak/representations/idm/RequiredCredentialRepresentation.java
 create mode 100755 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/angular/select2.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/LICENSE
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/README.md
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/component.json
 create mode 100755 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/release.sh
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2-spinner.gif
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.css
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.jquery.json
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.min.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.png
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ar.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ca.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_cs.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_da.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_de.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_el.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_en.js.template
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_es.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_et.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_eu.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fi.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fr.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_gl.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_he.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hr.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hu.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_id.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_is.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_it.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ja.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ko.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lt.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lv.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_mk.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_nl.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_no.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pl.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-BR.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-PT.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ro.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ru.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sk.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sv.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_tr.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ua.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_vi.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-CN.js
 create mode 100755 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-TW.js
 create mode 100644 examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2x2.png
 create mode 100755 services/src/test/resources/testrealm-demo.json

diff --git a/core/src/main/java/org/keycloak/AbstractOAuthClient.java b/core/src/main/java/org/keycloak/AbstractOAuthClient.java
index 955f9df1b0..592ddab405 100755
--- a/core/src/main/java/org/keycloak/AbstractOAuthClient.java
+++ b/core/src/main/java/org/keycloak/AbstractOAuthClient.java
@@ -111,7 +111,7 @@ public class AbstractOAuthClient {
                 .param("grant_type", "authorization_code")
                 .param("code", code)
                 .param("client_id", clientId)
-                .param("Password", password)
+                .param("password", password)
                 .param("redirect_uri", redirectUri);
         Response res = client.target(codeUrl).request().header(HttpHeaders.AUTHORIZATION, authHeader).post(Entity.form(codeForm));
         try {
diff --git a/core/src/main/java/org/keycloak/representations/idm/CredentialRepresentation.java b/core/src/main/java/org/keycloak/representations/idm/CredentialRepresentation.java
index 22593171e7..af9b292c47 100755
--- a/core/src/main/java/org/keycloak/representations/idm/CredentialRepresentation.java
+++ b/core/src/main/java/org/keycloak/representations/idm/CredentialRepresentation.java
@@ -5,9 +5,13 @@ package org.keycloak.representations.idm;
 * @version $Revision: 1 $
 */
 public class CredentialRepresentation {
+    public static final String PASSWORD = "password";
+    public static final String TOTP = "totp";
+    public static final String CLIENT_CERT = "cert";
+
     protected String type;
     protected String value;
-    protected boolean hashed;
+    protected String device;
 
     public String getType() {
         return type;
@@ -25,11 +29,11 @@ public class CredentialRepresentation {
         this.value = value;
     }
 
-    public boolean isHashed() {
-        return hashed;
+    public String getDevice() {
+        return device;
     }
 
-    public void setHashed(boolean hashed) {
-        this.hashed = hashed;
+    public void setDevice(String device) {
+        this.device = device;
     }
 }
diff --git a/core/src/main/java/org/keycloak/representations/idm/RealmRepresentation.java b/core/src/main/java/org/keycloak/representations/idm/RealmRepresentation.java
index 896c1c9ab8..53fb2c74e8 100755
--- a/core/src/main/java/org/keycloak/representations/idm/RealmRepresentation.java
+++ b/core/src/main/java/org/keycloak/representations/idm/RealmRepresentation.java
@@ -20,9 +20,9 @@ public class RealmRepresentation {
     protected String privateKey;
     protected String publicKey;
     protected List<RoleRepresentation> roles;
-    protected List<RequiredCredentialRepresentation> requiredCredentials;
-    protected List<RequiredCredentialRepresentation> requiredResourceCredentials;
-    protected List<RequiredCredentialRepresentation> requiredOAuthClientCredentials;
+    protected List<String> requiredCredentials;
+    protected List<String> requiredResourceCredentials;
+    protected List<String> requiredOAuthClientCredentials;
     protected List<UserRepresentation> users;
     protected List<RoleMappingRepresentation> roleMappings;
     protected List<ScopeMappingRepresentation> scopeMappings;
@@ -141,27 +141,27 @@ public class RealmRepresentation {
         return mapping;
     }
 
-    public List<RequiredCredentialRepresentation> getRequiredCredentials() {
+    public List<String> getRequiredCredentials() {
         return requiredCredentials;
     }
 
-    public void setRequiredCredentials(List<RequiredCredentialRepresentation> requiredCredentials) {
+    public void setRequiredCredentials(List<String> requiredCredentials) {
         this.requiredCredentials = requiredCredentials;
     }
 
-    public List<RequiredCredentialRepresentation> getRequiredResourceCredentials() {
+    public List<String> getRequiredResourceCredentials() {
         return requiredResourceCredentials;
     }
 
-    public void setRequiredResourceCredentials(List<RequiredCredentialRepresentation> requiredResourceCredentials) {
+    public void setRequiredResourceCredentials(List<String> requiredResourceCredentials) {
         this.requiredResourceCredentials = requiredResourceCredentials;
     }
 
-    public List<RequiredCredentialRepresentation> getRequiredOAuthClientCredentials() {
+    public List<String> getRequiredOAuthClientCredentials() {
         return requiredOAuthClientCredentials;
     }
 
-    public void setRequiredOAuthClientCredentials(List<RequiredCredentialRepresentation> requiredOAuthClientCredentials) {
+    public void setRequiredOAuthClientCredentials(List<String> requiredOAuthClientCredentials) {
         this.requiredOAuthClientCredentials = requiredOAuthClientCredentials;
     }
 
diff --git a/core/src/main/java/org/keycloak/representations/idm/RequiredCredentialRepresentation.java b/core/src/main/java/org/keycloak/representations/idm/RequiredCredentialRepresentation.java
deleted file mode 100755
index 7a9eaecb13..0000000000
--- a/core/src/main/java/org/keycloak/representations/idm/RequiredCredentialRepresentation.java
+++ /dev/null
@@ -1,39 +0,0 @@
-package org.keycloak.representations.idm;
-
-/**
- * @author <a href="mailto:bill@burkecentral.com">Bill Burke</a>
- * @version $Revision: 1 $
- */
-public class RequiredCredentialRepresentation {
-    public static final String PASSWORD = "Password";
-    public static final String TOTP = "TOTP";
-    public static final String CLIENT_CERT = "CLIENT_CERT";
-    public static final String CALLER_PRINCIPAL = "CALLER_PRINCIPAL";
-    protected String type;
-    protected boolean input;
-    protected boolean secret;
-
-    public String getType() {
-        return type;
-    }
-
-    public void setType(String type) {
-        this.type = type;
-    }
-
-    public boolean isInput() {
-        return input;
-    }
-
-    public void setInput(boolean input) {
-        this.input = input;
-    }
-
-    public boolean isSecret() {
-        return secret;
-    }
-
-    public void setSecret(boolean secret) {
-        this.secret = secret;
-    }
-}
diff --git a/core/src/main/java/org/keycloak/representations/idm/ResourceRepresentation.java b/core/src/main/java/org/keycloak/representations/idm/ResourceRepresentation.java
index 6cf9de6a79..2f4596e4fd 100755
--- a/core/src/main/java/org/keycloak/representations/idm/ResourceRepresentation.java
+++ b/core/src/main/java/org/keycloak/representations/idm/ResourceRepresentation.java
@@ -123,12 +123,11 @@ public class ResourceRepresentation {
         this.credentials = credentials;
     }
 
-    public ResourceRepresentation credential(String type, String value, boolean hashed) {
+    public ResourceRepresentation credential(String type, String value) {
         if (this.credentials == null) credentials = new ArrayList<CredentialRepresentation>();
         CredentialRepresentation cred = new CredentialRepresentation();
         cred.setType(type);
         cred.setValue(value);
-        cred.setHashed(hashed);
         credentials.add(cred);
         return this;
     }
diff --git a/core/src/main/java/org/keycloak/representations/idm/UserRepresentation.java b/core/src/main/java/org/keycloak/representations/idm/UserRepresentation.java
index cbbff891cb..2b3d02cf87 100755
--- a/core/src/main/java/org/keycloak/representations/idm/UserRepresentation.java
+++ b/core/src/main/java/org/keycloak/representations/idm/UserRepresentation.java
@@ -14,6 +14,9 @@ public class UserRepresentation {
     protected String self; // link
     protected String username;
     protected boolean enabled;
+    protected String firstName;
+    protected String lastName;
+    protected String email;
     protected Map<String, String> attributes;
     protected List<CredentialRepresentation> credentials;
 
@@ -25,6 +28,30 @@ public class UserRepresentation {
         this.self = self;
     }
 
+    public String getFirstName() {
+        return firstName;
+    }
+
+    public void setFirstName(String firstName) {
+        this.firstName = firstName;
+    }
+
+    public String getLastName() {
+        return lastName;
+    }
+
+    public void setLastName(String lastName) {
+        this.lastName = lastName;
+    }
+
+    public String getEmail() {
+        return email;
+    }
+
+    public void setEmail(String email) {
+        this.email = email;
+    }
+
     public String getUsername() {
         return username;
     }
@@ -55,12 +82,11 @@ public class UserRepresentation {
         this.credentials = credentials;
     }
 
-    public UserRepresentation credential(String type, String value, boolean hashed) {
+    public UserRepresentation credential(String type, String value) {
         if (this.credentials == null) credentials = new ArrayList<CredentialRepresentation>();
         CredentialRepresentation cred = new CredentialRepresentation();
         cred.setType(type);
         cred.setValue(value);
-        cred.setHashed(hashed);
         credentials.add(cred);
         return this;
     }
diff --git a/examples/as7-eap-demo/server/src/main/resources/META-INF/testrealm.json b/examples/as7-eap-demo/server/src/main/resources/META-INF/testrealm.json
index b333aab903..63f93fcab0 100755
--- a/examples/as7-eap-demo/server/src/main/resources/META-INF/testrealm.json
+++ b/examples/as7-eap-demo/server/src/main/resources/META-INF/testrealm.json
@@ -1,94 +1,86 @@
 {
-   "realm" : "demo",
-   "enabled" : true,
-   "tokenLifespan" : 10,
-   "accessCodeLifespan" : 10,
-   "sslNotRequired" : true,
-   "cookieLoginAllowed" : true,
-   "privateKey" : "MIICXAIBAAKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQABAoGAfmO8gVhyBxdqlxmIuglbz8bcjQbhXJLR2EoS8ngTXmN1bo2L90M0mUKSdc7qF10LgETBzqL8jYlQIbt+e6TH8fcEpKCjUlyq0Mf/vVbfZSNaVycY13nTzo27iPyWQHK5NLuJzn1xvxxrUeXI6A2WFpGEBLbHjwpx5WQG9A+2scECQQDvdn9NE75HPTVPxBqsEd2z10TKkl9CZxu10Qby3iQQmWLEJ9LNmy3acvKrE3gMiYNWb6xHPKiIqOR1as7L24aTAkEAtyvQOlCvr5kAjVqrEKXalj0Tzewjweuxc0pskvArTI2Oo070h65GpoIKLc9jf+UA69cRtquwP93aZKtW06U8dQJAF2Y44ks/mK5+eyDqik3koCI08qaC8HYq2wVl7G2QkJ6sbAaILtcvD92ToOvyGyeE0flvmDZxMYlvaZnaQ0lcSQJBAKZU6umJi3/xeEbkJqMfeLclD27XGEFoPeNrmdx0q10Azp4NfJAY+Z8KRyQCR2BEG+oNitBOZ+YXF9KCpH3cdmECQHEigJhYg+ykOvr1aiZUMFT72HU0jnmQe2FVekuG+LJUt2Tm7GtMjTFoGpf0JwrVuZN39fOYAlo+nTixgeW7X8Y=",
-   "publicKey" : "MIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQAB",
-   "requiredCredentials" : [
+    "realm": "demo",
+    "enabled": true,
+    "tokenLifespan": 300,
+    "accessCodeLifespan": 10,
+    "sslNotRequired": true,
+    "cookieLoginAllowed": true,
+    "privateKey": "MIICXAIBAAKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQABAoGAfmO8gVhyBxdqlxmIuglbz8bcjQbhXJLR2EoS8ngTXmN1bo2L90M0mUKSdc7qF10LgETBzqL8jYlQIbt+e6TH8fcEpKCjUlyq0Mf/vVbfZSNaVycY13nTzo27iPyWQHK5NLuJzn1xvxxrUeXI6A2WFpGEBLbHjwpx5WQG9A+2scECQQDvdn9NE75HPTVPxBqsEd2z10TKkl9CZxu10Qby3iQQmWLEJ9LNmy3acvKrE3gMiYNWb6xHPKiIqOR1as7L24aTAkEAtyvQOlCvr5kAjVqrEKXalj0Tzewjweuxc0pskvArTI2Oo070h65GpoIKLc9jf+UA69cRtquwP93aZKtW06U8dQJAF2Y44ks/mK5+eyDqik3koCI08qaC8HYq2wVl7G2QkJ6sbAaILtcvD92ToOvyGyeE0flvmDZxMYlvaZnaQ0lcSQJBAKZU6umJi3/xeEbkJqMfeLclD27XGEFoPeNrmdx0q10Azp4NfJAY+Z8KRyQCR2BEG+oNitBOZ+YXF9KCpH3cdmECQHEigJhYg+ykOvr1aiZUMFT72HU0jnmQe2FVekuG+LJUt2Tm7GtMjTFoGpf0JwrVuZN39fOYAlo+nTixgeW7X8Y=",
+    "publicKey": "MIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQAB",
+    "requiredCredentials": [ "password" ],
+    "requiredResourceCredentials": [ "password" ],
+    "requiredOAuthClientCredentials": [ "password" ],
+    "users" : [
         {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-   ],
-    "requiredResourceCredentials" : [
-        {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-    ],
-    "requiredOAuthClientCredentials" : [
-        {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-    ],
-   "users" : [
-      {
             "username" : "bburke@redhat.com",
             "enabled" : true,
             "attributes" : {
                 "email" : "bburke@redhat.com"
             },
             "credentials" : [
-                { "type" : "Password",
-                 "value" : "password" }
+                { "type" : "password",
+                    "value" : "password" }
             ]
-      },
-      {
+        },
+        {
             "username" : "third-party",
             "enabled" : true,
             "credentials" : [
-                { "type" : "Password",
-                 "value" : "password" }
+                { "type" : "password",
+                    "value" : "password" }
             ]
-      }
-   ],
-   "roles" : [
-      { "name" : "user", "description" : "Have User privileges" },
-      { "name" : "admin", "description" : "Have Administrator privileges" }
-   ],
-   "roleMappings" : [
-       {
-          "username" : "bburke@redhat.com",
-          "roles" : ["user"]
-       },
-       {
-          "username" : "third-party",
-          "roles" : ["KEYCLOAK_IDENTITY_REQUESTER"]
-       }
-   ],
-   "scopeMappings" : [
-       {
-          "username" : "third-party",
-          "roles" : ["user"]
-       }
-   ],
-   "resources" : [
-       {
-          "name" : "customer-portal",
-          "enabled" : true,
-          "adminUrl" : "http://localhost:8080/customer-portal/j_admin_request",
-          "useRealmMappings" : true,
-          "credentials" : [
-                { "type" : "Password",
-                 "value" : "password" }
-          ]
-       },
-       {
-          "name" : "product-portal",
-          "enabled" : true,
-          "adminUrl" : "http://localhost:8080/product-portal/j_admin_request",
-          "useRealmMappings" : true,
-          "credentials" : [
-                { "type" : "Password",
-                 "value" : "password" }
-          ]
-       }
-   ]
+        }
+    ],
+    "roles": [
+        {
+            "name": "user",
+            "description": "Have User privileges"
+        },
+        {
+            "name": "admin",
+            "description": "Have Administrator privileges"
+        }
+    ],
+    "roleMappings": [
+        {
+            "username": "bburke@redhat.com",
+            "roles": ["user"]
+        },
+        {
+            "username": "third-party",
+            "roles": ["KEYCLOAK_IDENTITY_REQUESTER"]
+        }
+    ],
+    "scopeMappings": [
+        {
+            "username": "third-party",
+            "roles": ["user"]
+        }
+    ],
+    "resources": [
+        {
+            "name": "customer-portal",
+            "enabled": true,
+            "adminUrl": "http://localhost:8080/customer-portal/j_admin_request",
+            "useRealmMappings": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "password"
+                }
+            ]
+        },
+        {
+            "name": "product-portal",
+            "enabled": true,
+            "adminUrl": "http://localhost:8080/product-portal/j_admin_request",
+            "useRealmMappings": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "password"
+                }
+            ]
+        }
+    ]
 }
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/index.html b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/index.html
index d792b3013e..ad1a87e78f 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/index.html
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/index.html
@@ -15,13 +15,20 @@
     <link href="lib/bootstrap/css/bootstrap-responsive.css" rel="stylesheet">
     <link href="css/admin.css" rel="stylesheet">
     <link href="css/admin-responsive.css" rel="stylesheet">
+    <link href="lib/select2-3.4.1/select2.css" rel="stylesheet">
 
     <link href="css/styles.css" rel="stylesheet">
 
+    <script src="lib/jquery/jquery-1.10.2.js" type="text/javascript"></script>
+    <script src="lib/select2-3.4.1/select2.js" type="text/javascript"></script>
+
     <script src="lib/angular/angular.js"></script>
     <script src="lib/angular/angular-resource.js"></script>
     <script src="lib/angular/ui-bootstrap-tpls-0.4.0.js"></script>
 
+    <script src="lib/jquery/jquery.idletimer.js" type="text/javascript"></script>
+    <script src="lib/jquery/jquery.idletimeout.js" type="text/javascript"></script>
+    <script src="lib/angular/select2.js" type="text/javascript"></script>
     <script src="js/app.js"></script>
     <script src="js/controllers.js"></script>
     <script src="js/loaders.js"></script>
@@ -57,9 +64,6 @@
     </div>
 </div>
 
-<script src="lib/jquery/jquery-1.10.2.js" type="text/javascript"></script>
-<script src="lib/jquery/jquery.idletimer.js" type="text/javascript"></script>
-<script src="lib/jquery/jquery.idletimeout.js" type="text/javascript"></script>
 <script type="text/javascript">
     $.idleTimeout('#idletimeout', '#idletimeout a', {
         idleAfter: 300,
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/app.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/app.js
index 9fe75a59de..6afcfedcca 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/app.js
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/app.js
@@ -1,6 +1,6 @@
 'use strict';
 
-var module = angular.module('keycloak', [ 'keycloak.services', 'keycloak.loaders', 'keycloak.controllers', 'ui.bootstrap' ]);
+var module = angular.module('keycloak', [ 'keycloak.services', 'keycloak.loaders', 'keycloak.controllers', 'ui.bootstrap', 'ui.select2' ]);
 var resourceRequests = 0;
 
 module.config([ '$routeProvider', function($routeProvider) {
@@ -197,13 +197,12 @@ module.factory('spinnerInterceptor', function($q, $window, $rootScope, $location
 	};
 });
 
-/*
 module.directive('kcInput', function() {
 	var d = {
 		scope : true,
 		replace : false,
 		link : function(scope, element, attrs) {
-			var form = element.closest('form');
+			var form = element.children('form');
 			var label = element.children('label');
 			var input = element.children('input');
 
@@ -242,7 +241,7 @@ module.directive('kcEnter', function() {
 		});
 	};
 });
-*/
+
 
 module.filter('remove', function() {
 	return function(input, remove, attribute) {
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/controllers.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/controllers.js
index ef872b3118..b60633d316 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/controllers.js
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/js/controllers.js
@@ -93,6 +93,7 @@ module.controller('RealmDetailCtrl', function($scope, Current, Realm, realm, $lo
         $scope.realm.tokenLifespanUnit = 'SECONDS';
         $scope.realm.accessCodeLifespan = 300;
         $scope.realm.accessCodeLifespanUnit = 'SECONDS';
+        $scope.realm.requiredCredentials = ['password'];
     } else {
         $scope.realm.name = realm.realm;
         $scope.realm.requireSsl = !$scope.realm.sslNotRequired;
@@ -100,6 +101,12 @@ module.controller('RealmDetailCtrl', function($scope, Current, Realm, realm, $lo
         $scope.realm.acessCodeLifespanUnit = 'SECONDS';
     }
 
+    $scope.userCredentialOptions = {
+       'multiple' : true,
+        'simple_tags' : true,
+        'tags' : ['password', 'totp', 'cert']
+    };
+
 	$scope.changed = $scope.create;
 
 	$scope.$watch('realm', function() {
@@ -168,7 +175,8 @@ module.controller('RealmDetailCtrl', function($scope, Current, Realm, realm, $lo
                 cookieLoginAllowed: $scope.realm.cookieLoginAllowed,
                 sslNotRequired: !$scope.realm.requireSsl,
                 tokenLifespan: $scope.realm.tokenLifespan,
-                accessCodeLifespan: $scope.realm.accessCodeLifespan
+                accessCodeLifespan: $scope.realm.accessCodeLifespan,
+                requiredCredentials: $scope.realm.requiredCredentials
 
             };
 
@@ -385,7 +393,7 @@ module.controller('ApplicationDetailCtrl', function($scope, realm, applications,
         application : null
     };
 
-    selection.applications = angular.copy(applications);
+    selection.applications = applications;
 
     for (var i=0;i < selection.applications.length; i++) {
         if (selection.applications[i].name == application.name) {
@@ -396,10 +404,11 @@ module.controller('ApplicationDetailCtrl', function($scope, realm, applications,
     }
 
     $scope.selection = selection;
-
-    $scope.application = angular.copy(application);
-
-
+    if (!$scope.create) {
+        $scope.application= selection.application;
+    } else {
+        $scope.application = {};
+    }
 
     $scope.changeApplication = function() {
         console.log('ApplicationDetailCtrl.changeApplication() - ' + $scope.selection.application.name);
@@ -407,7 +416,7 @@ module.controller('ApplicationDetailCtrl', function($scope, realm, applications,
     };
 
     $scope.$watch('application', function() {
-        if (!angular.equals($scope.application, application)) {
+        if (!angular.equals($scope.selection.application, application)) {
             $scope.changed = true;
         }
     }, true);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/angular/select2.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/angular/select2.js
new file mode 100755
index 0000000000..7a517905b5
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/angular/select2.js
@@ -0,0 +1,195 @@
+/**
+ * Enhanced Select2 Dropmenus
+ *
+ * @AJAX Mode - When in this mode, your value will be an object (or array of objects) of the data used by Select2
+ * This change is so that you do not have to do an additional query yourself on top of Select2's own query
+ * @params [options] {object} The configuration options passed to $.fn.select2(). Refer to the documentation
+ */
+angular.module('ui.select2', []).value('uiSelect2Config', {}).directive('uiSelect2', ['uiSelect2Config', '$timeout', function (uiSelect2Config, $timeout) {
+    var options = {};
+    if (uiSelect2Config) {
+        angular.extend(options, uiSelect2Config);
+    }
+    return {
+        require: 'ngModel',
+        compile: function (tElm, tAttrs) {
+            var watch,
+                repeatOption,
+                repeatAttr,
+                isSelect = tElm.is('select'),
+                isMultiple = (tAttrs.multiple !== undefined);
+
+            // Enable watching of the options dataset if in use
+            if (tElm.is('select')) {
+                repeatOption = tElm.find('option[ng-repeat], option[data-ng-repeat]');
+
+                if (repeatOption.length) {
+                    repeatAttr = repeatOption.attr('ng-repeat') || repeatOption.attr('data-ng-repeat');
+                    watch = jQuery.trim(repeatAttr.split('|')[0]).split(' ').pop();
+                }
+            }
+
+            return function (scope, elm, attrs, controller) {
+                // instance-specific options
+                var opts = angular.extend({}, options, scope.$eval(attrs.uiSelect2));
+
+                /*
+                 Convert from Select2 view-model to Angular view-model.
+                 */
+                var convertToAngularModel = function(select2_data) {
+                    var model;
+                    if (opts.simple_tags) {
+                        model = []
+                        angular.forEach(select2_data, function(value, index) {
+                            model.push(value.id)
+                        })
+                    } else {
+                        model = select2_data
+                    }
+                    return model
+                }
+
+                /*
+                 Convert from Angular view-model to Select2 view-model.
+                 */
+                var convertToSelect2Model = function(angular_data) {
+                    var model = []
+                    if (!angular_data) {
+                        return model;
+                    }
+
+                    if (opts.simple_tags) {
+                        model = [];
+                        angular.forEach(
+                            angular_data,
+                            function(value, index) {
+                                model.push({'id': value, 'text': value});
+                            })
+                    } else {
+                        model = angular_data;
+                    }
+                    return model
+                }
+
+                if (isSelect) {
+                    // Use <select multiple> instead
+                    delete opts.multiple;
+                    delete opts.initSelection;
+                } else if (isMultiple) {
+                    opts.multiple = true;
+                }
+
+                if (controller) {
+                    // Watch the model for programmatic changes
+                    scope.$watch(tAttrs.ngModel, function(current, old) {
+                        if (!current) {
+                            return
+                        }
+                        if (current == old) {
+                            return
+                        }
+                        controller.$render()
+                    }, true)
+                    controller.$render = function () {
+                        if (isSelect) {
+                            elm.select2('val', controller.$viewValue);
+                        } else {
+                            if (opts.multiple) {
+                                elm.select2(
+                                    'data', convertToSelect2Model(controller.$viewValue));
+                            } else {
+                                if (angular.isObject(controller.$viewValue)) {
+                                    elm.select2('data', controller.$viewValue);
+                                } else if (!controller.$viewValue) {
+                                    elm.select2('data', null);
+                                } else {
+                                    elm.select2('val', controller.$viewValue);
+                                }
+                            }
+                        }
+                    };
+
+                    // Watch the options dataset for changes
+                    if (watch) {
+                        scope.$watch(watch, function (newVal, oldVal, scope) {
+                            if (!newVal) return;
+                            // Delayed so that the options have time to be rendered
+                            $timeout(function () {
+                                elm.select2('val', controller.$viewValue);
+                                // Refresh angular to remove the superfluous option
+                                elm.trigger('change');
+                            });
+                        });
+                    }
+
+                    // Update valid and dirty statuses
+                    controller.$parsers.push(function (value) {
+                        var div = elm.prev()
+                        div
+                            .toggleClass('ng-invalid', !controller.$valid)
+                            .toggleClass('ng-valid', controller.$valid)
+                            .toggleClass('ng-invalid-required', !controller.$valid)
+                            .toggleClass('ng-valid-required', controller.$valid)
+                            .toggleClass('ng-dirty', controller.$dirty)
+                            .toggleClass('ng-pristine', controller.$pristine);
+                        return value;
+                    });
+
+                    if (!isSelect) {
+                        // Set the view and model value and update the angular template manually for the ajax/multiple select2.
+                        elm.bind("change", function () {
+                            if (scope.$$phase) return;
+                            scope.$apply(function () {
+                                controller.$setViewValue(
+                                    convertToAngularModel(elm.select2('data')));
+                            });
+                        });
+
+                        if (opts.initSelection) {
+                            var initSelection = opts.initSelection;
+                            opts.initSelection = function (element, callback) {
+                                initSelection(element, function (value) {
+                                    controller.$setViewValue(convertToAngularModel(value));
+                                    callback(value);
+                                });
+                            };
+                        }
+                    }
+                }
+
+                elm.bind("$destroy", function() {
+                    elm.select2("destroy");
+                });
+
+                attrs.$observe('disabled', function (value) {
+                    elm.select2('enable', !value);
+                });
+
+                attrs.$observe('readonly', function (value) {
+                    elm.select2('readonly', !!value);
+                });
+
+                if (attrs.ngMultiple) {
+                    scope.$watch(attrs.ngMultiple, function(newVal) {
+                        elm.select2(opts);
+                    });
+                }
+
+                // Initialize the plugin late so that the injected DOM does not disrupt the template compiler
+                $timeout(function () {
+                    elm.select2(opts);
+
+                    // Set initial value - I'm not sure about this but it seems to need to be there
+                    elm.val(controller.$viewValue);
+                    // important!
+                    controller.$render();
+
+                    // Not sure if I should just check for !isSelect OR if I should check for 'tags' key
+                    if (!opts.initSelection && !isSelect)
+                        controller.$setViewValue(
+                            convertToAngularModel(elm.select2('data')));
+                });
+            };
+        }
+    };
+}]);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/LICENSE b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/LICENSE
new file mode 100644
index 0000000000..3c98f3df42
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/LICENSE
@@ -0,0 +1,18 @@
+Copyright 2012 Igor Vaynberg
+
+Version: @@ver@@ Timestamp: @@timestamp@@
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/README.md b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/README.md
new file mode 100644
index 0000000000..cb0be3c6ea
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/README.md
@@ -0,0 +1,83 @@
+Select2
+=======
+
+Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
+
+To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
+
+Use cases
+---------
+
+* Enhancing native selects with search.
+* Enhancing native selects with a better multi-select interface.
+* Loading data from JavaScript: easily load items via ajax and have them searchable.
+* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
+* Tagging: ability to add new items on the fly.
+* Working with large, remote datasets: ability to partially load a dataset based on the search term.
+* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
+* Templating: support for custom rendering of results and selections.
+
+Browser compatibility
+---------------------
+* IE 8+
+* Chrome 8+
+* Firefox 10+
+* Safari 3+
+* Opera 10.6+
+
+Integrations
+------------
+
+* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
+* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
+* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org))
+* [Django](https://github.com/applegrew/django-select2)
+* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
+* [Bootstrap](https://github.com/t0m/select2-bootstrap-css) (CSS skin)
+* [Yii](https://github.com/tonybolzan/yii-select2)
+
+Internationalization (i18n)
+---------------------------
+
+Select2 supports multiple languages by simply including the right
+language JS file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.).
+
+Missing a language? Just copy `select2_locale_en.js.template`, translate
+it, and make a pull request back to Select2 here on GitHub.
+
+Bug tracker
+-----------
+
+Have a bug? Please create an issue here on GitHub!
+
+https://github.com/ivaynberg/select2/issues
+
+Mailing list
+------------
+
+Have a question? Ask on our mailing list!
+
+select2@googlegroups.com
+
+https://groups.google.com/d/forum/select2
+
+
+Copyright and license
+---------------------
+
+Copyright 2012 Igor Vaynberg
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/component.json b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/component.json
new file mode 100644
index 0000000000..ec475661c5
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/component.json
@@ -0,0 +1,8 @@
+{
+    "name": "select2",
+    "version": "3.4.1",
+    "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
+    "dependencies": {
+        "jquery": ">= 1.7.1"
+    }
+}
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/release.sh b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/release.sh
new file mode 100755
index 0000000000..0a315abc40
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/release.sh
@@ -0,0 +1,69 @@
+#!/bin/bash
+set -e
+
+echo -n "Enter the version for this release: "
+
+read ver
+
+if [ ! $ver ]; then 
+	echo "Invalid version."
+	exit
+fi
+
+name="select2"
+js="$name.js"
+mini="$name.min.js"
+css="$name.css"
+release="$name-$ver"
+tag="$ver"
+branch="build-$ver"
+curbranch=`git branch | grep "*" | sed "s/* //"`
+timestamp=$(date)
+tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
+remote="github"
+
+echo "Updating Version Identifiers"
+
+sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i "" component.json select2.jquery.json
+git add component.json
+git add select2.jquery.json
+git commit -m "modified version identifiers in descriptors for release $ver"
+git push
+ 
+git branch "$branch"
+git checkout "$branch"
+
+echo "Tokenizing..."
+
+find . -name "$js" | xargs -I{} sed -e "$tokens" -i "" {} 
+find . -name "$css" | xargs -I{} sed -e "$tokens" -i "" {}
+sed -e "s/latest/$ver/g" -i "" component.json
+
+git add "$js"
+git add "$css"
+
+echo "Minifying..."
+
+echo "/*" > "$mini"
+cat LICENSE | sed "$tokens" >> "$mini"
+echo "*/" >> "$mini"
+
+curl -s \
+	--data-urlencode "js_code@$js" \
+	http://marijnhaverbeke.nl/uglifyjs \
+	>> "$mini"
+
+git add "$mini"
+	
+git commit -m "release $ver"
+
+echo "Tagging..."
+git tag -a "$tag" -m "tagged version $ver"
+git push "$remote" --tags
+
+echo "Cleaning Up..."
+
+git checkout "$curbranch"
+git branch -D "$branch"
+
+echo "Done"
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2-spinner.gif b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2-spinner.gif
new file mode 100644
index 0000000000000000000000000000000000000000..5b33f7e54f4e55b6b8774d86d96895db9af044b4
GIT binary patch
literal 1849
zcma*odr(tX9tZI2z31lM+(&YVk%mZ}5P~KlG2s=WSbGzm0!x7^P##Mnh7t-jP!X0Q
zk_SQ}Po-L1tlDK;6l?(>v)e5ZBQx4|Y-Q?nr@Px3?9h(3ZWr3^tj=`TP57gKr87N$
zp2wWee1GRRCwo_xahnw)5cxNPJbCg2L6DV|6`#+yw6v6!mDS$f9-JvFD^n;GQ&UrZ
zzh5jCkByB101O60U0q#p_1BM>Cv-vP?&s4@g_((4_1L=L$(a91)0=J91Gas#R{McE
znYG^9*0A5YZ>#;~+Wkn(W5B0^yELIYLP!K}mB~<)AM@1&nqekynuaEGqP<JE0#l+(
z*R9joTN$nZ{F;;f_Nv(QpzP65;W)SYC;1+?>rzoH|KodRXJy)%+w_fu3nE5>@Bd_b
zqC$EQ;{c`T&?EsNO|igL9gC7Ygxv?aQUEXMq?~>wg{EyW;VcJ37CUF#HjrT=KQO_*
zS>M9yydXk18D(+QDJ1>r);Lav_uYKp$T?4vr{Q$lTo&pKv^?(>L-)G2*lwH!Ah7k?
z7oH<8h-(KTKt5V6$8gF)C7Io&P5=SjTh)=zV=E2EUhQZ<Wjvi)ks6lL7NUI41Suec
z%#@RZvp$b|KCxLd`PA8_!Ub^;+J%TE^_K&d6(i&k---epB#nC`b3_`MdhtuWMEe%I
z(wJ2$`EGgJTz=trW>P##L8S{d%UK>>+y82>+FV+#^BzW7u3F)Bb>=lYQ%%j`F>ASe
zo*cw@V#u6T`A2He;70mR(V&iV&-7{qP~=SRf&jm9-T{*ZeZ}$rd0#6c&fLG^xJcf5
z+p<`wJYgW+_s*V{uI$nMB;%8`S_3>PfGOj3Rq}@Cx^+j?rk92fANSFDBYnOqQ>Vdj
z)(|$AhP4t&Lb=Gvo2#3Gl%9<=Gv`Mz?Po@P4iLF!x}GUWJICDlFk-hS^Whyh7x~VH
z@0vD1>HYD4&e+~yzS*-sFR{9`{QEEZO1zg7>R&7cHts-6j!xHVdA8eI+ZlVzd%`es
zJT@$#GX(gvCJ1oJN%yLBK}{V=V;seo;!w|Yte!W1%5qLNFWqvZW>h&IiH+oPT=b@E
zPhGzv5=(Un*X>v`><w7vN-j#h05gB-F9AZf<&Z~SLlC&Nz^-G6DuPj|`n3d!<l7n!
z^9j1qeh2{s+i0tZ4@>%8h_nj^NdY<en;#4d>cE6NHS_ifkCV$*D)Tqrbu`s;<=t<4
zAHNqNV?6(g<1PY-w@#I-WYFViz?9TrkMr)u0g`O`u|>T;k|2sV*YF^pun<C(O34ry
z@yg-q+#%4rv$|41Y!PHPrjmV%@S3%TUelmz%~6?hLG4%mWKO9NB}mrI%KlhB`{^!g
zT?{Y#<ON%sq<!{buD;iH%`hL}N;>vT;$SuTy{j3Gv)yqD!R_CF>yR)MzmmYS5v+~R
zXAdD<Jm>%ng9?df;wd8GxR#%3O+gz};Vo;)sK%Bj-q>Oq%R7JU-KD?vYu>#2UjaDo
z&8$>5xW~?KPD_#XFToU1hIb*VOMidUr6iYiO0N|i-7s`T8!cFT`rN!^1Pt78J93i6
z5HI1wIM$94m{3SLDvISDe6$ZG1;eq_D9RTaaC>=cO{@Bs>$IlP<c+8wUtK_tPUz3j
z)>CPJJ$h$)-3vzNUQ6<Wm&Z5JfeG_o#I^S?ZP9*QGjsiJM3jH{?94}z{@d%97nOVw
zacge+X&InNUL3U(BUlor87ff?2qEf2c|yCI=Id~LI~<KyVA#R%nwHS3S<^IBTu|Jj
zW^-Xv#UBDqOwy>OsN#_zWxey!_9%hxwH2_dEJi=yY|1c7nDm2_Lm!Cof8-R_+9UkS
zcBE(o47yE)oMR(Q=dp1a2wTX5Kv<M)VDKP@wb$5DNEX!VTUn1Pd`taYrL9bpe}d9v
zqx3tu5NTGv8=X63WXPWMm1T8=ujh#QvSw5|(EZJ3$quU9*?0NxQKGsTrnFNF-ygOt
zYWPggi66%$nuj|v6!Ow2)>vGyLqlWTa7V&!A*|w|)ax~1_~aJ0=_Lilg*0iQk7#ZD
EAHN$8j{pDw

literal 0
HcmV?d00001

diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.css b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.css
new file mode 100644
index 0000000000..48c85b4581
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.css
@@ -0,0 +1,680 @@
+/*
+Version: 3.4.1 Timestamp: Thu Jun 27 18:02:10 PDT 2013
+*/
+.select2-container {
+    margin: 0;
+    position: relative;
+    display: inline-block;
+    /* inline-block for ie7 */
+    zoom: 1;
+    *display: inline;
+    vertical-align: middle;
+}
+
+.select2-container,
+.select2-drop,
+.select2-search,
+.select2-search input{
+  /*
+    Force border-box so that % widths fit the parent
+    container without overlap because of margin/padding.
+
+    More Info : http://www.quirksmode.org/css/box.html
+  */
+  -webkit-box-sizing: border-box; /* webkit */
+   -khtml-box-sizing: border-box; /* konqueror */
+     -moz-box-sizing: border-box; /* firefox */
+      -ms-box-sizing: border-box; /* ie */
+          box-sizing: border-box; /* css3 */
+}
+
+.select2-container .select2-choice {
+    display: block;
+    height: 26px;
+    padding: 0 0 0 8px;
+    overflow: hidden;
+    position: relative;
+
+    border: 1px solid #aaa;
+    white-space: nowrap;
+    line-height: 26px;
+    color: #444;
+    text-decoration: none;
+
+    -webkit-border-radius: 4px;
+       -moz-border-radius: 4px;
+            border-radius: 4px;
+
+    -webkit-background-clip: padding-box;
+       -moz-background-clip: padding;
+            background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+       -khtml-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eeeeee), color-stop(0.5, white));
+    background-image: -webkit-linear-gradient(center bottom, #eeeeee 0%, white 50%);
+    background-image: -moz-linear-gradient(center bottom, #eeeeee 0%, white 50%);
+    background-image: -o-linear-gradient(bottom, #eeeeee 0%, #ffffff 50%);
+    background-image: -ms-linear-gradient(top, #ffffff 0%, #eeeeee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
+    background-image: linear-gradient(top, #ffffff 0%, #eeeeee 50%);
+}
+
+.select2-container.select2-drop-above .select2-choice {
+    border-bottom-color: #aaa;
+
+    -webkit-border-radius:0 0 4px 4px;
+       -moz-border-radius:0 0 4px 4px;
+            border-radius:0 0 4px 4px;
+
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eeeeee), color-stop(0.9, white));
+    background-image: -webkit-linear-gradient(center bottom, #eeeeee 0%, white 90%);
+    background-image: -moz-linear-gradient(center bottom, #eeeeee 0%, white 90%);
+    background-image: -o-linear-gradient(bottom, #eeeeee 0%, white 90%);
+    background-image: -ms-linear-gradient(top, #eeeeee 0%,#ffffff 90%);
+    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#eeeeee',GradientType=0 );
+    background-image: linear-gradient(top, #eeeeee 0%,#ffffff 90%);
+}
+
+.select2-container.select2-allowclear .select2-choice .select2-chosen {
+    margin-right: 42px;
+}
+
+.select2-container .select2-choice > .select2-chosen {
+    margin-right: 26px;
+    display: block;
+    overflow: hidden;
+
+    white-space: nowrap;
+
+    -ms-text-overflow: ellipsis;
+     -o-text-overflow: ellipsis;
+        text-overflow: ellipsis;
+}
+
+.select2-container .select2-choice abbr {
+    display: none;
+    width: 12px;
+    height: 12px;
+    position: absolute;
+    right: 24px;
+    top: 8px;
+
+    font-size: 1px;
+    text-decoration: none;
+
+    border: 0;
+    background: url('select2.png') right top no-repeat;
+    cursor: pointer;
+    outline: 0;
+}
+
+.select2-container.select2-allowclear .select2-choice abbr {
+    display: inline-block;
+}
+
+.select2-container .select2-choice abbr:hover {
+    background-position: right -11px;
+    cursor: pointer;
+}
+
+.select2-drop-undermask {
+    border: 0;
+    margin: 0;
+    padding: 0;
+    position: absolute;
+    left: 0;
+    top: 0;
+    z-index: 9998;
+    background-color: transparent;
+    filter: alpha(opacity=0);
+}
+
+.select2-drop-mask {
+    border: 0;
+    margin: 0;
+    padding: 0;
+    position: absolute;
+    left: 0;
+    top: 0;
+    z-index: 9998;
+    /* styles required for IE to work */
+    background-color: #fff;
+    opacity: 0;
+    filter: alpha(opacity=0);
+}
+
+.select2-drop {
+    width: 100%;
+    margin-top: -1px;
+    position: absolute;
+    z-index: 9999;
+    top: 100%;
+
+    background: #fff;
+    color: #000;
+    border: 1px solid #aaa;
+    border-top: 0;
+
+    -webkit-border-radius: 0 0 4px 4px;
+       -moz-border-radius: 0 0 4px 4px;
+            border-radius: 0 0 4px 4px;
+
+    -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+       -moz-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-auto-width {
+    border-top: 1px solid #aaa;
+    width: auto;
+}
+
+.select2-drop-auto-width .select2-search {
+    padding-top: 4px;
+}
+
+.select2-drop.select2-drop-above {
+    margin-top: 1px;
+    border-top: 1px solid #aaa;
+    border-bottom: 0;
+
+    -webkit-border-radius: 4px 4px 0 0;
+       -moz-border-radius: 4px 4px 0 0;
+            border-radius: 4px 4px 0 0;
+
+    -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+       -moz-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-active {
+    border: 1px solid #5897fb;
+    border-top: none;
+}
+
+.select2-drop.select2-drop-above.select2-drop-active {
+    border-top: 1px solid #5897fb;
+}
+
+.select2-container .select2-choice .select2-arrow {
+    display: inline-block;
+    width: 18px;
+    height: 100%;
+    position: absolute;
+    right: 0;
+    top: 0;
+
+    border-left: 1px solid #aaa;
+    -webkit-border-radius: 0 4px 4px 0;
+       -moz-border-radius: 0 4px 4px 0;
+            border-radius: 0 4px 4px 0;
+
+    -webkit-background-clip: padding-box;
+       -moz-background-clip: padding;
+            background-clip: padding-box;
+
+    background: #ccc;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
+    background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    background-image: -o-linear-gradient(bottom, #ccc 0%, #eee 60%);
+    background-image: -ms-linear-gradient(top, #cccccc 0%, #eeeeee 60%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
+    background-image: linear-gradient(top, #cccccc 0%, #eeeeee 60%);
+}
+
+.select2-container .select2-choice .select2-arrow b {
+    display: block;
+    width: 100%;
+    height: 100%;
+    background: url('select2.png') no-repeat 0 1px;
+}
+
+.select2-search {
+    display: inline-block;
+    width: 100%;
+    min-height: 26px;
+    margin: 0;
+    padding-left: 4px;
+    padding-right: 4px;
+
+    position: relative;
+    z-index: 10000;
+
+    white-space: nowrap;
+}
+
+.select2-search input {
+    width: 100%;
+    height: auto !important;
+    min-height: 26px;
+    padding: 4px 20px 4px 5px;
+    margin: 0;
+
+    outline: 0;
+    font-family: sans-serif;
+    font-size: 1em;
+
+    border: 1px solid #aaa;
+    -webkit-border-radius: 0;
+       -moz-border-radius: 0;
+            border-radius: 0;
+
+    -webkit-box-shadow: none;
+       -moz-box-shadow: none;
+            box-shadow: none;
+
+    background: #fff url('select2.png') no-repeat 100% -22px;
+    background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, white), color-stop(0.99, #eeeeee));
+    background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, white 85%, #eeeeee 99%);
+    background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, white 85%, #eeeeee 99%);
+    background: url('select2.png') no-repeat 100% -22px, -o-linear-gradient(bottom, white 85%, #eeeeee 99%);
+    background: url('select2.png') no-repeat 100% -22px, -ms-linear-gradient(top, #ffffff 85%, #eeeeee 99%);
+    background: url('select2.png') no-repeat 100% -22px, linear-gradient(top, #ffffff 85%, #eeeeee 99%);
+}
+
+.select2-drop.select2-drop-above .select2-search input {
+    margin-top: 4px;
+}
+
+.select2-search input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100%;
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, white), color-stop(0.99, #eeeeee));
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, white 85%, #eeeeee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, white 85%, #eeeeee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, -o-linear-gradient(bottom, white 85%, #eeeeee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, -ms-linear-gradient(top, #ffffff 85%, #eeeeee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(top, #ffffff 85%, #eeeeee 99%);
+}
+
+.select2-container-active .select2-choice,
+.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0,0,0,.3);
+       -moz-box-shadow: 0 0 5px rgba(0,0,0,.3);
+            box-shadow: 0 0 5px rgba(0,0,0,.3);
+}
+
+.select2-dropdown-open .select2-choice {
+    border-bottom-color: transparent;
+    -webkit-box-shadow: 0 1px 0 #fff inset;
+       -moz-box-shadow: 0 1px 0 #fff inset;
+            box-shadow: 0 1px 0 #fff inset;
+
+    -webkit-border-bottom-left-radius: 0;
+        -moz-border-radius-bottomleft: 0;
+            border-bottom-left-radius: 0;
+
+    -webkit-border-bottom-right-radius: 0;
+        -moz-border-radius-bottomright: 0;
+            border-bottom-right-radius: 0;
+
+    background-color: #eee;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, white), color-stop(0.5, #eeeeee));
+    background-image: -webkit-linear-gradient(center bottom, white 0%, #eeeeee 50%);
+    background-image: -moz-linear-gradient(center bottom, white 0%, #eeeeee 50%);
+    background-image: -o-linear-gradient(bottom, white 0%, #eeeeee 50%);
+    background-image: -ms-linear-gradient(top, #ffffff 0%,#eeeeee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#eeeeee', endColorstr='#ffffff',GradientType=0 );
+    background-image: linear-gradient(top, #ffffff 0%,#eeeeee 50%);
+}
+
+.select2-dropdown-open.select2-drop-above .select2-choice,
+.select2-dropdown-open.select2-drop-above .select2-choices {
+    border: 1px solid #5897fb;
+    border-top-color: transparent;
+
+    background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, white), color-stop(0.5, #eeeeee));
+    background-image: -webkit-linear-gradient(center top, white 0%, #eeeeee 50%);
+    background-image: -moz-linear-gradient(center top, white 0%, #eeeeee 50%);
+    background-image: -o-linear-gradient(top, white 0%, #eeeeee 50%);
+    background-image: -ms-linear-gradient(bottom, #ffffff 0%,#eeeeee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#eeeeee', endColorstr='#ffffff',GradientType=0 );
+    background-image: linear-gradient(bottom, #ffffff 0%,#eeeeee 50%);
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow {
+    background: transparent;
+    border-left: none;
+    filter: none;
+}
+.select2-dropdown-open .select2-choice .select2-arrow b {
+    background-position: -18px 1px;
+}
+
+/* results */
+.select2-results {
+    max-height: 200px;
+    padding: 0 0 0 4px;
+    margin: 4px 4px 4px 0;
+    position: relative;
+    overflow-x: hidden;
+    overflow-y: auto;
+    -webkit-tap-highlight-color: rgba(0,0,0,0);
+}
+
+.select2-results ul.select2-result-sub {
+    margin: 0;
+    padding-left: 0;
+}
+
+.select2-results ul.select2-result-sub > li .select2-result-label { padding-left: 20px }
+.select2-results ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 40px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 60px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 80px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 100px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 110px }
+.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 120px }
+
+.select2-results li {
+    list-style: none;
+    display: list-item;
+    background-image: none;
+}
+
+.select2-results li.select2-result-with-children > .select2-result-label {
+    font-weight: bold;
+}
+
+.select2-results .select2-result-label {
+    padding: 3px 7px 4px;
+    margin: 0;
+    cursor: pointer;
+
+    min-height: 1em;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+       -khtml-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+}
+
+.select2-results .select2-highlighted {
+    background: #3875d7;
+    color: #fff;
+}
+
+.select2-results li em {
+    background: #feffde;
+    font-style: normal;
+}
+
+.select2-results .select2-highlighted em {
+    background: transparent;
+}
+
+.select2-results .select2-highlighted ul {
+    background: white;
+    color: #000;
+}
+
+
+.select2-results .select2-no-results,
+.select2-results .select2-searching,
+.select2-results .select2-selection-limit {
+    background: #f4f4f4;
+    display: list-item;
+}
+
+/*
+disabled look for disabled choices in the results dropdown
+*/
+.select2-results .select2-disabled.select2-highlighted {
+    color: #666;
+    background: #f4f4f4;
+    display: list-item;
+    cursor: default;
+}
+.select2-results .select2-disabled {
+  background: #f4f4f4;
+  display: list-item;
+  cursor: default;
+}
+
+.select2-results .select2-selected {
+    display: none;
+}
+
+.select2-more-results.select2-active {
+    background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
+}
+
+.select2-more-results {
+    background: #f4f4f4;
+    display: list-item;
+}
+
+/* disabled styles */
+
+.select2-container.select2-container-disabled .select2-choice {
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container.select2-container-disabled .select2-choice .select2-arrow {
+    background-color: #f4f4f4;
+    background-image: none;
+    border-left: 0;
+}
+
+.select2-container.select2-container-disabled .select2-choice abbr {
+    display: none;
+}
+
+
+/* multiselect */
+
+.select2-container-multi .select2-choices {
+    height: auto !important;
+    height: 1%;
+    margin: 0;
+    padding: 0;
+    position: relative;
+
+    border: 1px solid #aaa;
+    cursor: text;
+    overflow: hidden;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eeeeee), color-stop(15%, #ffffff));
+    background-image: -webkit-linear-gradient(top, #eeeeee 1%, #ffffff 15%);
+    background-image: -moz-linear-gradient(top, #eeeeee 1%, #ffffff 15%);
+    background-image: -o-linear-gradient(top, #eeeeee 1%, #ffffff 15%);
+    background-image: -ms-linear-gradient(top, #eeeeee 1%, #ffffff 15%);
+    background-image: linear-gradient(top, #eeeeee 1%, #ffffff 15%);
+}
+
+.select2-locked {
+  padding: 3px 5px 3px 5px !important;
+}
+
+.select2-container-multi .select2-choices {
+    min-height: 26px;
+}
+
+.select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0,0,0,.3);
+       -moz-box-shadow: 0 0 5px rgba(0,0,0,.3);
+            box-shadow: 0 0 5px rgba(0,0,0,.3);
+}
+.select2-container-multi .select2-choices li {
+    float: left;
+    list-style: none;
+}
+.select2-container-multi .select2-choices .select2-search-field {
+    margin: 0;
+    padding: 0;
+    white-space: nowrap;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input {
+    padding: 5px;
+    margin: 1px 0;
+
+    font-family: sans-serif;
+    font-size: 100%;
+    color: #666;
+    outline: 0;
+    border: 0;
+    -webkit-box-shadow: none;
+       -moz-box-shadow: none;
+            box-shadow: none;
+    background: transparent !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100% !important;
+}
+
+.select2-default {
+    color: #999 !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 18px;
+    margin: 3px 0 3px 5px;
+    position: relative;
+
+    line-height: 13px;
+    color: #333;
+    cursor: default;
+    border: 1px solid #aaaaaa;
+
+    -webkit-border-radius: 3px;
+       -moz-border-radius: 3px;
+            border-radius: 3px;
+
+    -webkit-box-shadow: 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05);
+       -moz-box-shadow: 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05);
+            box-shadow: 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05);
+
+    -webkit-background-clip: padding-box;
+       -moz-background-clip: padding;
+            background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+       -khtml-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #e4e4e4;
+    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0 );
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eeeeee));
+    background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%);
+    background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%);
+    background-image: -o-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%);
+    background-image: -ms-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%);
+    background-image: linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%);
+}
+.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
+    cursor: default;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus {
+    background: #d4d4d4;
+}
+
+.select2-search-choice-close {
+    display: block;
+    width: 12px;
+    height: 13px;
+    position: absolute;
+    right: 3px;
+    top: 4px;
+
+    font-size: 1px;
+    outline: none;
+    background: url('select2.png') right top no-repeat;
+}
+
+.select2-container-multi .select2-search-choice-close {
+    left: 3px;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
+  background-position: right -11px;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
+    background-position: right -11px;
+}
+
+/* disabled styles */
+.select2-container-multi.select2-container-disabled .select2-choices{
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 5px;
+    border: 1px solid #ddd;
+    background-image: none;
+    background-color: #f4f4f4;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close {    display: none;
+    background:none;
+}
+/* end multiselect */
+
+
+.select2-result-selectable .select2-match,
+.select2-result-unselectable .select2-match {
+    text-decoration: underline;
+}
+
+.select2-offscreen, .select2-offscreen:focus {
+    clip: rect(0 0 0 0);
+    width: 1px;
+    height: 1px;
+    border: 0;
+    margin: 0;
+    padding: 0;
+    overflow: hidden;
+    position: absolute;
+    outline: 0;
+    left: 0px;
+}
+
+.select2-display-none {
+    display: none;
+}
+
+.select2-measure-scrollbar {
+    position: absolute;
+    top: -10000px;
+    left: -10000px;
+    width: 100px;
+    height: 100px;
+    overflow: scroll;
+}
+/* Retina-ize icons */
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 144dpi)  {
+  .select2-search input, .select2-search-choice-close, .select2-container .select2-choice abbr, .select2-container .select2-choice .select2-arrow b {
+      background-image: url('select2x2.png') !important;
+      background-repeat: no-repeat !important;
+      background-size: 60px 40px !important;
+  }
+  .select2-search input {
+      background-position: 100% -21px !important;
+  }
+}
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.jquery.json b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.jquery.json
new file mode 100644
index 0000000000..af9cab7ff8
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.jquery.json
@@ -0,0 +1,36 @@
+{
+    "name": "select2",
+    "title": "Select2",
+    "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+    "keywords": [
+        "select",
+        "autocomplete",
+        "typeahead",
+        "dropdown",
+        "multiselect",
+        "tag",
+        "tagging"
+    ],
+    "version": "3.4.1",
+    "author": {
+        "name": "Igor Vaynberg",
+        "url": "https://github.com/ivaynberg"
+    },
+    "licenses": [
+        {
+            "type": "Apache",
+            "url": "http://www.apache.org/licenses/LICENSE-2.0"
+        },
+        {
+            "type": "GPL v2",
+            "url": "http://www.gnu.org/licenses/gpl-2.0.html"
+        }
+    ],
+    "bugs": "https://github.com/ivaynberg/select2/issues",
+    "homepage": "http://ivaynberg.github.com/select2",
+    "docs": "http://ivaynberg.github.com/select2/",
+    "download": "https://github.com/ivaynberg/select2/tags",
+    "dependencies": {
+        "jquery": ">=1.7.1"
+    }
+}
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.js
new file mode 100644
index 0000000000..a4960714c2
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.js
@@ -0,0 +1,3137 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.4.1 Timestamp: Thu Jun 27 18:02:10 PDT 2013
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+    http://www.apache.org/licenses/LICENSE-2.0
+    http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the
+Apache License or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
+CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
+the specific language governing permissions and limitations under the Apache License and the GPL License.
+*/
+(function ($) {
+    if(typeof $.fn.each2 == "undefined") {
+        $.fn.extend({
+            /*
+            * 4-10 times faster .each replacement
+            * use it carefully, as it overrides jQuery context of element on each iteration
+            */
+            each2 : function (c) {
+                var j = $([0]), i = -1, l = this.length;
+                while (
+                    ++i < l
+                    && (j.context = j[0] = this[i])
+                    && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
+                );
+                return this;
+            }
+        });
+    }
+})(jQuery);
+
+(function ($, undefined) {
+    "use strict";
+    /*global document, window, jQuery, console */
+
+    if (window.Select2 !== undefined) {
+        return;
+    }
+
+    var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
+        lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
+
+    KEY = {
+        TAB: 9,
+        ENTER: 13,
+        ESC: 27,
+        SPACE: 32,
+        LEFT: 37,
+        UP: 38,
+        RIGHT: 39,
+        DOWN: 40,
+        SHIFT: 16,
+        CTRL: 17,
+        ALT: 18,
+        PAGE_UP: 33,
+        PAGE_DOWN: 34,
+        HOME: 36,
+        END: 35,
+        BACKSPACE: 8,
+        DELETE: 46,
+        isArrow: function (k) {
+            k = k.which ? k.which : k;
+            switch (k) {
+            case KEY.LEFT:
+            case KEY.RIGHT:
+            case KEY.UP:
+            case KEY.DOWN:
+                return true;
+            }
+            return false;
+        },
+        isControl: function (e) {
+            var k = e.which;
+            switch (k) {
+            case KEY.SHIFT:
+            case KEY.CTRL:
+            case KEY.ALT:
+                return true;
+            }
+
+            if (e.metaKey) return true;
+
+            return false;
+        },
+        isFunctionKey: function (k) {
+            k = k.which ? k.which : k;
+            return k >= 112 && k <= 123;
+        }
+    },
+    MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>";
+
+    $document = $(document);
+
+    nextUid=(function() { var counter=1; return function() { return counter++; }; }());
+
+    function indexOf(value, array) {
+        var i = 0, l = array.length;
+        for (; i < l; i = i + 1) {
+            if (equal(value, array[i])) return i;
+        }
+        return -1;
+    }
+
+    function measureScrollbar () {
+        var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
+        $template.appendTo('body');
+
+        var dim = {
+            width: $template.width() - $template[0].clientWidth,
+            height: $template.height() - $template[0].clientHeight
+        };
+        $template.remove();
+
+        return dim;
+    }
+
+    /**
+     * Compares equality of a and b
+     * @param a
+     * @param b
+     */
+    function equal(a, b) {
+        if (a === b) return true;
+        if (a === undefined || b === undefined) return false;
+        if (a === null || b === null) return false;
+        // Check whether 'a' or 'b' is a string (primitive or object).
+        // The concatenation of an empty string (+'') converts its argument to a string's primitive.
+        if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
+        if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
+        return false;
+    }
+
+    /**
+     * Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty
+     * strings
+     * @param string
+     * @param separator
+     */
+    function splitVal(string, separator) {
+        var val, i, l;
+        if (string === null || string.length < 1) return [];
+        val = string.split(separator);
+        for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]);
+        return val;
+    }
+
+    function getSideBorderPadding(element) {
+        return element.outerWidth(false) - element.width();
+    }
+
+    function installKeyUpChangeEvent(element) {
+        var key="keyup-change-value";
+        element.on("keydown", function () {
+            if ($.data(element, key) === undefined) {
+                $.data(element, key, element.val());
+            }
+        });
+        element.on("keyup", function () {
+            var val= $.data(element, key);
+            if (val !== undefined && element.val() !== val) {
+                $.removeData(element, key);
+                element.trigger("keyup-change");
+            }
+        });
+    }
+
+    $document.on("mousemove", function (e) {
+        lastMousePosition.x = e.pageX;
+        lastMousePosition.y = e.pageY;
+    });
+
+    /**
+     * filters mouse events so an event is fired only if the mouse moved.
+     *
+     * filters out mouse events that occur when mouse is stationary but
+     * the elements under the pointer are scrolled.
+     */
+    function installFilteredMouseMove(element) {
+        element.on("mousemove", function (e) {
+            var lastpos = lastMousePosition;
+            if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
+                $(e.target).trigger("mousemove-filtered", e);
+            }
+        });
+    }
+
+    /**
+     * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
+     * within the last quietMillis milliseconds.
+     *
+     * @param quietMillis number of milliseconds to wait before invoking fn
+     * @param fn function to be debounced
+     * @param ctx object to be used as this reference within fn
+     * @return debounced version of fn
+     */
+    function debounce(quietMillis, fn, ctx) {
+        ctx = ctx || undefined;
+        var timeout;
+        return function () {
+            var args = arguments;
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function() {
+                fn.apply(ctx, args);
+            }, quietMillis);
+        };
+    }
+
+    /**
+     * A simple implementation of a thunk
+     * @param formula function used to lazily initialize the thunk
+     * @return {Function}
+     */
+    function thunk(formula) {
+        var evaluated = false,
+            value;
+        return function() {
+            if (evaluated === false) { value = formula(); evaluated = true; }
+            return value;
+        };
+    };
+
+    function installDebouncedScroll(threshold, element) {
+        var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
+        element.on("scroll", function (e) {
+            if (indexOf(e.target, element.get()) >= 0) notify(e);
+        });
+    }
+
+    function focus($el) {
+        if ($el[0] === document.activeElement) return;
+
+        /* set the focus in a 0 timeout - that way the focus is set after the processing
+            of the current event has finished - which seems like the only reliable way
+            to set focus */
+        window.setTimeout(function() {
+            var el=$el[0], pos=$el.val().length, range;
+
+            $el.focus();
+
+            /* make sure el received focus so we do not error out when trying to manipulate the caret.
+                sometimes modals or others listeners may steal it after its set */
+            if ($el.is(":visible") && el === document.activeElement) {
+
+                /* after the focus is set move the caret to the end, necessary when we val()
+                    just before setting focus */
+                if(el.setSelectionRange)
+                {
+                    el.setSelectionRange(pos, pos);
+                }
+                else if (el.createTextRange) {
+                    range = el.createTextRange();
+                    range.collapse(false);
+                    range.select();
+                }
+            }
+        }, 0);
+    }
+
+    function getCursorInfo(el) {
+        el = $(el)[0];
+        var offset = 0;
+        var length = 0;
+        if ('selectionStart' in el) {
+            offset = el.selectionStart;
+            length = el.selectionEnd - offset;
+        } else if ('selection' in document) {
+            el.focus();
+            var sel = document.selection.createRange();
+            length = document.selection.createRange().text.length;
+            sel.moveStart('character', -el.value.length);
+            offset = sel.text.length - length;
+        }
+        return { offset: offset, length: length };
+    }
+
+    function killEvent(event) {
+        event.preventDefault();
+        event.stopPropagation();
+    }
+    function killEventImmediately(event) {
+        event.preventDefault();
+        event.stopImmediatePropagation();
+    }
+
+    function measureTextWidth(e) {
+        if (!sizer){
+            var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
+            sizer = $(document.createElement("div")).css({
+                position: "absolute",
+                left: "-10000px",
+                top: "-10000px",
+                display: "none",
+                fontSize: style.fontSize,
+                fontFamily: style.fontFamily,
+                fontStyle: style.fontStyle,
+                fontWeight: style.fontWeight,
+                letterSpacing: style.letterSpacing,
+                textTransform: style.textTransform,
+                whiteSpace: "nowrap"
+            });
+            sizer.attr("class","select2-sizer");
+            $("body").append(sizer);
+        }
+        sizer.text(e.val());
+        return sizer.width();
+    }
+
+    function syncCssClasses(dest, src, adapter) {
+        var classes, replacements = [], adapted;
+
+        classes = dest.attr("class");
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+            $(classes.split(" ")).each2(function() {
+                if (this.indexOf("select2-") === 0) {
+                    replacements.push(this);
+                }
+            });
+        }
+        classes = src.attr("class");
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+            $(classes.split(" ")).each2(function() {
+                if (this.indexOf("select2-") !== 0) {
+                    adapted = adapter(this);
+                    if (adapted) {
+                        replacements.push(this);
+                    }
+                }
+            });
+        }
+        dest.attr("class", replacements.join(" "));
+    }
+
+
+    function markMatch(text, term, markup, escapeMarkup) {
+        var match=text.toUpperCase().indexOf(term.toUpperCase()),
+            tl=term.length;
+
+        if (match<0) {
+            markup.push(escapeMarkup(text));
+            return;
+        }
+
+        markup.push(escapeMarkup(text.substring(0, match)));
+        markup.push("<span class='select2-match'>");
+        markup.push(escapeMarkup(text.substring(match, match + tl)));
+        markup.push("</span>");
+        markup.push(escapeMarkup(text.substring(match + tl, text.length)));
+    }
+
+    function defaultEscapeMarkup(markup) {
+        var replace_map = {
+            '\\': '&#92;',
+            '&': '&amp;',
+            '<': '&lt;',
+            '>': '&gt;',
+            '"': '&quot;',
+            "'": '&#39;',
+            "/": '&#47;'
+        };
+
+        return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
+            return replace_map[match];
+        });
+    }
+
+    /**
+     * Produces an ajax-based query function
+     *
+     * @param options object containing configuration paramters
+     * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
+     * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
+     * @param options.url url for the data
+     * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
+     * @param options.dataType request data type: ajax, jsonp, other datatatypes supported by jQuery's $.ajax function or the transport function if specified
+     * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
+     * @param options.results a function(remoteData, pageNumber) that converts data returned form the remote request to the format expected by Select2.
+     *      The expected format is an object containing the following keys:
+     *      results array of objects that will be used as choices
+     *      more (optional) boolean indicating whether there are more results available
+     *      Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
+     */
+    function ajax(options) {
+        var timeout, // current scheduled but not yet executed request
+            requestSequence = 0, // sequence used to drop out-of-order responses
+            handler = null,
+            quietMillis = options.quietMillis || 100,
+            ajaxUrl = options.url,
+            self = this;
+
+        return function (query) {
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function () {
+                requestSequence += 1; // increment the sequence
+                var requestNumber = requestSequence, // this request's sequence number
+                    data = options.data, // ajax data function
+                    url = ajaxUrl, // ajax url string or function
+                    transport = options.transport || $.fn.select2.ajaxDefaults.transport,
+                    // deprecated - to be removed in 4.0  - use params instead
+                    deprecated = {
+                        type: options.type || 'GET', // set type of request (GET or POST)
+                        cache: options.cache || false,
+                        jsonpCallback: options.jsonpCallback||undefined,
+                        dataType: options.dataType||"json"
+                    },
+                    params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
+
+                data = data ? data.call(self, query.term, query.page, query.context) : null;
+                url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
+
+                if (handler) { handler.abort(); }
+
+                if (options.params) {
+                    if ($.isFunction(options.params)) {
+                        $.extend(params, options.params.call(self));
+                    } else {
+                        $.extend(params, options.params);
+                    }
+                }
+
+                $.extend(params, {
+                    url: url,
+                    dataType: options.dataType,
+                    data: data,
+                    success: function (data) {
+                        if (requestNumber < requestSequence) {
+                            return;
+                        }
+                        // TODO - replace query.page with query so users have access to term, page, etc.
+                        var results = options.results(data, query.page);
+                        query.callback(results);
+                    }
+                });
+                handler = transport.call(self, params);
+            }, quietMillis);
+        };
+    }
+
+    /**
+     * Produces a query function that works with a local array
+     *
+     * @param options object containing configuration parameters. The options parameter can either be an array or an
+     * object.
+     *
+     * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
+     *
+     * If the object form is used ti is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
+     * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
+     * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
+     * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
+     * the text.
+     */
+    function local(options) {
+        var data = options, // data elements
+            dataText,
+            tmp,
+            text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
+
+         if ($.isArray(data)) {
+            tmp = data;
+            data = { results: tmp };
+        }
+
+         if ($.isFunction(data) === false) {
+            tmp = data;
+            data = function() { return tmp; };
+        }
+
+        var dataItem = data();
+        if (dataItem.text) {
+            text = dataItem.text;
+            // if text is not a function we assume it to be a key name
+            if (!$.isFunction(text)) {
+                dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
+                text = function (item) { return item[dataText]; };
+            }
+        }
+
+        return function (query) {
+            var t = query.term, filtered = { results: [] }, process;
+            if (t === "") {
+                query.callback(data());
+                return;
+            }
+
+            process = function(datum, collection) {
+                var group, attr;
+                datum = datum[0];
+                if (datum.children) {
+                    group = {};
+                    for (attr in datum) {
+                        if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
+                    }
+                    group.children=[];
+                    $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
+                    if (group.children.length || query.matcher(t, text(group), datum)) {
+                        collection.push(group);
+                    }
+                } else {
+                    if (query.matcher(t, text(datum), datum)) {
+                        collection.push(datum);
+                    }
+                }
+            };
+
+            $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
+            query.callback(filtered);
+        };
+    }
+
+    // TODO javadoc
+    function tags(data) {
+        var isFunc = $.isFunction(data);
+        return function (query) {
+            var t = query.term, filtered = {results: []};
+            $(isFunc ? data() : data).each(function () {
+                var isObject = this.text !== undefined,
+                    text = isObject ? this.text : this;
+                if (t === "" || query.matcher(t, text)) {
+                    filtered.results.push(isObject ? this : {id: this, text: this});
+                }
+            });
+            query.callback(filtered);
+        };
+    }
+
+    /**
+     * Checks if the formatter function should be used.
+     *
+     * Throws an error if it is not a function. Returns true if it should be used,
+     * false if no formatting should be performed.
+     *
+     * @param formatter
+     */
+    function checkFormatter(formatter, formatterName) {
+        if ($.isFunction(formatter)) return true;
+        if (!formatter) return false;
+        throw new Error(formatterName +" must be a function or a falsy value");
+    }
+
+    function evaluate(val) {
+        return $.isFunction(val) ? val() : val;
+    }
+
+    function countResults(results) {
+        var count = 0;
+        $.each(results, function(i, item) {
+            if (item.children) {
+                count += countResults(item.children);
+            } else {
+                count++;
+            }
+        });
+        return count;
+    }
+
+    /**
+     * Default tokenizer. This function uses breaks the input on substring match of any string from the
+     * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
+     * two options have to be defined in order for the tokenizer to work.
+     *
+     * @param input text user has typed so far or pasted into the search field
+     * @param selection currently selected choices
+     * @param selectCallback function(choice) callback tho add the choice to selection
+     * @param opts select2's opts
+     * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
+     */
+    function defaultTokenizer(input, selection, selectCallback, opts) {
+        var original = input, // store the original so we can compare and know if we need to tell the search to update its text
+            dupe = false, // check for whether a token we extracted represents a duplicate selected choice
+            token, // token
+            index, // position at which the separator was found
+            i, l, // looping variables
+            separator; // the matched separator
+
+        if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
+
+        while (true) {
+            index = -1;
+
+            for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
+                separator = opts.tokenSeparators[i];
+                index = input.indexOf(separator);
+                if (index >= 0) break;
+            }
+
+            if (index < 0) break; // did not find any token separator in the input string, bail
+
+            token = input.substring(0, index);
+            input = input.substring(index + separator.length);
+
+            if (token.length > 0) {
+                token = opts.createSearchChoice.call(this, token, selection);
+                if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
+                    dupe = false;
+                    for (i = 0, l = selection.length; i < l; i++) {
+                        if (equal(opts.id(token), opts.id(selection[i]))) {
+                            dupe = true; break;
+                        }
+                    }
+
+                    if (!dupe) selectCallback(token);
+                }
+            }
+        }
+
+        if (original!==input) return input;
+    }
+
+    /**
+     * Creates a new class
+     *
+     * @param superClass
+     * @param methods
+     */
+    function clazz(SuperClass, methods) {
+        var constructor = function () {};
+        constructor.prototype = new SuperClass;
+        constructor.prototype.constructor = constructor;
+        constructor.prototype.parent = SuperClass.prototype;
+        constructor.prototype = $.extend(constructor.prototype, methods);
+        return constructor;
+    }
+
+    AbstractSelect2 = clazz(Object, {
+
+        // abstract
+        bind: function (func) {
+            var self = this;
+            return function () {
+                func.apply(self, arguments);
+            };
+        },
+
+        // abstract
+        init: function (opts) {
+            var results, search, resultsSelector = ".select2-results", disabled, readonly;
+
+            // prepare options
+            this.opts = opts = this.prepareOpts(opts);
+
+            this.id=opts.id;
+
+            // destroy if called on an existing component
+            if (opts.element.data("select2") !== undefined &&
+                opts.element.data("select2") !== null) {
+                opts.element.data("select2").destroy();
+            }
+
+            this.container = this.createContainer();
+
+            this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
+            this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
+            this.container.attr("id", this.containerId);
+
+            // cache the body so future lookups are cheap
+            this.body = thunk(function() { return opts.element.closest("body"); });
+
+            syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+
+            this.container.css(evaluate(opts.containerCss));
+            this.container.addClass(evaluate(opts.containerCssClass));
+
+            this.elementTabIndex = this.opts.element.attr("tabindex");
+
+            // swap container for the element
+            this.opts.element
+                .data("select2", this)
+                .attr("tabindex", "-1")
+                .before(this.container);
+            this.container.data("select2", this);
+
+            this.dropdown = this.container.find(".select2-drop");
+            this.dropdown.addClass(evaluate(opts.dropdownCssClass));
+            this.dropdown.data("select2", this);
+
+            this.results = results = this.container.find(resultsSelector);
+            this.search = search = this.container.find("input.select2-input");
+
+            this.resultsPage = 0;
+            this.context = null;
+
+            // initialize the container
+            this.initContainer();
+
+            installFilteredMouseMove(this.results);
+            this.dropdown.on("mousemove-filtered touchstart touchmove touchend", resultsSelector, this.bind(this.highlightUnderEvent));
+
+            installDebouncedScroll(80, this.results);
+            this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
+
+            // do not propagate change event from the search field out of the component
+            $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
+            $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
+
+            // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
+            if ($.fn.mousewheel) {
+                results.mousewheel(function (e, delta, deltaX, deltaY) {
+                    var top = results.scrollTop(), height;
+                    if (deltaY > 0 && top - deltaY <= 0) {
+                        results.scrollTop(0);
+                        killEvent(e);
+                    } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
+                        results.scrollTop(results.get(0).scrollHeight - results.height());
+                        killEvent(e);
+                    }
+                });
+            }
+
+            installKeyUpChangeEvent(search);
+            search.on("keyup-change input paste", this.bind(this.updateResults));
+            search.on("focus", function () { search.addClass("select2-focused"); });
+            search.on("blur", function () { search.removeClass("select2-focused");});
+
+            this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
+                if ($(e.target).closest(".select2-result-selectable").length > 0) {
+                    this.highlightUnderEvent(e);
+                    this.selectHighlighted(e);
+                }
+            }));
+
+            // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
+            // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
+            // dom it will trigger the popup close, which is not what we want
+            this.dropdown.on("click mouseup mousedown", function (e) { e.stopPropagation(); });
+
+            if ($.isFunction(this.opts.initSelection)) {
+                // initialize selection based on the current value of the source element
+                this.initSelection();
+
+                // if the user has provided a function that can set selection based on the value of the source element
+                // we monitor the change event on the element and trigger it, allowing for two way synchronization
+                this.monitorSource();
+            }
+
+            if (opts.maximumInputLength !== null) {
+                this.search.attr("maxlength", opts.maximumInputLength);
+            }
+
+            var disabled = opts.element.prop("disabled");
+            if (disabled === undefined) disabled = false;
+            this.enable(!disabled);
+
+            var readonly = opts.element.prop("readonly");
+            if (readonly === undefined) readonly = false;
+            this.readonly(readonly);
+
+            // Calculate size of scrollbar
+            scrollBarDimensions = scrollBarDimensions || measureScrollbar();
+
+            this.autofocus = opts.element.prop("autofocus")
+            opts.element.prop("autofocus", false);
+            if (this.autofocus) this.focus();
+        },
+
+        // abstract
+        destroy: function () {
+            var element=this.opts.element, select2 = element.data("select2");
+
+            if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+
+            if (select2 !== undefined) {
+                select2.container.remove();
+                select2.dropdown.remove();
+                element
+                    .removeClass("select2-offscreen")
+                    .removeData("select2")
+                    .off(".select2")
+                    .prop("autofocus", this.autofocus || false);
+                if (this.elementTabIndex) {
+                    element.attr({tabindex: this.elementTabIndex});
+                } else {
+                    element.removeAttr("tabindex");
+                }
+                element.show();
+            }
+        },
+
+        // abstract
+        optionToData: function(element) {
+            if (element.is("option")) {
+                return {
+                    id:element.prop("value"),
+                    text:element.text(),
+                    element: element.get(),
+                    css: element.attr("class"),
+                    disabled: element.prop("disabled"),
+                    locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
+                };
+            } else if (element.is("optgroup")) {
+                return {
+                    text:element.attr("label"),
+                    children:[],
+                    element: element.get(),
+                    css: element.attr("class")
+                };
+            }
+        },
+
+        // abstract
+        prepareOpts: function (opts) {
+            var element, select, idKey, ajaxUrl, self = this;
+
+            element = opts.element;
+
+            if (element.get(0).tagName.toLowerCase() === "select") {
+                this.select = select = opts.element;
+            }
+
+            if (select) {
+                // these options are not allowed when attached to a select because they are picked up off the element itself
+                $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
+                    if (this in opts) {
+                        throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
+                    }
+                });
+            }
+
+            opts = $.extend({}, {
+                populateResults: function(container, results, query) {
+                    var populate,  data, result, children, id=this.opts.id;
+
+                    populate=function(results, container, depth) {
+
+                        var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
+
+                        results = opts.sortResults(results, container, query);
+
+                        for (i = 0, l = results.length; i < l; i = i + 1) {
+
+                            result=results[i];
+
+                            disabled = (result.disabled === true);
+                            selectable = (!disabled) && (id(result) !== undefined);
+
+                            compound=result.children && result.children.length > 0;
+
+                            node=$("<li></li>");
+                            node.addClass("select2-results-dept-"+depth);
+                            node.addClass("select2-result");
+                            node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
+                            if (disabled) { node.addClass("select2-disabled"); }
+                            if (compound) { node.addClass("select2-result-with-children"); }
+                            node.addClass(self.opts.formatResultCssClass(result));
+
+                            label=$(document.createElement("div"));
+                            label.addClass("select2-result-label");
+
+                            formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
+                            if (formatted!==undefined) {
+                                label.html(formatted);
+                            }
+
+                            node.append(label);
+
+                            if (compound) {
+
+                                innerContainer=$("<ul></ul>");
+                                innerContainer.addClass("select2-result-sub");
+                                populate(result.children, innerContainer, depth+1);
+                                node.append(innerContainer);
+                            }
+
+                            node.data("select2-data", result);
+                            container.append(node);
+                        }
+                    };
+
+                    populate(results, container, 0);
+                }
+            }, $.fn.select2.defaults, opts);
+
+            if (typeof(opts.id) !== "function") {
+                idKey = opts.id;
+                opts.id = function (e) { return e[idKey]; };
+            }
+
+            if ($.isArray(opts.element.data("select2Tags"))) {
+                if ("tags" in opts) {
+                    throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
+                }
+                opts.tags=opts.element.data("select2Tags");
+            }
+
+            if (select) {
+                opts.query = this.bind(function (query) {
+                    var data = { results: [], more: false },
+                        term = query.term,
+                        children, placeholderOption, process;
+
+                    process=function(element, collection) {
+                        var group;
+                        if (element.is("option")) {
+                            if (query.matcher(term, element.text(), element)) {
+                                collection.push(self.optionToData(element));
+                            }
+                        } else if (element.is("optgroup")) {
+                            group=self.optionToData(element);
+                            element.children().each2(function(i, elm) { process(elm, group.children); });
+                            if (group.children.length>0) {
+                                collection.push(group);
+                            }
+                        }
+                    };
+
+                    children=element.children();
+
+                    // ignore the placeholder option if there is one
+                    if (this.getPlaceholder() !== undefined && children.length > 0) {
+                        placeholderOption = this.getPlaceholderOption();
+                        if (placeholderOption) {
+                            children=children.not(placeholderOption);
+                        }
+                    }
+
+                    children.each2(function(i, elm) { process(elm, data.results); });
+
+                    query.callback(data);
+                });
+                // this is needed because inside val() we construct choices from options and there id is hardcoded
+                opts.id=function(e) { return e.id; };
+                opts.formatResultCssClass = function(data) { return data.css; };
+            } else {
+                if (!("query" in opts)) {
+
+                    if ("ajax" in opts) {
+                        ajaxUrl = opts.element.data("ajax-url");
+                        if (ajaxUrl && ajaxUrl.length > 0) {
+                            opts.ajax.url = ajaxUrl;
+                        }
+                        opts.query = ajax.call(opts.element, opts.ajax);
+                    } else if ("data" in opts) {
+                        opts.query = local(opts.data);
+                    } else if ("tags" in opts) {
+                        opts.query = tags(opts.tags);
+                        if (opts.createSearchChoice === undefined) {
+                            opts.createSearchChoice = function (term) { return {id: term, text: term}; };
+                        }
+                        if (opts.initSelection === undefined) {
+                            opts.initSelection = function (element, callback) {
+                                var data = [];
+                                $(splitVal(element.val(), opts.separator)).each(function () {
+                                    var id = this, text = this, tags=opts.tags;
+                                    if ($.isFunction(tags)) tags=tags();
+                                    $(tags).each(function() { if (equal(this.id, id)) { text = this.text; return false; } });
+                                    data.push({id: id, text: text});
+                                });
+
+                                callback(data);
+                            };
+                        }
+                    }
+                }
+            }
+            if (typeof(opts.query) !== "function") {
+                throw "query function not defined for Select2 " + opts.element.attr("id");
+            }
+
+            return opts;
+        },
+
+        /**
+         * Monitor the original element for changes and update select2 accordingly
+         */
+        // abstract
+        monitorSource: function () {
+            var el = this.opts.element, sync;
+
+            el.on("change.select2", this.bind(function (e) {
+                if (this.opts.element.data("select2-change-triggered") !== true) {
+                    this.initSelection();
+                }
+            }));
+
+            sync = this.bind(function () {
+
+                var enabled, readonly, self = this;
+
+                // sync enabled state
+                var disabled = el.prop("disabled");
+                if (disabled === undefined) disabled = false;
+                this.enable(!disabled);
+
+                var readonly = el.prop("readonly");
+                if (readonly === undefined) readonly = false;
+                this.readonly(readonly);
+
+                syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+                this.container.addClass(evaluate(this.opts.containerCssClass));
+
+                syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+                this.dropdown.addClass(evaluate(this.opts.dropdownCssClass));
+
+            });
+
+            // mozilla and IE
+            el.on("propertychange.select2 DOMAttrModified.select2", sync);
+
+
+            // hold onto a reference of the callback to work around a chromium bug
+            if (this.mutationCallback === undefined) {
+                this.mutationCallback = function (mutations) {
+                    mutations.forEach(sync);
+                }
+            }
+
+            // safari and chrome
+            if (typeof WebKitMutationObserver !== "undefined") {
+                if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+                this.propertyObserver = new WebKitMutationObserver(this.mutationCallback);
+                this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
+            }
+        },
+
+        // abstract
+        triggerSelect: function(data) {
+            var evt = $.Event("select2-selecting", { val: this.id(data), object: data });
+            this.opts.element.trigger(evt);
+            return !evt.isDefaultPrevented();
+        },
+
+        /**
+         * Triggers the change event on the source element
+         */
+        // abstract
+        triggerChange: function (details) {
+
+            details = details || {};
+            details= $.extend({}, details, { type: "change", val: this.val() });
+            // prevents recursive triggering
+            this.opts.element.data("select2-change-triggered", true);
+            this.opts.element.trigger(details);
+            this.opts.element.data("select2-change-triggered", false);
+
+            // some validation frameworks ignore the change event and listen instead to keyup, click for selects
+            // so here we trigger the click event manually
+            this.opts.element.click();
+
+            // ValidationEngine ignorea the change event and listens instead to blur
+            // so here we trigger the blur event manually if so desired
+            if (this.opts.blurOnChange)
+                this.opts.element.blur();
+        },
+
+        //abstract
+        isInterfaceEnabled: function()
+        {
+            return this.enabledInterface === true;
+        },
+
+        // abstract
+        enableInterface: function() {
+            var enabled = this._enabled && !this._readonly,
+                disabled = !enabled;
+
+            if (enabled === this.enabledInterface) return false;
+
+            this.container.toggleClass("select2-container-disabled", disabled);
+            this.close();
+            this.enabledInterface = enabled;
+
+            return true;
+        },
+
+        // abstract
+        enable: function(enabled) {
+            if (enabled === undefined) enabled = true;
+            if (this._enabled === enabled) return false;
+            this._enabled = enabled;
+
+            this.opts.element.prop("disabled", !enabled);
+            this.enableInterface();
+            return true;
+        },
+
+        // abstract
+        readonly: function(enabled) {
+            if (enabled === undefined) enabled = false;
+            if (this._readonly === enabled) return false;
+            this._readonly = enabled;
+
+            this.opts.element.prop("readonly", enabled);
+            this.enableInterface();
+            return true;
+        },
+
+        // abstract
+        opened: function () {
+            return this.container.hasClass("select2-dropdown-open");
+        },
+
+        // abstract
+        positionDropdown: function() {
+            var $dropdown = this.dropdown,
+                offset = this.container.offset(),
+                height = this.container.outerHeight(false),
+                width = this.container.outerWidth(false),
+                dropHeight = $dropdown.outerHeight(false),
+                viewPortRight = $(window).scrollLeft() + $(window).width(),
+                viewportBottom = $(window).scrollTop() + $(window).height(),
+                dropTop = offset.top + height,
+                dropLeft = offset.left,
+                enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
+                enoughRoomAbove = (offset.top - dropHeight) >= this.body().scrollTop(),
+                dropWidth = $dropdown.outerWidth(false),
+                enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight,
+                aboveNow = $dropdown.hasClass("select2-drop-above"),
+                bodyOffset,
+                above,
+                css,
+                resultsListNode;
+
+            if (this.opts.dropdownAutoWidth) {
+                resultsListNode = $('.select2-results', $dropdown)[0];
+                $dropdown.addClass('select2-drop-auto-width');
+                $dropdown.css('width', '');
+                // Add scrollbar width to dropdown if vertical scrollbar is present
+                dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
+                dropWidth > width ? width = dropWidth : dropWidth = width;
+                enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
+            }
+            else {
+                this.container.removeClass('select2-drop-auto-width');
+            }
+
+            //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
+            //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body().scrollTop(), "enough?", enoughRoomAbove);
+
+            // fix positioning when body has an offset and is not position: static
+            if (this.body().css('position') !== 'static') {
+                bodyOffset = this.body().offset();
+                dropTop -= bodyOffset.top;
+                dropLeft -= bodyOffset.left;
+            }
+
+            // always prefer the current above/below alignment, unless there is not enough room
+            if (aboveNow) {
+                above = true;
+                if (!enoughRoomAbove && enoughRoomBelow) above = false;
+            } else {
+                above = false;
+                if (!enoughRoomBelow && enoughRoomAbove) above = true;
+            }
+
+            if (!enoughRoomOnRight) {
+               dropLeft = offset.left + width - dropWidth;
+            }
+
+            if (above) {
+                dropTop = offset.top - dropHeight;
+                this.container.addClass("select2-drop-above");
+                $dropdown.addClass("select2-drop-above");
+            }
+            else {
+                this.container.removeClass("select2-drop-above");
+                $dropdown.removeClass("select2-drop-above");
+            }
+
+            css = $.extend({
+                top: dropTop,
+                left: dropLeft,
+                width: width
+            }, evaluate(this.opts.dropdownCss));
+
+            $dropdown.css(css);
+        },
+
+        // abstract
+        shouldOpen: function() {
+            var event;
+
+            if (this.opened()) return false;
+
+            if (this._enabled === false || this._readonly === true) return false;
+
+            event = $.Event("select2-opening");
+            this.opts.element.trigger(event);
+            return !event.isDefaultPrevented();
+        },
+
+        // abstract
+        clearDropdownAlignmentPreference: function() {
+            // clear the classes used to figure out the preference of where the dropdown should be opened
+            this.container.removeClass("select2-drop-above");
+            this.dropdown.removeClass("select2-drop-above");
+        },
+
+        /**
+         * Opens the dropdown
+         *
+         * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
+         * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
+         */
+        // abstract
+        open: function () {
+
+            if (!this.shouldOpen()) return false;
+
+            this.opening();
+
+            return true;
+        },
+
+        /**
+         * Performs the opening of the dropdown
+         */
+        // abstract
+        opening: function() {
+            var cid = this.containerId,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid,
+                mask, maskCss;
+
+            this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
+
+            this.clearDropdownAlignmentPreference();
+
+            if(this.dropdown[0] !== this.body().children().last()[0]) {
+                this.dropdown.detach().appendTo(this.body());
+            }
+
+            // create the dropdown mask if doesnt already exist
+            mask = $("#select2-drop-mask");
+            if (mask.length == 0) {
+                mask = $(document.createElement("div"));
+                mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
+                mask.hide();
+                mask.appendTo(this.body());
+                mask.on("mousedown touchstart click", function (e) {
+                    var dropdown = $("#select2-drop"), self;
+                    if (dropdown.length > 0) {
+                        self=dropdown.data("select2");
+                        if (self.opts.selectOnBlur) {
+                            self.selectHighlighted({noFocus: true});
+                        }
+                        self.close();
+                        e.preventDefault();
+                        e.stopPropagation();
+                    }
+                });
+            }
+
+            // ensure the mask is always right before the dropdown
+            if (this.dropdown.prev()[0] !== mask[0]) {
+                this.dropdown.before(mask);
+            }
+
+            // move the global id to the correct dropdown
+            $("#select2-drop").removeAttr("id");
+            this.dropdown.attr("id", "select2-drop");
+
+            // show the elements
+            maskCss=_makeMaskCss();
+
+            mask.css(maskCss).show();
+
+            this.dropdown.show();
+            this.positionDropdown();
+
+            this.dropdown.addClass("select2-drop-active");
+
+            // attach listeners to events that can change the position of the container and thus require
+            // the position of the dropdown to be updated as well so it does not come unglued from the container
+            var that = this;
+            this.container.parents().add(window).each(function () {
+                $(this).on(resize+" "+scroll+" "+orient, function (e) {
+                    var maskCss=_makeMaskCss();
+                    $("#select2-drop-mask").css(maskCss);
+                    that.positionDropdown();
+                });
+            });
+
+            function _makeMaskCss() {
+                return {
+                    width  : Math.max(document.documentElement.scrollWidth,  $(window).width()),
+                    height : Math.max(document.documentElement.scrollHeight, $(window).height())
+                }
+            }
+        },
+
+        // abstract
+        close: function () {
+            if (!this.opened()) return;
+
+            var cid = this.containerId,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid;
+
+            // unbind event listeners
+            this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
+
+            this.clearDropdownAlignmentPreference();
+
+            $("#select2-drop-mask").hide();
+            this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
+            this.dropdown.hide();
+            this.container.removeClass("select2-dropdown-open");
+            this.results.empty();
+
+
+            this.clearSearch();
+            this.search.removeClass("select2-active");
+            this.opts.element.trigger($.Event("select2-close"));
+        },
+
+        /**
+         * Opens control, sets input value, and updates results.
+         */
+        // abstract
+        externalSearch: function (term) {
+            this.open();
+            this.search.val(term);
+            this.updateResults(false);
+        },
+
+        // abstract
+        clearSearch: function () {
+
+        },
+
+        //abstract
+        getMaximumSelectionSize: function() {
+            return evaluate(this.opts.maximumSelectionSize);
+        },
+
+        // abstract
+        ensureHighlightVisible: function () {
+            var results = this.results, children, index, child, hb, rb, y, more;
+
+            index = this.highlight();
+
+            if (index < 0) return;
+
+            if (index == 0) {
+
+                // if the first element is highlighted scroll all the way to the top,
+                // that way any unselectable headers above it will also be scrolled
+                // into view
+
+                results.scrollTop(0);
+                return;
+            }
+
+            children = this.findHighlightableChoices().find('.select2-result-label');
+
+            child = $(children[index]);
+
+            hb = child.offset().top + child.outerHeight(true);
+
+            // if this is the last child lets also make sure select2-more-results is visible
+            if (index === children.length - 1) {
+                more = results.find("li.select2-more-results");
+                if (more.length > 0) {
+                    hb = more.offset().top + more.outerHeight(true);
+                }
+            }
+
+            rb = results.offset().top + results.outerHeight(true);
+            if (hb > rb) {
+                results.scrollTop(results.scrollTop() + (hb - rb));
+            }
+            y = child.offset().top - results.offset().top;
+
+            // make sure the top of the element is visible
+            if (y < 0 && child.css('display') != 'none' ) {
+                results.scrollTop(results.scrollTop() + y); // y is negative
+            }
+        },
+
+        // abstract
+        findHighlightableChoices: function() {
+            return this.results.find(".select2-result-selectable:not(.select2-selected):not(.select2-disabled)");
+        },
+
+        // abstract
+        moveHighlight: function (delta) {
+            var choices = this.findHighlightableChoices(),
+                index = this.highlight();
+
+            while (index > -1 && index < choices.length) {
+                index += delta;
+                var choice = $(choices[index]);
+                if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
+                    this.highlight(index);
+                    break;
+                }
+            }
+        },
+
+        // abstract
+        highlight: function (index) {
+            var choices = this.findHighlightableChoices(),
+                choice,
+                data;
+
+            if (arguments.length === 0) {
+                return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
+            }
+
+            if (index >= choices.length) index = choices.length - 1;
+            if (index < 0) index = 0;
+
+            this.results.find(".select2-highlighted").removeClass("select2-highlighted");
+
+            choice = $(choices[index]);
+            choice.addClass("select2-highlighted");
+
+            this.ensureHighlightVisible();
+
+            data = choice.data("select2-data");
+            if (data) {
+                this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
+            }
+        },
+
+        // abstract
+        countSelectableResults: function() {
+            return this.findHighlightableChoices().length;
+        },
+
+        // abstract
+        highlightUnderEvent: function (event) {
+            var el = $(event.target).closest(".select2-result-selectable");
+            if (el.length > 0 && !el.is(".select2-highlighted")) {
+                var choices = this.findHighlightableChoices();
+                this.highlight(choices.index(el));
+            } else if (el.length == 0) {
+                // if we are over an unselectable item remove al highlights
+                this.results.find(".select2-highlighted").removeClass("select2-highlighted");
+            }
+        },
+
+        // abstract
+        loadMoreIfNeeded: function () {
+            var results = this.results,
+                more = results.find("li.select2-more-results"),
+                below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
+                offset = -1, // index of first element without data
+                page = this.resultsPage + 1,
+                self=this,
+                term=this.search.val(),
+                context=this.context;
+
+            if (more.length === 0) return;
+            below = more.offset().top - results.offset().top - results.height();
+
+            if (below <= this.opts.loadMorePadding) {
+                more.addClass("select2-active");
+                this.opts.query({
+                        element: this.opts.element,
+                        term: term,
+                        page: page,
+                        context: context,
+                        matcher: this.opts.matcher,
+                        callback: this.bind(function (data) {
+
+                    // ignore a response if the select2 has been closed before it was received
+                    if (!self.opened()) return;
+
+
+                    self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
+                    self.postprocessResults(data, false, false);
+
+                    if (data.more===true) {
+                        more.detach().appendTo(results).text(self.opts.formatLoadMore(page+1));
+                        window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                    } else {
+                        more.remove();
+                    }
+                    self.positionDropdown();
+                    self.resultsPage = page;
+                    self.context = data.context;
+                })});
+            }
+        },
+
+        /**
+         * Default tokenizer function which does nothing
+         */
+        tokenize: function() {
+
+        },
+
+        /**
+         * @param initial whether or not this is the call to this method right after the dropdown has been opened
+         */
+        // abstract
+        updateResults: function (initial) {
+            var search = this.search,
+                results = this.results,
+                opts = this.opts,
+                data,
+                self = this,
+                input,
+                term = search.val(),
+                lastTerm=$.data(this.container, "select2-last-term");
+
+            // prevent duplicate queries against the same term
+            if (initial !== true && lastTerm && equal(term, lastTerm)) return;
+
+            $.data(this.container, "select2-last-term", term);
+
+            // if the search is currently hidden we do not alter the results
+            if (initial !== true && (this.showSearchInput === false || !this.opened())) {
+                return;
+            }
+
+            function postRender() {
+                search.removeClass("select2-active");
+                self.positionDropdown();
+            }
+
+            function render(html) {
+                results.html(html);
+                postRender();
+            }
+
+            var maxSelSize = this.getMaximumSelectionSize();
+            if (maxSelSize >=1) {
+                data = this.data();
+                if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
+                    render("<li class='select2-selection-limit'>" + opts.formatSelectionTooBig(maxSelSize) + "</li>");
+                    return;
+                }
+            }
+
+            if (search.val().length < opts.minimumInputLength) {
+                if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
+                    render("<li class='select2-no-results'>" + opts.formatInputTooShort(search.val(), opts.minimumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                if (initial && this.showSearch) this.showSearch(true);
+                return;
+            }
+
+            if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
+                if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
+                    render("<li class='select2-no-results'>" + opts.formatInputTooLong(search.val(), opts.maximumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                return;
+            }
+
+            if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
+                render("<li class='select2-searching'>" + opts.formatSearching() + "</li>");
+            }
+
+            search.addClass("select2-active");
+
+            // give the tokenizer a chance to pre-process the input
+            input = this.tokenize();
+            if (input != undefined && input != null) {
+                search.val(input);
+            }
+
+            this.resultsPage = 1;
+
+            opts.query({
+                element: opts.element,
+                    term: search.val(),
+                    page: this.resultsPage,
+                    context: null,
+                    matcher: opts.matcher,
+                    callback: this.bind(function (data) {
+                var def; // default choice
+
+                // ignore a response if the select2 has been closed before it was received
+                if (!this.opened()) {
+                    this.search.removeClass("select2-active");
+                    return;
+                }
+
+                // save context, if any
+                this.context = (data.context===undefined) ? null : data.context;
+                // create a default choice and prepend it to the list
+                if (this.opts.createSearchChoice && search.val() !== "") {
+                    def = this.opts.createSearchChoice.call(self, search.val(), data.results);
+                    if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
+                        if ($(data.results).filter(
+                            function () {
+                                return equal(self.id(this), self.id(def));
+                            }).length === 0) {
+                            data.results.unshift(def);
+                        }
+                    }
+                }
+
+                if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
+                    render("<li class='select2-no-results'>" + opts.formatNoMatches(search.val()) + "</li>");
+                    return;
+                }
+
+                results.empty();
+                self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
+
+                if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
+                    results.append("<li class='select2-more-results'>" + self.opts.escapeMarkup(opts.formatLoadMore(this.resultsPage)) + "</li>");
+                    window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                }
+
+                this.postprocessResults(data, initial);
+
+                postRender();
+
+                this.opts.element.trigger({ type: "select2-loaded", items: data });
+            })});
+        },
+
+        // abstract
+        cancel: function () {
+            this.close();
+        },
+
+        // abstract
+        blur: function () {
+            // if selectOnBlur == true, select the currently highlighted option
+            if (this.opts.selectOnBlur)
+                this.selectHighlighted({noFocus: true});
+
+            this.close();
+            this.container.removeClass("select2-container-active");
+            // synonymous to .is(':focus'), which is available in jquery >= 1.6
+            if (this.search[0] === document.activeElement) { this.search.blur(); }
+            this.clearSearch();
+            this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+        },
+
+        // abstract
+        focusSearch: function () {
+            focus(this.search);
+        },
+
+        // abstract
+        selectHighlighted: function (options) {
+            var index=this.highlight(),
+                highlighted=this.results.find(".select2-highlighted"),
+                data = highlighted.closest('.select2-result').data("select2-data");
+
+            if (data) {
+                this.highlight(index);
+                this.onSelect(data, options);
+            } else if (options && options.noFocus) {
+                this.close();
+            }
+        },
+
+        // abstract
+        getPlaceholder: function () {
+            var placeholderOption;
+            return this.opts.element.attr("placeholder") ||
+                this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
+                this.opts.element.data("placeholder") ||
+                this.opts.placeholder ||
+                ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
+        },
+
+        // abstract
+        getPlaceholderOption: function() {
+            if (this.select) {
+                var firstOption = this.select.children().first();
+                if (this.opts.placeholderOption !== undefined ) {
+                    //Determine the placeholder option based on the specified placeholderOption setting
+                    return (this.opts.placeholderOption === "first" && firstOption) ||
+                           (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
+                } else if (firstOption.text() === "" && firstOption.val() === "") {
+                    //No explicit placeholder option specified, use the first if it's blank
+                    return firstOption;
+                }
+            }
+        },
+
+        /**
+         * Get the desired width for the container element.  This is
+         * derived first from option `width` passed to select2, then
+         * the inline 'style' on the original element, and finally
+         * falls back to the jQuery calculated element width.
+         */
+        // abstract
+        initContainerWidth: function () {
+            function resolveContainerWidth() {
+                var style, attrs, matches, i, l;
+
+                if (this.opts.width === "off") {
+                    return null;
+                } else if (this.opts.width === "element"){
+                    return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
+                } else if (this.opts.width === "copy" || this.opts.width === "resolve") {
+                    // check if there is inline style on the element that contains width
+                    style = this.opts.element.attr('style');
+                    if (style !== undefined) {
+                        attrs = style.split(';');
+                        for (i = 0, l = attrs.length; i < l; i = i + 1) {
+                            matches = attrs[i].replace(/\s/g, '')
+                                .match(/width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
+                            if (matches !== null && matches.length >= 1)
+                                return matches[1];
+                        }
+                    }
+
+                    if (this.opts.width === "resolve") {
+                        // next check if css('width') can resolve a width that is percent based, this is sometimes possible
+                        // when attached to input type=hidden or elements hidden via css
+                        style = this.opts.element.css('width');
+                        if (style.indexOf("%") > 0) return style;
+
+                        // finally, fallback on the calculated width of the element
+                        return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
+                    }
+
+                    return null;
+                } else if ($.isFunction(this.opts.width)) {
+                    return this.opts.width();
+                } else {
+                    return this.opts.width;
+               }
+            };
+
+            var width = resolveContainerWidth.call(this);
+            if (width !== null) {
+                this.container.css("width", width);
+            }
+        }
+    });
+
+    SingleSelect2 = clazz(AbstractSelect2, {
+
+        // single
+
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container"
+            }).html([
+                "<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>",
+                "   <span class='select2-chosen'>&nbsp;</span><abbr class='select2-search-choice-close'></abbr>",
+                "   <span class='select2-arrow'><b></b></span>",
+                "</a>",
+                "<input class='select2-focusser select2-offscreen' type='text'/>",
+                "<div class='select2-drop select2-display-none'>",
+                "   <div class='select2-search'>",
+                "       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>",
+                "   </div>",
+                "   <ul class='select2-results'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // single
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.focusser.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // single
+        opening: function () {
+            var el, range, len;
+
+            if (this.opts.minimumResultsForSearch >= 0) {
+                this.showSearch(true);
+            }
+
+            this.parent.opening.apply(this, arguments);
+
+            if (this.showSearchInput !== false) {
+                // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
+                // all other browsers handle this just fine
+
+                this.search.val(this.focusser.val());
+            }
+            this.search.focus();
+            // move the cursor to the end after focussing, otherwise it will be at the beginning and
+            // new text will appear *before* focusser.val()
+            el = this.search.get(0);
+            if (el.createTextRange) {
+                range = el.createTextRange();
+                range.collapse(false);
+                range.select();
+            } else if (el.setSelectionRange) {
+                len = this.search.val().length;
+                el.setSelectionRange(len, len);
+            }
+
+            this.focusser.prop("disabled", true).val("");
+            this.updateResults(true);
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // single
+        close: function () {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+            this.focusser.removeAttr("disabled");
+            this.focusser.focus();
+        },
+
+        // single
+        focus: function () {
+            if (this.opened()) {
+                this.close();
+            } else {
+                this.focusser.removeAttr("disabled");
+                this.focusser.focus();
+            }
+        },
+
+        // single
+        isFocused: function () {
+            return this.container.hasClass("select2-container-active");
+        },
+
+        // single
+        cancel: function () {
+            this.parent.cancel.apply(this, arguments);
+            this.focusser.removeAttr("disabled");
+            this.focusser.focus();
+        },
+
+        // single
+        initContainer: function () {
+
+            var selection,
+                container = this.container,
+                dropdown = this.dropdown;
+
+            if (this.opts.minimumResultsForSearch < 0) {
+                this.showSearch(false);
+            } else {
+                this.showSearch(true);
+            }
+
+            this.selection = selection = container.find(".select2-choice");
+
+            this.focusser = container.find(".select2-focusser");
+
+            // rewrite labels from original element to focusser
+            this.focusser.attr("id", "s2id_autogen"+nextUid());
+
+            $("label[for='" + this.opts.element.attr("id") + "']")
+                .attr('for', this.focusser.attr('id'));
+
+            this.focusser.attr("tabindex", this.elementTabIndex);
+
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                    return;
+                }
+
+                switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus: true});
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                }
+            }));
+
+            this.search.on("blur", this.bind(function(e) {
+                // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
+                // without this the search field loses focus which is annoying
+                if (document.activeElement === this.body().get(0)) {
+                    window.setTimeout(this.bind(function() {
+                        this.search.focus();
+                    }), 0);
+                }
+            }));
+
+            this.focusser.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DOWN || e.which == KEY.UP
+                    || (e.which == KEY.ENTER && this.opts.openOnEnter)) {
+
+                    if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
+
+                    this.open();
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
+                    if (this.opts.allowClear) {
+                        this.clear();
+                    }
+                    killEvent(e);
+                    return;
+                }
+            }));
+
+
+            installKeyUpChangeEvent(this.focusser);
+            this.focusser.on("keyup-change input", this.bind(function(e) {
+                if (this.opts.minimumResultsForSearch >= 0) {
+                    e.stopPropagation();
+                    if (this.opened()) return;
+                    this.open();
+                }
+            }));
+
+            selection.on("mousedown", "abbr", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+                this.clear();
+                killEventImmediately(e);
+                this.close();
+                this.selection.focus();
+            }));
+
+            selection.on("mousedown", this.bind(function (e) {
+
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+
+                if (this.opened()) {
+                    this.close();
+                } else if (this.isInterfaceEnabled()) {
+                    this.open();
+                }
+
+                killEvent(e);
+            }));
+
+            dropdown.on("mousedown", this.bind(function() { this.search.focus(); }));
+
+            selection.on("focus", this.bind(function(e) {
+                killEvent(e);
+            }));
+
+            this.focusser.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            })).on("blur", this.bind(function() {
+                if (!this.opened()) {
+                    this.container.removeClass("select2-container-active");
+                    this.opts.element.trigger($.Event("select2-blur"));
+                }
+            }));
+            this.search.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.addClass("select2-offscreen");
+            this.setPlaceholder();
+
+        },
+
+        // single
+        clear: function(triggerChange) {
+            var data=this.selection.data("select2-data");
+            if (data) { // guard against queued quick consecutive clicks
+                var placeholderOption = this.getPlaceholderOption();
+                this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
+                this.selection.find(".select2-chosen").empty();
+                this.selection.removeData("select2-data");
+                this.setPlaceholder();
+
+                if (triggerChange !== false){
+                    this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+                    this.triggerChange({removed:data});
+                }
+            }
+        },
+
+        /**
+         * Sets selection based on source element's value
+         */
+        // single
+        initSelection: function () {
+            var selected;
+            if (this.isPlaceholderOptionSelected()) {
+                this.updateSelection([]);
+                this.close();
+                this.setPlaceholder();
+            } else {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(selected){
+                    if (selected !== undefined && selected !== null) {
+                        self.updateSelection(selected);
+                        self.close();
+                        self.setPlaceholder();
+                    }
+                });
+            }
+        },
+
+        isPlaceholderOptionSelected: function() {
+            var placeholderOption;
+            return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.is(':selected')) ||
+                   (this.opts.element.val() === "") ||
+                   (this.opts.element.val() === undefined) ||
+                   (this.opts.element.val() === null);
+        },
+
+        // single
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install the selection initializer
+                opts.initSelection = function (element, callback) {
+                    var selected = element.find(":selected");
+                    // a single select box always has a value, no need to null check 'selected'
+                    callback(self.optionToData(selected));
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var id = element.val();
+                    //search in data by id, storing the actual matching item
+                    var match = null;
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = equal(id, opts.id(el));
+                            if (is_match) {
+                                match = el;
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            callback(match);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        // single
+        getPlaceholder: function() {
+            // if a placeholder is specified on a single select without a valid placeholder option ignore it
+            if (this.select) {
+                if (this.getPlaceholderOption() === undefined) {
+                    return undefined;
+                }
+            }
+
+            return this.parent.getPlaceholder.apply(this, arguments);
+        },
+
+        // single
+        setPlaceholder: function () {
+            var placeholder = this.getPlaceholder();
+
+            if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
+
+                // check for a placeholder option if attached to a select
+                if (this.select && this.getPlaceholderOption() === undefined) return;
+
+                this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
+
+                this.selection.addClass("select2-default");
+
+                this.container.removeClass("select2-allowclear");
+            }
+        },
+
+        // single
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var selected = 0, self = this, showSearchInput = true;
+
+            // find the selected element in the result list
+
+            this.findHighlightableChoices().each2(function (i, elm) {
+                if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
+                    selected = i;
+                    return false;
+                }
+            });
+
+            // and highlight it
+            if (noHighlightUpdate !== false) {
+                if (initial === true && selected >= 0) {
+                    this.highlight(selected);
+                } else {
+                    this.highlight(0);
+                }
+            }
+
+            // hide the search box if this is the first we got the results and there are enough of them for search
+
+            if (initial === true) {
+                var min = this.opts.minimumResultsForSearch;
+                if (min >= 0) {
+                    this.showSearch(countResults(data.results) >= min);
+                }
+            }
+        },
+
+        // single
+        showSearch: function(showSearchInput) {
+            if (this.showSearchInput === showSearchInput) return;
+
+            this.showSearchInput = showSearchInput;
+
+            this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
+            this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
+            //add "select2-with-searchbox" to the container if search box is shown
+            $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
+        },
+
+        // single
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data)) { return; }
+
+            var old = this.opts.element.val(),
+                oldData = this.data();
+
+            this.opts.element.val(this.id(data));
+            this.updateSelection(data);
+
+            this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
+
+            this.close();
+
+            if (!options || !options.noFocus)
+                this.selection.focus();
+
+            if (!equal(old, this.id(data))) { this.triggerChange({added:data,removed:oldData}); }
+        },
+
+        // single
+        updateSelection: function (data) {
+
+            var container=this.selection.find(".select2-chosen"), formatted, cssClass;
+
+            this.selection.data("select2-data", data);
+
+            container.empty();
+            formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
+            if (formatted !== undefined) {
+                container.append(formatted);
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, container);
+            if (cssClass !== undefined) {
+                container.addClass(cssClass);
+            }
+
+            this.selection.removeClass("select2-default");
+
+            if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
+                this.container.addClass("select2-allowclear");
+            }
+        },
+
+        // single
+        val: function () {
+            var val,
+                triggerChange = false,
+                data = null,
+                self = this,
+                oldData = this.data();
+
+            if (arguments.length === 0) {
+                return this.opts.element.val();
+            }
+
+            val = arguments[0];
+
+            if (arguments.length > 1) {
+                triggerChange = arguments[1];
+            }
+
+            if (this.select) {
+                this.select
+                    .val(val)
+                    .find(":selected").each2(function (i, elm) {
+                        data = self.optionToData(elm);
+                        return false;
+                    });
+                this.updateSelection(data);
+                this.setPlaceholder();
+                if (triggerChange) {
+                    this.triggerChange({added: data, removed:oldData});
+                }
+            } else {
+                // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+                if (!val && val !== 0) {
+                    this.clear(triggerChange);
+                    return;
+                }
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("cannot call val() if initSelection() is not defined");
+                }
+                this.opts.element.val(val);
+                this.opts.initSelection(this.opts.element, function(data){
+                    self.opts.element.val(!data ? "" : self.id(data));
+                    self.updateSelection(data);
+                    self.setPlaceholder();
+                    if (triggerChange) {
+                        self.triggerChange({added: data, removed:oldData});
+                    }
+                });
+            }
+        },
+
+        // single
+        clearSearch: function () {
+            this.search.val("");
+            this.focusser.val("");
+        },
+
+        // single
+        data: function(value, triggerChange) {
+            var data;
+
+            if (arguments.length === 0) {
+                data = this.selection.data("select2-data");
+                if (data == undefined) data = null;
+                return data;
+            } else {
+                if (!value || value === "") {
+                    this.clear(triggerChange);
+                } else {
+                    data = this.data();
+                    this.opts.element.val(!value ? "" : this.id(value));
+                    this.updateSelection(value);
+                    if (triggerChange) {
+                        this.triggerChange({added: value, removed:data});
+                    }
+                }
+            }
+        }
+    });
+
+    MultiSelect2 = clazz(AbstractSelect2, {
+
+        // multi
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container select2-container-multi"
+            }).html([
+                "<ul class='select2-choices'>",
+                "  <li class='select2-search-field'>",
+                "    <input type='text' autocomplete='off' autocorrect='off' autocapitilize='off' spellcheck='false' class='select2-input'>",
+                "  </li>",
+                "</ul>",
+                "<div class='select2-drop select2-drop-multi select2-display-none'>",
+                "   <ul class='select2-results'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // multi
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            // TODO validate placeholder is a string if specified
+
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install sthe selection initializer
+                opts.initSelection = function (element, callback) {
+
+                    var data = [];
+
+                    element.find(":selected").each2(function (i, elm) {
+                        data.push(self.optionToData(elm));
+                    });
+                    callback(data);
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var ids = splitVal(element.val(), opts.separator);
+                    //search in data by array of ids, storing matching items in a list
+                    var matches = [];
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = $.grep(ids, function(id) {
+                                return equal(id, opts.id(el));
+                            }).length;
+                            if (is_match) {
+                                matches.push(el);
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            // reorder matches based on the order they appear in the ids array because right now
+                            // they are in the order in which they appear in data array
+                            var ordered = [];
+                            for (var i = 0; i < ids.length; i++) {
+                                var id = ids[i];
+                                for (var j = 0; j < matches.length; j++) {
+                                    var match = matches[j];
+                                    if (equal(id, opts.id(match))) {
+                                        ordered.push(match);
+                                        matches.splice(j, 1);
+                                        break;
+                                    }
+                                }
+                            }
+                            callback(ordered);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        selectChoice: function (choice) {
+
+            var selected = this.container.find(".select2-search-choice-focus");
+            if (selected.length && choice && choice[0] == selected[0]) {
+
+            } else {
+                if (selected.length) {
+                    this.opts.element.trigger("choice-deselected", selected);
+                }
+                selected.removeClass("select2-search-choice-focus");
+                if (choice && choice.length) {
+                    this.close();
+                    choice.addClass("select2-search-choice-focus");
+                    this.opts.element.trigger("choice-selected", choice);
+                }
+            }
+        },
+
+        // multi
+        initContainer: function () {
+
+            var selector = ".select2-choices", selection;
+
+            this.searchContainer = this.container.find(".select2-search-field");
+            this.selection = selection = this.container.find(selector);
+
+            var _this = this;
+            this.selection.on("mousedown", ".select2-search-choice", function (e) {
+                //killEvent(e);
+                _this.search[0].focus();
+                _this.selectChoice($(this));
+            })
+
+            // rewrite labels from original element to focusser
+            this.search.attr("id", "s2id_autogen"+nextUid());
+            $("label[for='" + this.opts.element.attr("id") + "']")
+                .attr('for', this.search.attr('id'));
+
+            this.search.on("input paste", this.bind(function() {
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.opened()) {
+                    this.open();
+                }
+            }));
+
+            this.search.attr("tabindex", this.elementTabIndex);
+
+            this.keydowns = 0;
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                ++this.keydowns;
+                var selected = selection.find(".select2-search-choice-focus");
+                var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
+                var next = selected.next(".select2-search-choice:not(.select2-locked)");
+                var pos = getCursorInfo(this.search);
+
+                if (selected.length &&
+                    (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
+                    var selectedChoice = selected;
+                    if (e.which == KEY.LEFT && prev.length) {
+                        selectedChoice = prev;
+                    }
+                    else if (e.which == KEY.RIGHT) {
+                        selectedChoice = next.length ? next : null;
+                    }
+                    else if (e.which === KEY.BACKSPACE) {
+                        this.unselect(selected.first());
+                        this.search.width(10);
+                        selectedChoice = prev.length ? prev : next;
+                    } else if (e.which == KEY.DELETE) {
+                        this.unselect(selected.first());
+                        this.search.width(10);
+                        selectedChoice = next.length ? next : null;
+                    } else if (e.which == KEY.ENTER) {
+                        selectedChoice = null;
+                    }
+
+                    this.selectChoice(selectedChoice);
+                    killEvent(e);
+                    if (!selectedChoice || !selectedChoice.length) {
+                        this.open();
+                    }
+                    return;
+                } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
+                    || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
+
+                    this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
+                    killEvent(e);
+                    return;
+                } else {
+                    this.selectChoice(null);
+                }
+
+                if (this.opened()) {
+                    switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus:true});
+                        this.close();
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                    }
+                }
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
+                 || e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (e.which === KEY.ENTER) {
+                    if (this.opts.openOnEnter === false) {
+                        return;
+                    } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
+                        return;
+                    }
+                }
+
+                this.open();
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                }
+
+                if (e.which === KEY.ENTER) {
+                    // prevent form from being submitted
+                    killEvent(e);
+                }
+
+            }));
+
+            this.search.on("keyup", this.bind(function (e) {
+                this.keydowns = 0;
+                this.resizeSearch();
+            })
+            );
+
+            this.search.on("blur", this.bind(function(e) {
+                this.container.removeClass("select2-container-active");
+                this.search.removeClass("select2-focused");
+                this.selectChoice(null);
+                if (!this.opened()) this.clearSearch();
+                e.stopImmediatePropagation();
+                this.opts.element.trigger($.Event("select2-blur"));
+            }));
+
+            this.container.on("click", selector, this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+                if ($(e.target).closest(".select2-search-choice").length > 0) {
+                    // clicked inside a select2 search choice, do not open
+                    return;
+                }
+                this.selectChoice(null);
+                this.clearPlaceholder();
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.open();
+                this.focusSearch();
+                e.preventDefault();
+            }));
+
+            this.container.on("focus", selector, this.bind(function () {
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+                this.dropdown.addClass("select2-drop-active");
+                this.clearPlaceholder();
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.addClass("select2-offscreen");
+
+            // set the placeholder if necessary
+            this.clearSearch();
+        },
+
+        // multi
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.search.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // multi
+        initSelection: function () {
+            var data;
+            if (this.opts.element.val() === "" && this.opts.element.text() === "") {
+                this.updateSelection([]);
+                this.close();
+                // set the placeholder if necessary
+                this.clearSearch();
+            }
+            if (this.select || this.opts.element.val() !== "") {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(data){
+                    if (data !== undefined && data !== null) {
+                        self.updateSelection(data);
+                        self.close();
+                        // set the placeholder if necessary
+                        self.clearSearch();
+                    }
+                });
+            }
+        },
+
+        // multi
+        clearSearch: function () {
+            var placeholder = this.getPlaceholder(),
+                maxWidth = this.getMaxSearchWidth();
+
+            if (placeholder !== undefined  && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
+                this.search.val(placeholder).addClass("select2-default");
+                // stretch the search box to full width of the container so as much of the placeholder is visible as possible
+                // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
+                this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
+            } else {
+                this.search.val("").width(10);
+            }
+        },
+
+        // multi
+        clearPlaceholder: function () {
+            if (this.search.hasClass("select2-default")) {
+                this.search.val("").removeClass("select2-default");
+            }
+        },
+
+        // multi
+        opening: function () {
+            this.clearPlaceholder(); // should be done before super so placeholder is not used to search
+            this.resizeSearch();
+
+            this.parent.opening.apply(this, arguments);
+
+            this.focusSearch();
+
+            this.updateResults(true);
+            this.search.focus();
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // multi
+        close: function () {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+        },
+
+        // multi
+        focus: function () {
+            this.close();
+            this.search.focus();
+        },
+
+        // multi
+        isFocused: function () {
+            return this.search.hasClass("select2-focused");
+        },
+
+        // multi
+        updateSelection: function (data) {
+            var ids = [], filtered = [], self = this;
+
+            // filter out duplicates
+            $(data).each(function () {
+                if (indexOf(self.id(this), ids) < 0) {
+                    ids.push(self.id(this));
+                    filtered.push(this);
+                }
+            });
+            data = filtered;
+
+            this.selection.find(".select2-search-choice").remove();
+            $(data).each(function () {
+                self.addSelectedChoice(this);
+            });
+            self.postprocessResults();
+        },
+
+        // multi
+        tokenize: function() {
+            var input = this.search.val();
+            input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
+            if (input != null && input != undefined) {
+                this.search.val(input);
+                if (input.length > 0) {
+                    this.open();
+                }
+            }
+
+        },
+
+        // multi
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data)) { return; }
+
+            this.addSelectedChoice(data);
+
+            this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
+
+            if (this.select || !this.opts.closeOnSelect) this.postprocessResults();
+
+            if (this.opts.closeOnSelect) {
+                this.close();
+                this.search.width(10);
+            } else {
+                if (this.countSelectableResults()>0) {
+                    this.search.width(10);
+                    this.resizeSearch();
+                    if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
+                        // if we reached max selection size repaint the results so choices
+                        // are replaced with the max selection reached message
+                        this.updateResults(true);
+                    }
+                    this.positionDropdown();
+                } else {
+                    // if nothing left to select close
+                    this.close();
+                    this.search.width(10);
+                }
+            }
+
+            // since its not possible to select an element that has already been
+            // added we do not need to check if this is a new element before firing change
+            this.triggerChange({ added: data });
+
+            if (!options || !options.noFocus)
+                this.focusSearch();
+        },
+
+        // multi
+        cancel: function () {
+            this.close();
+            this.focusSearch();
+        },
+
+        addSelectedChoice: function (data) {
+            var enableChoice = !data.locked,
+                enabledItem = $(
+                    "<li class='select2-search-choice'>" +
+                    "    <div></div>" +
+                    "    <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a>" +
+                    "</li>"),
+                disabledItem = $(
+                    "<li class='select2-search-choice select2-locked'>" +
+                    "<div></div>" +
+                    "</li>");
+            var choice = enableChoice ? enabledItem : disabledItem,
+                id = this.id(data),
+                val = this.getVal(),
+                formatted,
+                cssClass;
+
+            formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
+            if (formatted != undefined) {
+                choice.find("div").replaceWith("<div>"+formatted+"</div>");
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
+            if (cssClass != undefined) {
+                choice.addClass(cssClass);
+            }
+
+            if(enableChoice){
+              choice.find(".select2-search-choice-close")
+                  .on("mousedown", killEvent)
+                  .on("click dblclick", this.bind(function (e) {
+                  if (!this.isInterfaceEnabled()) return;
+
+                  $(e.target).closest(".select2-search-choice").fadeOut('fast', this.bind(function(){
+                      this.unselect($(e.target));
+                      this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+                      this.close();
+                      this.focusSearch();
+                  })).dequeue();
+                  killEvent(e);
+              })).on("focus", this.bind(function () {
+                  if (!this.isInterfaceEnabled()) return;
+                  this.container.addClass("select2-container-active");
+                  this.dropdown.addClass("select2-drop-active");
+              }));
+            }
+
+            choice.data("select2-data", data);
+            choice.insertBefore(this.searchContainer);
+
+            val.push(id);
+            this.setVal(val);
+        },
+
+        // multi
+        unselect: function (selected) {
+            var val = this.getVal(),
+                data,
+                index;
+
+            selected = selected.closest(".select2-search-choice");
+
+            if (selected.length === 0) {
+                throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
+            }
+
+            data = selected.data("select2-data");
+
+            if (!data) {
+                // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
+                // and invoked on an element already removed
+                return;
+            }
+
+            index = indexOf(this.id(data), val);
+
+            if (index >= 0) {
+                val.splice(index, 1);
+                this.setVal(val);
+                if (this.select) this.postprocessResults();
+            }
+            selected.remove();
+
+            this.opts.element.trigger({ type: "removed", val: this.id(data), choice: data });
+            this.triggerChange({ removed: data });
+        },
+
+        // multi
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var val = this.getVal(),
+                choices = this.results.find(".select2-result"),
+                compound = this.results.find(".select2-result-with-children"),
+                self = this;
+
+            choices.each2(function (i, choice) {
+                var id = self.id(choice.data("select2-data"));
+                if (indexOf(id, val) >= 0) {
+                    choice.addClass("select2-selected");
+                    // mark all children of the selected parent as selected
+                    choice.find(".select2-result-selectable").addClass("select2-selected");
+                }
+            });
+
+            compound.each2(function(i, choice) {
+                // hide an optgroup if it doesnt have any selectable children
+                if (!choice.is('.select2-result-selectable')
+                    && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
+                    choice.addClass("select2-selected");
+                }
+            });
+
+            if (this.highlight() == -1 && noHighlightUpdate !== false){
+                self.highlight(0);
+            }
+
+            //If all results are chosen render formatNoMAtches
+            if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
+                if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
+                    if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
+                        this.results.append("<li class='select2-no-results'>" + self.opts.formatNoMatches(self.search.val()) + "</li>");
+                    }
+                }
+            }
+
+        },
+
+        // multi
+        getMaxSearchWidth: function() {
+            return this.selection.width() - getSideBorderPadding(this.search);
+        },
+
+        // multi
+        resizeSearch: function () {
+            var minimumWidth, left, maxWidth, containerLeft, searchWidth,
+                sideBorderPadding = getSideBorderPadding(this.search);
+
+            minimumWidth = measureTextWidth(this.search) + 10;
+
+            left = this.search.offset().left;
+
+            maxWidth = this.selection.width();
+            containerLeft = this.selection.offset().left;
+
+            searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
+
+            if (searchWidth < minimumWidth) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth < 40) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth <= 0) {
+              searchWidth = minimumWidth;
+            }
+
+            this.search.width(searchWidth);
+        },
+
+        // multi
+        getVal: function () {
+            var val;
+            if (this.select) {
+                val = this.select.val();
+                return val === null ? [] : val;
+            } else {
+                val = this.opts.element.val();
+                return splitVal(val, this.opts.separator);
+            }
+        },
+
+        // multi
+        setVal: function (val) {
+            var unique;
+            if (this.select) {
+                this.select.val(val);
+            } else {
+                unique = [];
+                // filter out duplicates
+                $(val).each(function () {
+                    if (indexOf(this, unique) < 0) unique.push(this);
+                });
+                this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
+            }
+        },
+
+        // multi
+        buildChangeDetails: function (old, current) {
+            var current = current.slice(0),
+                old = old.slice(0);
+
+            // remove intersection from each array
+            for (var i = 0; i < current.length; i++) {
+                for (var j = 0; j < old.length; j++) {
+                    if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
+                        current.splice(i, 1);
+                        i--;
+                        old.splice(j, 1);
+                        j--;
+                    }
+                }
+            }
+
+            return {added: current, removed: old};
+        },
+
+
+        // multi
+        val: function (val, triggerChange) {
+            var oldData, self=this, changeDetails;
+
+            if (arguments.length === 0) {
+                return this.getVal();
+            }
+
+            oldData=this.data();
+            if (!oldData.length) oldData=[];
+
+            // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+            if (!val && val !== 0) {
+                this.opts.element.val("");
+                this.updateSelection([]);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange({added: this.data(), removed: oldData});
+                }
+                return;
+            }
+
+            // val is a list of ids
+            this.setVal(val);
+
+            if (this.select) {
+                this.opts.initSelection(this.select, this.bind(this.updateSelection));
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(oldData, this.data()));
+                }
+            } else {
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("val() cannot be called if initSelection() is not defined");
+                }
+
+                this.opts.initSelection(this.opts.element, function(data){
+                    var ids=$.map(data, self.id);
+                    self.setVal(ids);
+                    self.updateSelection(data);
+                    self.clearSearch();
+                    if (triggerChange) {
+                        self.triggerChange(this.buildChangeDetails(oldData, this.data()));
+                    }
+                });
+            }
+            this.clearSearch();
+        },
+
+        // multi
+        onSortStart: function() {
+            if (this.select) {
+                throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
+            }
+
+            // collapse search field into 0 width so its container can be collapsed as well
+            this.search.width(0);
+            // hide the container
+            this.searchContainer.hide();
+        },
+
+        // multi
+        onSortEnd:function() {
+
+            var val=[], self=this;
+
+            // show search and move it to the end of the list
+            this.searchContainer.show();
+            // make sure the search container is the last item in the list
+            this.searchContainer.appendTo(this.searchContainer.parent());
+            // since we collapsed the width in dragStarted, we resize it here
+            this.resizeSearch();
+
+            // update selection
+            this.selection.find(".select2-search-choice").each(function() {
+                val.push(self.opts.id($(this).data("select2-data")));
+            });
+            this.setVal(val);
+            this.triggerChange();
+        },
+
+        // multi
+        data: function(values, triggerChange) {
+            var self=this, ids, old;
+            if (arguments.length === 0) {
+                 return this.selection
+                     .find(".select2-search-choice")
+                     .map(function() { return $(this).data("select2-data"); })
+                     .get();
+            } else {
+                old = this.data();
+                if (!values) { values = []; }
+                ids = $.map(values, function(e) { return self.opts.id(e); });
+                this.setVal(ids);
+                this.updateSelection(values);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(old, this.data()));
+                }
+            }
+        }
+    });
+
+    $.fn.select2 = function () {
+
+        var args = Array.prototype.slice.call(arguments, 0),
+            opts,
+            select2,
+            method, value, multiple,
+            allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "readonly", "positionDropdown", "data", "search"],
+            valueMethods = ["val", "opened", "isFocused", "container", "data"],
+            methodsMap = { search: "externalSearch" };
+
+        this.each(function () {
+            if (args.length === 0 || typeof(args[0]) === "object") {
+                opts = args.length === 0 ? {} : $.extend({}, args[0]);
+                opts.element = $(this);
+
+                if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                    multiple = opts.element.prop("multiple");
+                } else {
+                    multiple = opts.multiple || false;
+                    if ("tags" in opts) {opts.multiple = multiple = true;}
+                }
+
+                select2 = multiple ? new MultiSelect2() : new SingleSelect2();
+                select2.init(opts);
+            } else if (typeof(args[0]) === "string") {
+
+                if (indexOf(args[0], allowedMethods) < 0) {
+                    throw "Unknown method: " + args[0];
+                }
+
+                value = undefined;
+                select2 = $(this).data("select2");
+                if (select2 === undefined) return;
+
+                method=args[0];
+
+                if (method === "container") {
+                    value = select2.container;
+                } else if (method === "dropdown") {
+                    value = select2.dropdown;
+                } else {
+                    if (methodsMap[method]) method = methodsMap[method];
+
+                    value = select2[method].apply(select2, args.slice(1));
+                }
+                if (indexOf(args[0], valueMethods) >= 0) {
+                    return false;
+                }
+            } else {
+                throw "Invalid arguments to select2 plugin: " + args;
+            }
+        });
+        return (value === undefined) ? this : value;
+    };
+
+    // plugin defaults, accessible to users
+    $.fn.select2.defaults = {
+        width: "copy",
+        loadMorePadding: 0,
+        closeOnSelect: true,
+        openOnEnter: true,
+        containerCss: {},
+        dropdownCss: {},
+        containerCssClass: "",
+        dropdownCssClass: "",
+        formatResult: function(result, container, query, escapeMarkup) {
+            var markup=[];
+            markMatch(result.text, query.term, markup, escapeMarkup);
+            return markup.join("");
+        },
+        formatSelection: function (data, container, escapeMarkup) {
+            return data ? escapeMarkup(data.text) : undefined;
+        },
+        sortResults: function (results, container, query) {
+            return results;
+        },
+        formatResultCssClass: function(data) {return undefined;},
+        formatSelectionCssClass: function(data, container) {return undefined;},
+        formatNoMatches: function () { return "No matches found"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Loading more results..."; },
+        formatSearching: function () { return "Searching..."; },
+        minimumResultsForSearch: 0,
+        minimumInputLength: 0,
+        maximumInputLength: null,
+        maximumSelectionSize: 0,
+        id: function (e) { return e.id; },
+        matcher: function(term, text) {
+            return (''+text).toUpperCase().indexOf((''+term).toUpperCase()) >= 0;
+        },
+        separator: ",",
+        tokenSeparators: [],
+        tokenizer: defaultTokenizer,
+        escapeMarkup: defaultEscapeMarkup,
+        blurOnChange: false,
+        selectOnBlur: false,
+        adaptContainerCssClass: function(c) { return c; },
+        adaptDropdownCssClass: function(c) { return null; }
+    };
+
+    $.fn.select2.ajaxDefaults = {
+        transport: $.ajax,
+        params: {
+            type: "GET",
+            cache: false,
+            dataType: "json"
+        }
+    };
+
+    // exports
+    window.Select2 = {
+        query: {
+            ajax: ajax,
+            local: local,
+            tags: tags
+        }, util: {
+            debounce: debounce,
+            markMatch: markMatch,
+            escapeMarkup: defaultEscapeMarkup
+        }, "class": {
+            "abstract": AbstractSelect2,
+            "single": SingleSelect2,
+            "multi": MultiSelect2
+        }
+    };
+
+}(jQuery));
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.min.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.min.js
new file mode 100644
index 0000000000..1537edca04
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.min.js
@@ -0,0 +1,22 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.4.1 Timestamp: Thu Jun 27 18:02:10 PDT 2013
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
+*/
+(function(a){a.fn.each2===void 0&&a.fn.extend({each2:function(b){for(var c=a([0]),d=-1,e=this.length;e>++d&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})})(jQuery),function(a,b){"use strict";function m(a,b){for(var c=0,d=b.length;d>c;c+=1)if(o(a,b[c]))return c;return-1}function n(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function o(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function p(b,c){var d,e,f;if(null===b||1>b.length)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function q(a){return a.outerWidth(!1)-a.width()}function r(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function s(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function t(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function u(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function v(a,b){var c=t(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){m(a.target,b.get())>=0&&c(a)})}function w(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function x(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function y(a){a.preventDefault(),a.stopPropagation()}function z(a){a.preventDefault(),a.stopImmediatePropagation()}function A(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function B(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(this))})),b.attr("class",f.join(" "))}function C(a,c,d,e){var f=a.toUpperCase().indexOf(c.toUpperCase()),g=c.length;return 0>f?(d.push(e(a)),b):(d.push(e(a.substring(0,f))),d.push("<span class='select2-match'>"),d.push(e(a.substring(f,f+g))),d.push("</span>"),d.push(e(a.substring(f+g,a.length))),b)}function D(a){var b={"\\":"&#92;","&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#47;"};return(a+"").replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function E(c){var d,e=0,f=null,g=c.quietMillis||100,h=c.url,i=this;return function(j){window.clearTimeout(d),d=window.setTimeout(function(){e+=1;var d=e,g=c.data,k=h,l=c.transport||a.fn.select2.ajaxDefaults.transport,m={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},n=a.extend({},a.fn.select2.ajaxDefaults.params,m);g=g?g.call(i,j.term,j.page,j.context):null,k="function"==typeof k?k.call(i,j.term,j.page,j.context):k,f&&f.abort(),c.params&&(a.isFunction(c.params)?a.extend(n,c.params.call(i)):a.extend(n,c.params)),a.extend(n,{url:k,dataType:c.dataType,data:g,success:function(a){if(!(e>d)){var b=c.results(a,j.page);j.callback(b)}}}),f=l.call(i,n)},g)}}function F(c){var e,f,d=c,g=function(a){return""+a.text};a.isArray(d)&&(f=d,d={results:f}),a.isFunction(d)===!1&&(f=d,d=function(){return f});var h=d();return h.text&&(g=h.text,a.isFunction(g)||(e=h.text,g=function(a){return a[e]})),function(c){var h,e=c.term,f={results:[]};return""===e?(c.callback(d()),b):(h=function(b,d){var f,i;if(b=b[0],b.children){f={};for(i in b)b.hasOwnProperty(i)&&(f[i]=b[i]);f.children=[],a(b.children).each2(function(a,b){h(b,f.children)}),(f.children.length||c.matcher(e,g(f),b))&&d.push(f)}else c.matcher(e,g(b),b)&&d.push(b)},a(d().results).each2(function(a,b){h(b,f.results)}),c.callback(f),b)}}function G(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function H(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw Error(c+" must be a function or a falsy value")}function I(b){return a.isFunction(b)?b():b}function J(b){var c=0;return a.each(b,function(a,b){b.children?c+=J(b.children):c++}),c}function K(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||1>e.tokenSeparators.length)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(o(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:b}function L(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>";j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=L(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,h,i,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=u(function(){return c.element.closest("body")}),B(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.css(I(c.containerCss)),this.container.addClass(I(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),this.dropdown.addClass(I(c.dropdownCssClass)),this.dropdown.data("select2",this),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.resultsPage=0,this.context=null,this.initContainer(),s(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),v(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),y(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),y(a))}),r(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||n(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus()},destroy:function(){var a=this.opts.element,c=a.data("select2");this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:o(a.attr("locked"),"locked")||o(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:b},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,l=this.opts.id;g=function(d,e,i){var j,k,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),j=0,k=d.length;k>j;j+=1)m=d[j],o=m.disabled===!0,n=!o&&l(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+i),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("select2-result-sub"),g(m.children,s,i+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c||("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0&&(c.ajax.url=g),c.query=E.call(c.element,c.ajax)):"data"in c?c.query=F(c.data):"tags"in c&&(c.query=G(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(a){return{id:a,text:a}}),c.initSelection===b&&(c.initSelection=function(d,e){var f=[];a(p(d.val(),c.separator)).each(function(){var d=this,e=this,g=c.tags;a.isFunction(g)&&(g=g()),a(g).each(function(){return o(this.id,d)?(e=this.text,!1):b}),f.push({id:d,text:e})}),e(f)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var d,f=a.prop("disabled");f===b&&(f=!1),this.enable(!f);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),B(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(I(this.opts.containerCssClass)),B(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(I(this.opts.dropdownCssClass))}),a.on("propertychange.select2 DOMAttrModified.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),"undefined"!=typeof WebKitMutationObserver&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new WebKitMutationObserver(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){return a===b&&(a=!0),this._enabled===a?!1:(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface(),!0)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var q,r,s,t,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window).scrollLeft()+a(window).width(),h=a(window).scrollTop()+a(window).height(),i=c.top+d,j=c.left,l=h>=i+f,m=c.top-f>=this.body().scrollTop(),n=b.outerWidth(!1),o=g>=j+n,p=b.hasClass("select2-drop-above");this.opts.dropdownAutoWidth?(t=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),n=b.outerWidth(!1)+(t.scrollHeight===t.clientHeight?0:k.width),n>e?e=n:n=e,o=g>=j+n):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(q=this.body().offset(),i-=q.top,j-=q.left),p?(r=!0,!m&&l&&(r=!1)):(r=!1,!l&&m&&(r=!0)),o||(j=c.left+e-n),r?(i=c.top-f,this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),s=a.extend({top:i,left:j,width:e},I(this.opts.dropdownCss)),b.css(s)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){function i(){return{width:Math.max(document.documentElement.scrollWidth,a(window).width()),height:Math.max(document.documentElement.scrollHeight,a(window).height())}}var f,g,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),g=i(),f.css(g).show(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var h=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){var c=i();a("#select2-drop-mask").css(c),h.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return I(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var d,e,f,g,h,i,j,c=this.results;if(e=this.highlight(),!(0>e)){if(0==e)return c.scrollTop(0),b;d=this.findHighlightableChoices().find(".select2-result-label"),f=a(d[e]),g=f.offset().top+f.outerHeight(!0),e===d.length-1&&(j=c.find("li.select2-more-results"),j.length>0&&(g=j.offset().top+j.outerHeight(!0))),h=c.offset().top+c.outerHeight(!0),g>h&&c.scrollTop(c.scrollTop()+(g-h)),i=f.offset().top-c.offset().top,0>i&&"none"!=f.css("display")&&c.scrollTop(c.scrollTop()+i)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-selected):not(.select2-disabled)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&c.length>d;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(c){var e,f,d=this.findHighlightableChoices();return 0===arguments.length?m(d.filter(".select2-highlighted")[0],d.get()):(c>=d.length&&(c=d.length-1),0>c&&(c=0),this.results.find(".select2-highlighted").removeClass("select2-highlighted"),e=a(d[c]),e.addClass("select2-highlighted"),this.ensureHighlightVisible(),f=e.data("select2-data"),f&&this.opts.element.trigger({type:"select2-highlight",val:this.id(f),choice:f}),b)},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.results.find(".select2-highlighted").removeClass("select2-highlighted")},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),e=this.resultsPage+1,f=this,g=this.search.val(),h=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),this.opts.loadMorePadding>=c&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:g,page:e,context:h,matcher:this.opts.matcher,callback:this.bind(function(c){f.opened()&&(f.opts.populateResults.call(this,a,c.results,{term:g,page:e,context:h}),f.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(f.opts.formatLoadMore(e+1)),window.setTimeout(function(){f.loadMoreIfNeeded()},10)):b.remove(),f.positionDropdown(),f.resultsPage=e,f.context=c.context)})})))},tokenize:function(){},updateResults:function(c){function l(){d.removeClass("select2-active"),h.positionDropdown()}function m(a){e.html(a),l()}var g,i,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!o(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){var n=this.getMaximumSelectionSize();if(n>=1&&(g=this.data(),a.isArray(g)&&g.length>=n&&H(f.formatSelectionTooBig,"formatSelectionTooBig")))return m("<li class='select2-selection-limit'>"+f.formatSelectionTooBig(n)+"</li>"),b;if(d.val().length<f.minimumInputLength)return H(f.formatInputTooShort,"formatInputTooShort")?m("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):m(""),c&&this.showSearch&&this.showSearch(!0),b;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return H(f.formatInputTooLong,"formatInputTooLong")?m("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):m(""),b;f.formatSearching&&0===this.findHighlightableChoices().length&&m("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;return this.opened()?(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return o(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&H(f.formatNoMatches,"formatNoMatches")?(m("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),b):(e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&H(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),l(),this.opts.element.trigger({type:"select2-loaded",items:g}),b)):(this.search.removeClass("select2-active"),b)})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){w(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children().first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(e=d[f].replace(/\s/g,"").match(/width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=L(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>","   <span class='select2-chosen'>&nbsp;</span><abbr class='select2-search-choice-close'></abbr>","   <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>","   <div class='select2-search'>","       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>","   </div>","   <ul class='select2-results'>","   </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var b,c,d;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),b=this.search.get(0),b.createTextRange?(c=b.createTextRange(),c.collapse(!1),c.select()):b.setSelectionRange&&(d=this.search.val().length,b.setSelectionRange(d,d)),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},initContainer:function(){var d,e=this.container,f=this.dropdown;0>this.opts.minimumResultsForSearch?this.showSearch(!1):this.showSearch(!0),this.selection=d=e.find(".select2-choice"),this.focusser=e.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return y(a),b;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),y(a),b;case c.ENTER:return this.selectHighlighted(),y(a),b;case c.TAB:return this.selectHighlighted({noFocus:!0}),b;case c.ESC:return this.cancel(a),y(a),b}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return y(a),b;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),y(a),b}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),y(a),b):b}})),r(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),d.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),z(a),this.close(),this.selection.focus())})),d.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),y(b)})),f.on("mousedown",this.bind(function(){this.search.focus()})),d.on("focus",this.bind(function(a){y(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(a){var b=this.selection.data("select2-data");if(b){var c=this.getPlaceholderOption();this.opts.element.val(c?c.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),a!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(b),choice:b}),this.triggerChange({removed:b}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection([]),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return(a=this.getPlaceholderOption())!==b&&a.is(":selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find(":selected");b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=o(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,c,d){var e=0,f=this;if(this.findHighlightableChoices().each2(function(a,c){return o(f.id(c.data("select2-data")),f.opts.element.val())?(e=a,!1):b}),d!==!1&&(c===!0&&e>=0?this.highlight(e):this.highlight(0)),c===!0){var h=this.opts.minimumResultsForSearch;h>=0&&this.showSearch(J(a.results)>=h)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.close(),b&&b.noFocus||this.selection.focus(),o(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),d=this.opts.formatSelection(a,c,this.opts.escapeMarkup),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")
+},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find(":selected").each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),b;if(this.opts.initSelection===b)throw Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a,c){var d;return 0===arguments.length?(d=this.selection.data("select2-data"),d==b&&(d=null),d):(a&&""!==a?(d=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),c&&this.triggerChange({added:a,removed:d})):this.clear(c),b)}}),f=L(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>","  <li class='select2-search-field'>","    <input type='text' autocomplete='off' autocorrect='off' autocapitilize='off' spellcheck='false' class='select2-input'>","  </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>","   <ul class='select2-results'>","   </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find(":selected").each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=p(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return o(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;e.length>c;c++)for(var g=e[c],h=0;f.length>h;h++){var i=f[h];if(o(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},initContainer:function(){var e,d=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=e=this.container.find(d);var f=this;this.selection.on("mousedown",".select2-search-choice",function(){f.search[0].focus(),f.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var d=e.find(".select2-search-choice-focus"),f=d.prev(".select2-search-choice:not(.select2-locked)"),g=d.next(".select2-search-choice:not(.select2-locked)"),h=x(this.search);if(d.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var i=d;return a.which==c.LEFT&&f.length?i=f:a.which==c.RIGHT?i=g.length?g:null:a.which===c.BACKSPACE?(this.unselect(d.first()),this.search.width(10),i=f.length?f:g):a.which==c.DELETE?(this.unselect(d.first()),this.search.width(10),i=g.length?g:null):a.which==c.ENTER&&(i=null),this.selectChoice(i),y(a),i&&i.length||this.open(),b}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==h.offset&&!h.length)return this.selectChoice(e.find(".select2-search-choice:not(.select2-locked)").last()),y(a),b;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),y(a),b;case c.ENTER:return this.selectHighlighted(),y(a),b;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),b;case c.ESC:return this.cancel(a),y(a),b}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&y(a),a.which===c.ENTER&&y(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",d,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",d,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){0>m(e.id(this),c)&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'>    <div></div>    <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",y).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),y(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(a){var c,d,b=this.getVal();if(a=a.closest(".select2-search-choice"),0===a.length)throw"Invalid argument: "+a+". Must be .select2-search-choice";c=a.data("select2-data"),c&&(d=m(this.id(c),b),d>=0&&(b.splice(d,1),this.setVal(b),this.select&&this.postprocessResults()),a.remove(),this.opts.element.trigger({type:"removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));m(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&H(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-q(this.search)},resizeSearch:function(){var a,b,c,d,e,f=q(this.search);a=A(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(e)},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),p(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){0>m(this,c)&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;b.length>c;c++)for(var d=0;a.length>d;d++)o(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),b;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(this.buildChangeDetails(e,this.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(c,d){var f,g,e=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(g=this.data(),c||(c=[]),f=a.map(c,function(a){return e.opts.id(a)}),this.setVal(f),this.updateSelection(c),this.clearSearch(),d&&this.triggerChange(this.buildChangeDetails(g,this.data())),b)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","readonly","positionDropdown","data","search"],l=["val","opened","isFocused","container","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple||!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(0>m(c[0],k))throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),m(c[0],l)>=0)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return C(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return(""+b).toUpperCase().indexOf((""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:K,escapeMarkup:D,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:E,local:F,tags:G},util:{debounce:t,markMatch:C,escapeMarkup:D},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.png b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2.png
new file mode 100644
index 0000000000000000000000000000000000000000..1d804ffb99699b9e030f1010314de0970b5a000d
GIT binary patch
literal 613
zcmV-r0-F7aP)<h;3K|Lk000e1NJLTq002Ay001Zm1^@s6qPv;@0006kNkl<Zc-rmR
z&r1|x9LMps2uh5F)-GaQDk#Z_4iR>#WY!I$JQV$)A5aAS1BM||2XVJl=+L1^1S1H%
zM-&lx?NZpUrHhn>fk<>POqf2sh40}xxGZfc+t+#Eb(q<Oecn6I%nq|DNy|zSyexzN
z$5AL0?&Dan9pN5UxC<ug5`<4^!bTJ!40{Z2#(M~pn1C$$pw}f`kJpeHM`McNHFyg?
zK;|>Hy9_3*1(U%t9t)QDnI#YAL(|ACV(>)>6WD-t!8tutHkdb^#3`HzoJG3A2@T`%
zA|K@o*b!`R#(7)PWrMFn2))Ca3MR4(zaT`Zr61*kZK5NPnZwQszxh$fyv3?&4c>$q
z2m=+yc0dRXRAsPDxF6sD;@rK4JGdR_``1S~o6Xi@2&aR6hcSrEp9HVRzEqVDqB<bN
zXhRETAUt&UJ4{pqo<W$!4+ziE?D9@4ilQ3gUO=XZ)oyPsiQA7akeNo#WiVk!@H1G(
zkAmgh?J@W$gqNtpN{mA2@w%j2(GYBBaKPD;E<cjsBsd99f~(<?&RR6i%jfeou7io}
z!W3j)q1|OLVRs>n<1%hR=D4e1f^ra^A|34Cjc=Gny{F(o#MrvPYgZuTJOz(n)-F<|
zj()qR;C={)N<0RRvDZ^@6ND+W*}gh-Lip(MDt!(zMSO)!j2j+*hxgzC-e3$@(O2p*
zu;+gddm(cZwXTCLx*Ky4THOa*^b^F`woveIeCK^0aR|TJ00000NkvXXu0mjfA#WC6

literal 0
HcmV?d00001

diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ar.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ar.js
new file mode 100644
index 0000000000..5ce0106315
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ar.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Arabic translation.
+ * 
+ * Author: Your Name <amedhat3@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "لا توجد نتائج"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "من فضلك أدخل " + n + " حروف أكثر"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "من فضلك أحذف  " + n + " حروف"; },
+        formatSelectionTooBig: function (limit) { return "يمكنك ان تختار " + limit + " أختيارات فقط"; },
+        formatLoadMore: function (pageNumber) { return "تحمل المذيد من النتائج ..."; },
+        formatSearching: function () { return "جاري البحث ..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ca.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ca.js
new file mode 100644
index 0000000000..bdcdaa7982
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ca.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Catalan translation.
+ * 
+ * Author: David Planella <david.planella@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
+        formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats..."; },
+        formatSearching: function () { return "S'està cercant..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_cs.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_cs.js
new file mode 100644
index 0000000000..b3c748c231
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_cs.js
@@ -0,0 +1,49 @@
+/**
+ * Select2 Czech translation.
+ * 
+ * Author: Michal Marek <ahoj@michal-marek.cz>
+ * Author - sklonovani: David Vallner <david@vallner.net>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dvě"); },
+        3: function() { return "tři"; },
+        4: function() { return "čtyři"; }
+    }
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenalezeny žádné položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím zadejte ještě jeden znak";
+            } else if (n <= 4) {
+                return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím zadejte ještě dalších "+n+" znaků";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím zadejte o jeden znak méně";
+            } else if (n <= 4) {
+                return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
+            } else {
+                return "Prosím zadejte o "+n+" znaků méně";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Můžete zvolit jen jednu položku";
+            } else if (limit <= 4) {
+                return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Můžete zvolit maximálně "+limit+" položek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítají se další výsledky..."; },
+        formatSearching: function () { return "Vyhledávání..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_da.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_da.js
new file mode 100644
index 0000000000..dbce3e1748
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_da.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Danish translation.
+ *
+ * Author: Anders Jenbo <anders@jenbo.dk>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ingen resultater fundet"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
+        formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
+        formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
+        formatSearching: function () { return "Søger…"; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_de.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_de.js
new file mode 100644
index 0000000000..01f94ed4fa
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_de.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 German translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
+        formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
+        formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse..."; },
+        formatSearching: function () { return "Suche..."; }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_el.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_el.js
new file mode 100644
index 0000000000..65b6e07c38
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_el.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Your Name <your@email>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερους χαρακτήρες" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρες" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμενο" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων..."; },
+        formatSearching: function () { return "Αναζήτηση..."; }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_en.js.template b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_en.js.template
new file mode 100644
index 0000000000..f76b37498a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_en.js.template
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Your Name <your@email>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No matches found"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Loading more results..."; },
+        formatSearching: function () { return "Searching..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_es.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_es.js
new file mode 100644
index 0000000000..1b0a021464
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_es.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Spanish translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "No se encontraron resultados"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor adicione " + n + " caracter" + (n == 1? "" : "es"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor elimine " + n + " caracter" + (n == 1? "" : "es"); },
+        formatSelectionTooBig: function (limit) { return "Solo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Cargando más resultados..."; },
+        formatSearching: function () { return "Buscando..."; }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_et.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_et.js
new file mode 100644
index 0000000000..a4045d22df
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_et.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Estonian translation.
+ *
+ * Author: Kuldar Kalvik <kuldar@kalvik.ee>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Tulemused puuduvad"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
+        formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
+        formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
+        formatSearching: function () { return "Otsin.."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_eu.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_eu.js
new file mode 100644
index 0000000000..05665f5fcd
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_eu.js
@@ -0,0 +1,43 @@
+/**
+ * Select2 Basque translation.
+ *
+ * Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+          return "Ez da bat datorrenik aurkitu";
+        },
+        formatInputTooShort: function (input, min) {
+          var n = min - input.length;
+          if (n === 1) {
+            return "Idatzi karaktere bat gehiago";
+          } else {
+            return "Idatzi " + n + " karaktere gehiago";
+          }
+        },
+        formatInputTooLong: function (input, max) {
+          var n = input.length - max;
+          if (n === 1) {
+            return "Idatzi karaktere bat gutxiago";
+          } else {
+            return "Idatzi " + n + " karaktere gutxiago";
+          }
+        },
+        formatSelectionTooBig: function (limit) {
+          if (limit === 1 ) {
+            return "Elementu bakarra hauta dezakezu";
+          } else {
+            return limit + " elementu hauta ditzakezu soilik";
+          }
+        },
+        formatLoadMore: function (pageNumber) {
+          return "Emaitza gehiago kargatzen...";
+        },
+        formatSearching: function () {
+          return "Bilatzen...";
+        }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fi.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fi.js
new file mode 100644
index 0000000000..fa0917fb7a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fi.js
@@ -0,0 +1,28 @@
+/**
+ * Select2 Finnish translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Ei tuloksia";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            return "Ole hyvä ja anna " + n + " merkkiä lisää.";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            return "Ole hyvä ja annar " + n + " merkkiä vähemmän.";
+        },
+        formatSelectionTooBig: function (limit) {
+            return "Voit valita ainoastaan " + limit + " kpl";
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Ladataan lisää tuloksia...";
+        },
+        formatSearching: function () {
+            return "Etsitään...";
+        }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fr.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fr.js
new file mode 100644
index 0000000000..f8d3e4841c
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_fr.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 French translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Aucun résultat trouvé"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Merci de saisir " + n + " caractère" + (n == 1? "" : "s") + " de plus"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Merci de supprimer " + n + " caractère" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires..."; },
+        formatSearching: function () { return "Recherche en cours..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_gl.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_gl.js
new file mode 100644
index 0000000000..1017c202e8
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_gl.js
@@ -0,0 +1,43 @@
+/**
+ * Select2 Galician translation
+ * 
+ * Author: Leandro Regueiro <leandro.regueiro@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Non se atoparon resultados";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n === 1) {
+                return "Engada un carácter";
+            } else {
+                return "Engada " + n + " caracteres";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n === 1) {
+                return "Elimine un carácter";
+            } else {
+                return "Elimine " + n + " caracteres";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit === 1 ) {
+                return "Só pode seleccionar un elemento";
+            } else {
+                return "Só pode seleccionar " + limit + " elementos";
+            }
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Cargando máis resultados...";
+        },
+        formatSearching: function () {
+            return "Buscando...";
+        }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_he.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_he.js
new file mode 100644
index 0000000000..dd72eaa633
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_he.js
@@ -0,0 +1,17 @@
+/**
+* Select2 Hebrew translation.
+*
+* Author: Yakir Sitbon <http://www.yakirs.net/>
+*/
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "לא נמצאו התאמות"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
+        formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
+        formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות..."; },
+        formatSearching: function () { return "מחפש..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hr.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hr.js
new file mode 100644
index 0000000000..b0615405eb
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hr.js
@@ -0,0 +1,42 @@
+/**
+ * Select2 Croatian translation.
+ *
+ * Author: Edi Modrić <edi.modric@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    var specialNumbers = {
+        1: function(n) { return (n % 100 != 11 ? "znak" : "znakova"); },
+        2: function(n) { return (n % 100 != 12 ? "znaka" : "znakova"); },
+        3: function(n) { return (n % 100 != 13 ? "znaka" : "znakova"); },
+        4: function(n) { return (n % 100 != 14 ? "znaka" : "znakova"); }
+    };
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nema rezultata"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            var nMod10 = n % 10;
+
+            if (nMod10 > 0 && nMod10 < 5) {
+                return "Unesite još " + n + " " + specialNumbers[nMod10](n);
+            }
+
+            return "Unesite još " + n + " znakova";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            var nMod10 = n % 10;
+
+            if (nMod10 > 0 && nMod10 < 5) {
+                return "Unesite " + n + " " + specialNumbers[nMod10](n) + " manje";
+            }
+
+            return "Unesite " + n + " znakova manje";
+        },
+        formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
+        formatLoadMore: function (pageNumber) { return "Učitavanje rezultata..."; },
+        formatSearching: function () { return "Pretraga..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hu.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hu.js
new file mode 100644
index 0000000000..572dea96de
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_hu.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Hungarian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nincs találat."; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " kerekterrel több mint kellene."; },
+        formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
+        formatLoadMore: function (pageNumber) { return "Töltés..."; },
+        formatSearching: function () { return "Keresés..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_id.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_id.js
new file mode 100644
index 0000000000..59a896ac5a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_id.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Indonesian translation.
+ * 
+ * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Mengambil data..."; },
+        formatSearching: function () { return "Mencari..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_is.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_is.js
new file mode 100644
index 0000000000..b10073b5f9
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_is.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Icelandic translation.
+ * 
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ekkert fannst"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n == 1 ? "" : "i") + " í viðbót"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n == 1 ? "" : "i"); },
+        formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
+        formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður..."; }, 
+        formatSearching: function () { return "Leita..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_it.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_it.js
new file mode 100644
index 0000000000..98369dda24
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_it.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Italian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
+        formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
+        formatLoadMore: function (pageNumber) { return "Caricamento in corso..."; },
+        formatSearching: function () { return "Ricerca..."; }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ja.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ja.js
new file mode 100644
index 0000000000..81106e78a8
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ja.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Japanese translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "該当なし"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
+        formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
+        formatLoadMore: function (pageNumber) { return "読込中･･･"; },
+        formatSearching: function () { return "検索中･･･"; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ko.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ko.js
new file mode 100644
index 0000000000..864906b6b9
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ko.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: Swen Mun <longfinfunnel@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "결과 없음"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
+        formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
+        formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
+        formatSearching: function () { return "검색 중…"; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lt.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lt.js
new file mode 100644
index 0000000000..dbb1f09d5f
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lt.js
@@ -0,0 +1,29 @@
+/**
+ * Select2 lithuanian translation.
+ * 
+ * Author: CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Atitikmenų nerasta"; },
+        formatInputTooShort: function (input, min) {
+        	var n = min - input.length,
+        	    suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'ius' : 'ių');
+        	return "Įrašykite dar " + n + " simbol" + suffix;
+        },
+        formatInputTooLong: function (input, max) {
+        	var n = input.length - max,
+        	    suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'ius' : 'ių');
+        	return "Pašalinkite " + n + " simbol" + suffix;
+        },
+        formatSelectionTooBig: function (limit) {
+        	var n = limit,
+                suffix = (n % 10 == 1) && (n % 100 != 11) ? 'ą' : (((n % 10 >= 2) && ((n % 100 < 10) || (n % 100 >= 20))) ? 'us' : 'ų');
+        	return "Jūs galite pasirinkti tik " + limit + " element" + suffix;
+        },
+        formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų..."; },
+        formatSearching: function () { return "Ieškoma..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lv.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lv.js
new file mode 100644
index 0000000000..2c05cfdab6
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_lv.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Latvian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Sakritību nav"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : (/^\d*[1]$/im.test(n)? "u" : "us")); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : (/^\d*[1]$/im.test(n)? "u" : "iem")) + " mazāk"; },
+        formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : (/^\d*[1]$/im.test(limit)? "u" : "us")); },
+        formatLoadMore: function (pageNumber) { return "Datu ielāde..."; },
+        formatSearching: function () { return "Meklēšana..."; }
+    });
+	
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_mk.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_mk.js
new file mode 100644
index 0000000000..69e3981abc
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_mk.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Macedonian translation.
+ * 
+ * Author: Marko Aleksic <psybaron@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
+        formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
+        formatLoadMore: function (pageNumber) { return "Вчитување резултати..."; },
+        formatSearching: function () { return "Пребарување..."; }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_nl.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_nl.js
new file mode 100644
index 0000000000..2ee26627c5
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_nl.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Dutch translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Geen resultaten gevonden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " meer in"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " minder in"; },
+        formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
+        formatLoadMore: function (pageNumber) { return "Meer resultaten laden..."; },
+        formatSearching: function () { return "Zoeken..."; },
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_no.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_no.js
new file mode 100644
index 0000000000..0831360f07
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_no.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 Norwegian translation.
+ *
+ * Author: Torgeir Veimo <torgeir.veimo@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Ingen treff"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
+        formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
+        formatLoadMore: function (pageNumber) { return "Laster flere resultater..."; },
+        formatSearching: function () { return "Søker..."; }
+    });
+})(jQuery);
+
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pl.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pl.js
new file mode 100644
index 0000000000..1d5b32730a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pl.js
@@ -0,0 +1,37 @@
+/**
+ * Select2 Polish translation.
+ * 
+ * Author: Jan Kondratowicz <jan@kondratowicz.pl>
+ */
+(function ($) {
+    "use strict";
+    
+    var pl_suffix = function(n) {
+        if(n == 1) return "";
+        if((n%100 > 1 && n%100 < 5) || (n%100 > 20 && n%10 > 1 && n%10 < 5)) return "i";
+        return "ów";
+    };
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () {
+            return "Brak wyników.";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            return "Wpisz jeszcze " + n + " znak" + pl_suffix(n) + ".";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            return "Wpisana fraza jest za długa o " + n + " znak" + pl_suffix(n) + ".";
+        },
+        formatSelectionTooBig: function (limit) {
+            return "Możesz zaznaczyć najwyżej " + limit + " element" + pl_suffix(limit) + ".";
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Ładowanie wyników...";
+        },
+        formatSearching: function () {
+            return "Szukanie...";
+        }
+    });
+})(jQuery);
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-BR.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-BR.js
new file mode 100644
index 0000000000..701fb7f85d
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-BR.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Brazilian Portuguese translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Informe " + n + " caracter" + (n == 1? "" : "es"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Carregando mais resultados..."; },
+        formatSearching: function () { return "Buscando..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-PT.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-PT.js
new file mode 100644
index 0000000000..008653ed75
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_pt-PT.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Portuguese (Portugal) translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " caracter" + (n == 1 ? "" : "es"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1 ? "" : "es"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "A carregar mais resultados..."; },
+        formatSearching: function () { return "A pesquisar..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ro.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ro.js
new file mode 100644
index 0000000000..88b3ac413a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ro.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Romanian translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nu a fost găsit nimic"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
+        formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
+        formatLoadMore: function (pageNumber) { return "Se încarcă..."; },
+        formatSearching: function () { return "Căutare..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ru.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ru.js
new file mode 100644
index 0000000000..3da956a8c6
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ru.js
@@ -0,0 +1,15 @@
+/**
+ * Select2 Russian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Совпадений не найдено"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Пожалуйста, введите еще " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5) ? "а" : "ов")); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Пожалуйста, введите на " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5)? "а" : "ов")) + " меньше"; },
+        formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit == 1 ? "а" : "ов"); },
+        formatLoadMore: function (pageNumber) { return "Загрузка данных..."; },
+        formatSearching: function () { return "Поиск..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sk.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sk.js
new file mode 100644
index 0000000000..8d4e46afec
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sk.js
@@ -0,0 +1,48 @@
+/**
+ * Select2 Slovak translation.
+ *
+ * Author: David Vallner <david@vallner.net>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dve"); },
+        3: function() { return "tri"; },
+        4: function() { return "štyri"; }
+    }
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím zadajte ešte jeden znak";
+            } else if (n <= 4) {
+                return "Prosím zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím zadajte ešte ďalších "+n+" znakov";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím zadajte o jeden znak menej";
+            } else if (n <= 4) {
+                return "Prosím zadajte o "+smallNumbers[n](true)+" znaky menej";
+            } else {
+                return "Prosím zadajte o "+n+" znakov menej";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Môžete zvoliť len jednu položku";
+            } else if (limit <= 4) {
+                return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Môžete zvoliť najviac "+limit+" položiek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky..."; },
+        formatSearching: function () { return "Vyhľadávanie..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sv.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sv.js
new file mode 100644
index 0000000000..9f09de30f3
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_sv.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Swedish translation.
+ *
+ * Author: Jens Rantil <jens.rantil@telavox.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Inga träffar"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
+        formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
+        formatLoadMore: function (pageNumber) { return "Laddar fler resultat..."; },
+        formatSearching: function () { return "Söker..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_tr.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_tr.js
new file mode 100644
index 0000000000..b47a2fad64
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_tr.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Turkish translation.
+ * 
+ * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Sonuç bulunamadı"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
+        formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
+        formatLoadMore: function (pageNumber) { return "Daha fazla..."; },
+        formatSearching: function () { return "Aranıyor..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ua.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ua.js
new file mode 100644
index 0000000000..58d31e762d
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_ua.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 <Language> translation.
+ * 
+ * Author: bigmihail <bigmihail@bigmir.net>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Нічого не знайдено"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка ще " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ]; },
+        formatInputTooLong: function (input, max) { var n = input.length - max, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка на " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ] + " менше"; },
+        formatSelectionTooBig: function (limit) {var s = ["", "и", "ів"], p = [2,0,1,1,1,2];  return "Ви можете вибрати лише " + limit + " елемент" + s[ (limit%100>4 && limit%100<=20)? 2 : p[Math.min(limit%10, 5)] ]; },
+        formatLoadMore: function (pageNumber) { return "Завантаження даних..."; },
+        formatSearching: function () { return "Пошук..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_vi.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_vi.js
new file mode 100644
index 0000000000..0a45dfc9cb
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_vi.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 Vietnamese translation.
+ * 
+ * Author: Long Nguyen <olragon@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "Không tìm thấy kết quả"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả..."; },
+        formatSearching: function () { return "Đang tìm..."; }
+    });
+})(jQuery);
+
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-CN.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-CN.js
new file mode 100644
index 0000000000..49d8e5994a
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-CN.js
@@ -0,0 +1,14 @@
+/**
+ * Select2 Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "没有找到匹配项"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
+        formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
+        formatLoadMore: function (pageNumber) { return "加载结果中..."; },
+        formatSearching: function () { return "搜索中..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-TW.js b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-TW.js
new file mode 100755
index 0000000000..3d447d68a7
--- /dev/null
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2_locale_zh-TW.js
@@ -0,0 +1,14 @@
+/**
+ * Select2 Traditional Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.extend($.fn.select2.defaults, {
+        formatNoMatches: function () { return "沒有找到相符的項目"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
+        formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
+        formatLoadMore: function (pageNumber) { return "載入中..."; },
+        formatSearching: function () { return "搜尋中..."; }
+    });
+})(jQuery);
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2x2.png b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/lib/select2-3.4.1/select2x2.png
new file mode 100644
index 0000000000000000000000000000000000000000..4bdd5c961d452c49dfa0789c2c7ffb82c238fc24
GIT binary patch
literal 845
zcmV-T1G4;yP)<h;3K|Lk000e1NJLTq004LZ002-31^@s6(wnh~0009NNkl<Zc-rlq
zv2GJV5I`eA5ebSzqy-%%f8hdLP~9h_qV^Xci^>upQ6WKflyv?C|ADVW!U!t`EpA+x
zB)5#EjWk-_X77YJZtQo`E0SF)^1bZr%<ScI;+%s6=ICz#f&syRU}(wBHJi=KJtvV%
z&q1&qv^eJpB{$ANuo1Mlh~(%T1ltp=DYaY#8zmuerN1Ub+fTAw3X&{)g1bmADU*y5
zUblqhl?+n{vw|Hrl|2~9qJcUX=wx*w)_|YxX&9mxeE=mzu0C`g40D>)B7Cd`*OK*r
z5WG-7e-R9G9^69ksDt29&oyHqxPSt|-S>xi3%PTd+GjY+BGF|nWC(7D-sd(kxqd9~
zS@2YF5vB+>dP8+$l^{oO3-lEWiGA*QI<ZQyKyWv~v4m^Xqu?O1N>U)Wds#9M6RZ9N
zcQ4y4)xqQOxD=vwu%7cz1nY#$lT&y8HCmkWgpwQP#3dhnYj9|2aS_R}IUF_^6s#$=
zTm%~>A#oM?KIg$kh=<`gJkeoHa2LrulVy$Yx+N_0R3$4I!R*0677f(FKqm`2_o4~W
z0h}fQZ`lC^1A+m;fM7uI(R1`S0KtG@KrkQ}5DW+&@cTnDVIow56KciMk7a899t0bC
zC1KI<NAq=n6MhK=f(@YLo(pv#^;)>{TsMe5NAR%GD_5`B-@<p{rSMpIB)k$<!Y=ql
zC=fhg{GPi}!nVSD;k03YekgqMb862<$PheS!4oBGC%j9%)a;J%LAX>ad4k~K3SO%H
z_M31|`HV?E6)u$E3c&*<*n20+V@mRCop>R5;DWuZCmjSo7p@R&OYl<!6QXYf&j`^5
z2wIX~h5Ie!o(UI9@DjnpE|YYF<D+mlkwJf^OtRPLs6AUR@T@`Z1L2FXRdRPirluiy
zpsh;Xe!LWZ2ycXE!VBT8@Kdi`MTuYwhYjIDL;SG8HBchh)^TC22*vJVk`Zj@z<=2w
zxbkC}P{t%9`0)R&U5Q}xg42=_Y+Z0#a)n^ig42=_Y+P_C8Nv2R^{Fc*c#2>^@G<ZQ
XF(xQ&SEjMs00000NkvXXu0mjf{}FjY

literal 0
HcmV?d00001

diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/application-menu.html b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/application-menu.html
index 5eaa5f301b..9246307894 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/application-menu.html
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/application-menu.html
@@ -16,10 +16,10 @@
         </ul>
         <hr/>
         <div>
-            <a href="#/realms/{{realm.id}}">Back to realm management...</a>
+            <a href="#/create/application/{{realm.id}}">New Application...</a>
         </div>
         <div>
-            <a href="#/create/application/{{realm.id}}">New Application...</a>
+            <a href="#/realms/{{realm.id}}">Back to realm management...</a>
         </div>
     </nav>
 </div>
\ No newline at end of file
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-detail.html b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-detail.html
index a10e742628..d49b1cb5c2 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-detail.html
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-detail.html
@@ -17,39 +17,74 @@
 
             <form class="form-horizontal" name="realmForm" novalidate>
                 <fieldset>
-                    <legend>Settings</legend>
 
-                    <div data-kc-input>
-                        <label>Name</label>
-                        <input class="input-xlarge" type="text" name="name" data-ng-model="realm.name" autofocus
-                               required>
+                    <div class="control-group">
+                        <label for="realmForm-name" class="control-label">Name</label>
+
+                        <div class="controls">
+                            <input class="input-xlarge" type="text" name="name" data-ng-model="realm.name" autofocus
+                                   required>
+                        </div>
                     </div>
 
-                    <div data-kc-input>
-                        <label>Enabled</label>
-                        <input class="input-xlarge" type="checkbox" name="enabled" data-ng-model="realm.enabled">
-                    </div>
+                     <table>
+                        <tr>
+                            <td>
+                                <div class="control-group">
+                                    <label class="control-label">Enabled</label>
 
-                    <div data-kc-input>
-                        <label>Social login</label>
-                        <input class="input-xlarge" type="checkbox" name="social" data-ng-model="realm.social">
-                    </div>
+                                    <div class="controls">
+                                        <input class="input-xlarge" type="checkbox" name="enabled"
+                                               data-ng-model="realm.enabled">
+                                    </div>
+                                </div>
+                            </td>
+                            <td>
+                                <div class="control-group">
+                                    <label class="control-label">Social login</label>
 
-                    <div data-kc-input>
-                        <label>Require SSL</label>
-                        <input class="input-xlarge" type="checkbox" name="requireSsl" data-ng-model="realm.requireSsl">
-                    </div>
+                                    <div class="controls">
+                                        <input class="input-xlarge" type="checkbox" name="social"
+                                               data-ng-model="realm.social">
+                                    </div>
+                                </div>
+                            </td>
+                        </tr>
+                        <tr>
+                            <td>
+                                <div class="control-group">
+                                    <label class="control-label">Require SSL</label>
 
-                    <div data-kc-input>
-                        <label>Cookie login allowed</label>
-                        <input class="input-xlarge" type="checkbox" name="cookieLoginAllowed" data-ng-model="realm.cookieLoginAllowed">
-                    </div>
+                                    <div class="controls">
+                                        <input class="input-xlarge" type="checkbox" name="requireSsl"
+                                               data-ng-model="realm.requireSsl">
+                                    </div>
+                                </div>
+                            </td>
+                            <td>
+                                <div class="control-group">
+                                    <label class="control-label">Cookie login allowed</label>
 
-                    <div data-kc-input>
-                        <label>User registration</label>
-                        <input class="input-xlarge" type="checkbox" name="social"
-                               data-ng-model="realm.userRegistration">
-                    </div>
+                                    <div class="controls">
+                                        <input class="input-xlarge" type="checkbox" name="cookieLoginAllowed"
+                                               data-ng-model="realm.cookieLoginAllowed">
+                                    </div>
+                                </div>
+                            </td>
+                        </tr>
+                         <tr>
+                             <td>
+                                 <div class="control-group">
+                                     <label class="control-label">User registration</label>
+
+                                     <div class="controls">
+                                         <input class="input-xlarge" type="checkbox" name="userRegistration"
+                                                data-ng-model="realm.userRegistration">
+                                     </div>
+                                 </div>
+                             </td>
+                         </tr>
+                    </table>
 
                     <div class="control-group">
                         <label for="realmForm-tokenLifespan" class="control-label">Token lifespan</label>
@@ -74,13 +109,21 @@
                                    data-ng-model="realm.accessCodeLifespan">
                             <select style="width: auto;" name="accessCodeLifespanUnit"
                                     data-ng-model="realm.accessCodeLifespanUnit">
-                                <option value="SECONDS" data-ng-selected="!realm.accessCodeLifespanUnit">Seconds</option>
+                                <option value="SECONDS" data-ng-selected="!realm.accessCodeLifespanUnit">Seconds
+                                </option>
                                 <option value="MINUTES">Minutes</option>
                                 <option value="HOURS">Hours</option>
                                 <option value="DAYS">Days</option>
                             </select>
                         </div>
                     </div>
+                    <div class="control-group">
+                        <label class="control-label">User Required Credentials</label>
+
+                        <div class="controls">
+                            <input style="width:250px" type="text" ui-select2="userCredentialOptions" ng-model="realm.requiredCredentials">
+                        </div>
+                    </div>
                 </fieldset>
                 <div class="form-actions" data-ng-show="createRealm">
                     <button type="submit" data-ng-click="save()" class="btn btn-primary" data-ng-show="changed">Save
diff --git a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-menu.html b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-menu.html
index b8d120503d..977de65ca4 100755
--- a/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-menu.html
+++ b/examples/as7-eap-demo/server/src/main/webapp/saas/admin/partials/realm-menu.html
@@ -1,23 +1,22 @@
 <div data-ng-hide="createRealm">
     <nav id="local-nav">
         <ul class="nav nav-list">
-            <li data-ng-class="!path[2] && 'active'"><a href="#/realms/{{realm.id}}">Realm Settings</a></li>
-            <li data-ng-class="path[2] == 'roles' && 'active'"><a href="#/realms/{{realm.id}}/roles">Realm Roles</a>
-                <ul class="sub-items">
-                    <li data-ng-class="path[0] == 'create' && path[1] == 'role' && 'active'"><a
-                            href="#/create/role/{{realm.id}}">Add Role</a></li>
-                </ul>
-            </li>
-            <li data-ng-class="path[2] == 'users' && 'active'"><a href="#/realms/{{realm.id}}/users">Realm Users</a>
+            <li data-ng-class="path[2] == 'users' && 'active'"><a href="#/realms/{{realm.id}}/users">Users</a>
                 <ul class="sub-items">
                     <li data-ng-class="path[0] == 'create' && path[1] == 'user' && 'active'"><a
-                            href="#/create/user/{{realm.id}}">Add User</a></li>
+                            href="#/create/user/{{realm.id}}">New User</a></li>
                     <li data-ng-class="path[0] == 'find' && path[1] == 'user' && 'active'"><a
                             href="#/find/user/{{realm.id}}">Find User</a></li>
                 </ul>
             </li>
+            <li data-ng-class="path[2] == 'roles' && 'active'"><a href="#/realms/{{realm.id}}/roles">Roles</a>
+                <ul class="sub-items">
+                    <li data-ng-class="path[0] == 'create' && path[1] == 'role' && 'active'"><a
+                            href="#/create/role/{{realm.id}}">New Role</a></li>
+                </ul>
+            </li>
             <li data-ng-class="path[2] == 'resources' && 'active'"><a href="#/realms/{{realm.id}}/applications">Manage Applications</a></li>
-
+            <li data-ng-class="!path[2] && 'active'"><a href="#/realms/{{realm.id}}">Realm Settings</a></li>
         </ul>
     </nav>
 </div>
\ No newline at end of file
diff --git a/integration/as7-eap6/adapter/src/main/java/org/keycloak/adapters/as7/ServletOAuthLogin.java b/integration/as7-eap6/adapter/src/main/java/org/keycloak/adapters/as7/ServletOAuthLogin.java
index f046eed07a..0d4dfb1352 100755
--- a/integration/as7-eap6/adapter/src/main/java/org/keycloak/adapters/as7/ServletOAuthLogin.java
+++ b/integration/as7-eap6/adapter/src/main/java/org/keycloak/adapters/as7/ServletOAuthLogin.java
@@ -6,7 +6,7 @@ import org.keycloak.RealmConfiguration;
 import org.keycloak.VerificationException;
 import org.keycloak.representations.AccessTokenResponse;
 import org.keycloak.representations.SkeletonKeyToken;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
+import org.keycloak.representations.idm.CredentialRepresentation;
 
 import javax.servlet.http.Cookie;
 import javax.servlet.http.HttpServletRequest;
@@ -230,7 +230,7 @@ public class ServletOAuthLogin {
         form.param("grant_type", "authorization_code")
                 .param("code", code)
                 .param("client_id", client_id)
-                .param(RequiredCredentialRepresentation.PASSWORD, password)
+                .param(CredentialRepresentation.PASSWORD, password)
                 .param("redirect_uri", redirectUri);
 
         Response res = realmInfo.getCodeUrl().request()
diff --git a/sdk-html/src/main/java/org/keycloak/sdk/LoginBean.java b/sdk-html/src/main/java/org/keycloak/sdk/LoginBean.java
index 61d551586d..a953ec8bbf 100755
--- a/sdk-html/src/main/java/org/keycloak/sdk/LoginBean.java
+++ b/sdk-html/src/main/java/org/keycloak/sdk/LoginBean.java
@@ -153,7 +153,7 @@ public class LoginBean {
         requiredCredentials = new LinkedList<RequiredCredential>();
         for (RequiredCredentialModel m : realm.getRequiredCredentials()) {
             if (m.isInput()) {
-                requiredCredentials.add(new RequiredCredential(m.getType(), m.isSecret()));
+                requiredCredentials.add(new RequiredCredential(m.getType(), m.isSecret(), m.getFormLabel()));
             }
         }
     }
@@ -193,10 +193,12 @@ public class LoginBean {
     public class RequiredCredential {
         private String type;
         private boolean secret;
+        private String formLabel;
 
-        public RequiredCredential(String type, boolean secure) {
+        public RequiredCredential(String type, boolean secure, String formLabel) {
             this.type = type;
             this.secret = secure;
+            this.formLabel = formLabel;
         }
 
         public String getName() {
@@ -204,7 +206,7 @@ public class LoginBean {
         }
 
         public String getLabel() {
-            return type;
+            return formLabel;
         }
 
         public String getInputType() {
diff --git a/services/src/main/java/org/keycloak/services/managers/AuthenticationManager.java b/services/src/main/java/org/keycloak/services/managers/AuthenticationManager.java
index 02c87eb539..705a7aba78 100755
--- a/services/src/main/java/org/keycloak/services/managers/AuthenticationManager.java
+++ b/services/src/main/java/org/keycloak/services/managers/AuthenticationManager.java
@@ -8,7 +8,7 @@ import org.jboss.resteasy.spi.ResteasyProviderFactory;
 import org.keycloak.RSATokenVerifier;
 import org.keycloak.VerificationException;
 import org.keycloak.representations.SkeletonKeyToken;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
+import org.keycloak.representations.idm.CredentialRepresentation;
 import org.keycloak.services.models.RealmModel;
 import org.keycloak.services.models.RequiredCredentialModel;
 import org.keycloak.services.models.UserModel;
@@ -206,9 +206,9 @@ public class AuthenticationManager {
 
         List<RequiredCredentialModel> requiredCredentials = null;
         if (realm.hasRole(user, RealmManager.RESOURCE_ROLE)) {
-            requiredCredentials = realm.getResourceRequiredCredentials();
+            requiredCredentials = realm.getRequiredResourceCredentials();
         } else if (realm.hasRole(user, RealmManager.IDENTITY_REQUESTER_ROLE)) {
-            requiredCredentials = realm.getOAuthClientRequiredCredentials();
+            requiredCredentials = realm.getRequiredOAuthClientCredentials();
         } else {
             requiredCredentials = realm.getRequiredCredentials();
         }
@@ -216,21 +216,23 @@ public class AuthenticationManager {
             types.add(credential.getType());
         }
 
-        if (types.contains(RequiredCredentialRepresentation.PASSWORD)) {
-            String password = formData.getFirst(RequiredCredentialRepresentation.PASSWORD);
+        if (types.contains(CredentialRepresentation.PASSWORD)) {
+            String password = formData.getFirst(CredentialRepresentation.PASSWORD);
             if (password == null) {
                 logger.warn("Password not provided");
                 return false;
             }
 
-            if (types.contains(RequiredCredentialRepresentation.TOTP)) {
-                String token = formData.getFirst(RequiredCredentialRepresentation.TOTP);
+            if (types.contains(CredentialRepresentation.TOTP)) {
+                String token = formData.getFirst(CredentialRepresentation.TOTP);
                 if (token == null) {
                     logger.warn("TOTP token not provided");
                     return false;
                 }
+                logger.info("validating TOTP");
                 return realm.validateTOTP(user, password, token);
             } else {
+                logger.info("validating password for user: " + user.getLoginName());
                 return realm.validatePassword(user, password);
             }
         } else {
diff --git a/services/src/main/java/org/keycloak/services/managers/RealmManager.java b/services/src/main/java/org/keycloak/services/managers/RealmManager.java
index 56d65ca725..4eaa529d55 100755
--- a/services/src/main/java/org/keycloak/services/managers/RealmManager.java
+++ b/services/src/main/java/org/keycloak/services/managers/RealmManager.java
@@ -2,26 +2,19 @@ package org.keycloak.services.managers;
 
 import org.keycloak.representations.idm.CredentialRepresentation;
 import org.keycloak.representations.idm.RealmRepresentation;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
 import org.keycloak.representations.idm.ResourceRepresentation;
 import org.keycloak.representations.idm.RoleMappingRepresentation;
 import org.keycloak.representations.idm.RoleRepresentation;
 import org.keycloak.representations.idm.ScopeMappingRepresentation;
 import org.keycloak.representations.idm.UserRepresentation;
-import org.keycloak.services.models.KeycloakSession;
-import org.keycloak.services.models.RealmModel;
-import org.keycloak.services.models.RequiredCredentialModel;
-import org.keycloak.services.models.ResourceModel;
-import org.keycloak.services.models.RoleModel;
-import org.keycloak.services.models.UserCredentialModel;
-import org.keycloak.services.models.UserModel;
+import org.keycloak.services.models.*;
 
-import javax.ws.rs.WebApplicationException;
-import javax.ws.rs.core.Response;
 import java.security.KeyPair;
 import java.security.KeyPairGenerator;
 import java.security.NoSuchAlgorithmException;
+import java.util.ArrayList;
 import java.util.HashMap;
+import java.util.List;
 import java.util.Map;
 import java.util.concurrent.atomic.AtomicLong;
 
@@ -105,19 +98,19 @@ public class RealmManager {
         Map<String, UserModel> userMap = new HashMap<String, UserModel>();
 
         if (rep.getRequiredCredentials() != null) {
-            for (RequiredCredentialRepresentation requiredCred : rep.getRequiredCredentials()) {
+            for (String requiredCred : rep.getRequiredCredentials()) {
                 addRequiredCredential(newRealm, requiredCred);
             }
         }
 
         if (rep.getRequiredResourceCredentials() != null) {
-            for (RequiredCredentialRepresentation requiredCred : rep.getRequiredCredentials()) {
+            for (String requiredCred : rep.getRequiredCredentials()) {
                 addResourceRequiredCredential(newRealm, requiredCred);
             }
         }
 
         if (rep.getRequiredOAuthClientCredentials() != null) {
-            for (RequiredCredentialRepresentation requiredCred : rep.getRequiredCredentials()) {
+            for (String requiredCred : rep.getRequiredCredentials()) {
                 addOAuthClientRequiredCredential(newRealm, requiredCred);
             }
         }
@@ -193,30 +186,19 @@ public class RealmManager {
         return user;
     }
 
-    public void addRequiredCredential(RealmModel newRealm, RequiredCredentialRepresentation requiredCred) {
-        RequiredCredentialModel credential = initializeCred(requiredCred);
-        newRealm.addRequiredCredential(credential);
+    public void addRequiredCredential(RealmModel newRealm, String requiredCred) {
+        newRealm.addRequiredCredential(requiredCred);
     }
-    public void addResourceRequiredCredential(RealmModel newRealm, RequiredCredentialRepresentation requiredCred) {
-        RequiredCredentialModel credential = initializeCred(requiredCred);
-        newRealm.addResourceRequiredCredential(credential);
+    public void addResourceRequiredCredential(RealmModel newRealm, String requiredCred) {
+        newRealm.addRequiredResourceCredential(requiredCred);
     }
-    public void addOAuthClientRequiredCredential(RealmModel newRealm, RequiredCredentialRepresentation requiredCred) {
-        RequiredCredentialModel credential = initializeCred(requiredCred);
-        newRealm.addOAuthClientRequiredCredential(credential);
+    public void addOAuthClientRequiredCredential(RealmModel newRealm, String requiredCred) {
+        newRealm.addRequiredOAuthClientCredential(requiredCred);
     }
 
 
 
-    private RequiredCredentialModel initializeCred(RequiredCredentialRepresentation requiredCred) {
-        RequiredCredentialModel credential = new RequiredCredentialModel();
-        credential.setType(requiredCred.getType());
-        credential.setInput(requiredCred.isInput());
-        credential.setSecret(requiredCred.isSecret());
-        return credential;
-    }
-
-    protected void createResources(RealmRepresentation rep, RealmModel realm) {
+     protected void createResources(RealmRepresentation rep, RealmModel realm) {
         RoleModel loginRole = realm.getRole(RealmManager.RESOURCE_ROLE);
         ResourceManager manager = new ResourceManager(this);
         for (ResourceRepresentation resourceRep : rep.getResources()) {
@@ -232,4 +214,39 @@ public class RealmManager {
         return rep;
     }
 
+    public RealmRepresentation toRepresentation(RealmModel realm) {
+        RealmRepresentation rep = new RealmRepresentation();
+        rep.setId(realm.getId());
+        rep.setRealm(realm.getName());
+        rep.setEnabled(realm.isEnabled());
+        rep.setSslNotRequired(realm.isSslNotRequired());
+        rep.setCookieLoginAllowed(realm.isCookieLoginAllowed());
+        rep.setPublicKey(realm.getPublicKeyPem());
+        rep.setTokenLifespan(realm.getTokenLifespan());
+        rep.setAccessCodeLifespan(realm.getAccessCodeLifespan());
+        List<RequiredCredentialModel> requiredCredentialModels = realm.getRequiredCredentials();
+        if (requiredCredentialModels.size() > 0) {
+            rep.setRequiredCredentials(new ArrayList<String>());
+            for (RequiredCredentialModel cred : requiredCredentialModels) {
+                rep.getRequiredCredentials().add(cred.getType());
+            }
+        }
+        List<RequiredCredentialModel> requiredResourceCredentialModels = realm.getRequiredResourceCredentials();
+        if (requiredResourceCredentialModels.size() > 0) {
+            rep.setRequiredResourceCredentials(new ArrayList<String>());
+            for (RequiredCredentialModel cred : requiredResourceCredentialModels) {
+                rep.getRequiredResourceCredentials().add(cred.getType());
+            }
+        }
+        List<RequiredCredentialModel> requiredOAuthCredentialModels = realm.getRequiredOAuthClientCredentials();
+        if (requiredOAuthCredentialModels.size() > 0) {
+            rep.setRequiredOAuthClientCredentials(new ArrayList<String>());
+            for (RequiredCredentialModel cred : requiredOAuthCredentialModels) {
+                rep.getRequiredOAuthClientCredentials().add(cred.getType());
+            }
+        }
+        return rep;
+    }
+
+
 }
diff --git a/services/src/main/java/org/keycloak/services/models/RealmModel.java b/services/src/main/java/org/keycloak/services/models/RealmModel.java
index 404f83767d..f63b942b62 100755
--- a/services/src/main/java/org/keycloak/services/models/RealmModel.java
+++ b/services/src/main/java/org/keycloak/services/models/RealmModel.java
@@ -62,6 +62,7 @@ public interface RealmModel {
     List<RequiredCredentialModel> getRequiredCredentials();
 
     void addRequiredCredential(RequiredCredentialModel cred);
+    void addRequiredCredential(String cred);
 
     boolean validatePassword(UserModel user, String password);
 
@@ -101,15 +102,19 @@ public interface RealmModel {
 
     RoleModel getRoleById(String id);
 
-    void addResourceRequiredCredential(RequiredCredentialModel cred);
+    void addRequiredResourceCredential(RequiredCredentialModel cred);
 
-    List<RequiredCredentialModel> getResourceRequiredCredentials();
+    List<RequiredCredentialModel> getRequiredResourceCredentials();
 
-    void addOAuthClientRequiredCredential(RequiredCredentialModel cred);
+    void addRequiredOAuthClientCredential(RequiredCredentialModel cred);
 
-    List<RequiredCredentialModel> getOAuthClientRequiredCredentials();
+    List<RequiredCredentialModel> getRequiredOAuthClientCredentials();
 
     boolean hasRole(UserModel user, String role);
 
     ResourceModel getResourceById(String id);
+
+    void addRequiredOAuthClientCredential(String type);
+
+    void addRequiredResourceCredential(String type);
 }
diff --git a/services/src/main/java/org/keycloak/services/models/RequiredCredentialModel.java b/services/src/main/java/org/keycloak/services/models/RequiredCredentialModel.java
index c8ca58490d..a72bcbad3a 100755
--- a/services/src/main/java/org/keycloak/services/models/RequiredCredentialModel.java
+++ b/services/src/main/java/org/keycloak/services/models/RequiredCredentialModel.java
@@ -1,6 +1,10 @@
 package org.keycloak.services.models;
 
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
+import org.keycloak.representations.idm.CredentialRepresentation;
+
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Map;
 
 /**
  * @author <a href="mailto:bill@burkecentral.com">Bill Burke</a>
@@ -10,16 +14,11 @@ public class RequiredCredentialModel {
     protected String type;
     protected boolean input;
     protected boolean secret;
+    protected String formLabel;
 
     public RequiredCredentialModel() {
     }
 
-    public RequiredCredentialModel(String type, boolean input, boolean secret) {
-        this.type = type;
-        this.input = input;
-        this.secret = secret;
-    }
-
     public String getType() {
         return type;
     }
@@ -44,5 +43,39 @@ public class RequiredCredentialModel {
         this.secret = secret;
     }
 
-    public static final RequiredCredentialModel PASSWORD = new RequiredCredentialModel(RequiredCredentialRepresentation.PASSWORD, true, true);
+    public String getFormLabel() {
+        return formLabel;
+    }
+
+    public void setFormLabel(String formLabel) {
+        this.formLabel = formLabel;
+    }
+
+    public static final Map<String, RequiredCredentialModel> BUILT_IN;
+    public static final RequiredCredentialModel PASSWORD;
+    public static final RequiredCredentialModel TOTP;
+    public static final RequiredCredentialModel CLIENT_CERT;
+
+    static {
+        Map<String, RequiredCredentialModel> map = new HashMap<String, RequiredCredentialModel>();
+        PASSWORD = new RequiredCredentialModel();
+        PASSWORD.setType(CredentialRepresentation.PASSWORD);
+        PASSWORD.setInput(true);
+        PASSWORD.setSecret(true);
+        PASSWORD.setFormLabel("Password");
+        map.put(PASSWORD.getType(), PASSWORD);
+        TOTP = new RequiredCredentialModel();
+        TOTP.setType(CredentialRepresentation.TOTP);
+        TOTP.setInput(true);
+        TOTP.setSecret(false);
+        TOTP.setFormLabel("Authenticator Code");
+        map.put(TOTP.getType(), TOTP);
+        CLIENT_CERT = new RequiredCredentialModel();
+        CLIENT_CERT.setType(CredentialRepresentation.CLIENT_CERT);
+        CLIENT_CERT.setInput(false);
+        CLIENT_CERT.setSecret(false);
+        CLIENT_CERT.setFormLabel("Client Certificate");
+        map.put(CLIENT_CERT.getType(), CLIENT_CERT);
+        BUILT_IN = Collections.unmodifiableMap(map);
+    }
 }
diff --git a/services/src/main/java/org/keycloak/services/models/UserCredentialModel.java b/services/src/main/java/org/keycloak/services/models/UserCredentialModel.java
index 5807319db5..1ccf8be787 100755
--- a/services/src/main/java/org/keycloak/services/models/UserCredentialModel.java
+++ b/services/src/main/java/org/keycloak/services/models/UserCredentialModel.java
@@ -8,6 +8,7 @@ public class UserCredentialModel {
 
     protected String type;
     protected String value;
+    protected String device;
 
     public String getType() {
         return type;
@@ -24,4 +25,12 @@ public class UserCredentialModel {
     public void setValue(String value) {
         this.value = value;
     }
+
+    public String getDevice() {
+        return device;
+    }
+
+    public void setDevice(String device) {
+        this.device = device;
+    }
 }
diff --git a/services/src/main/java/org/keycloak/services/models/UserModel.java b/services/src/main/java/org/keycloak/services/models/UserModel.java
index bac22c75ec..f6eccf2572 100755
--- a/services/src/main/java/org/keycloak/services/models/UserModel.java
+++ b/services/src/main/java/org/keycloak/services/models/UserModel.java
@@ -20,4 +20,16 @@ public interface UserModel {
     String getAttribute(String name);
 
     Map<String, String> getAttributes();
+
+    String getFirstName();
+
+    void setFirstName(String firstName);
+
+    String getLastName();
+
+    void setLastName(String lastName);
+
+    String getEmail();
+
+    void setEmail(String email);
 }
diff --git a/services/src/main/java/org/keycloak/services/models/picketlink/RealmAdapter.java b/services/src/main/java/org/keycloak/services/models/picketlink/RealmAdapter.java
index fe023f7c9d..86100f092d 100755
--- a/services/src/main/java/org/keycloak/services/models/picketlink/RealmAdapter.java
+++ b/services/src/main/java/org/keycloak/services/models/picketlink/RealmAdapter.java
@@ -2,7 +2,7 @@ package org.keycloak.services.models.picketlink;
 
 import org.bouncycastle.openssl.PEMWriter;
 import org.jboss.resteasy.security.PemUtils;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
+import org.keycloak.representations.idm.CredentialRepresentation;
 import org.keycloak.services.managers.RealmManager;
 import org.keycloak.services.models.KeycloakSession;
 import org.keycloak.services.models.RealmModel;
@@ -259,13 +259,13 @@ public class RealmAdapter implements RealmModel {
 
 
     @Override
-    public void addResourceRequiredCredential(RequiredCredentialModel cred) {
+    public void addRequiredResourceCredential(RequiredCredentialModel cred) {
         ResourceRequiredCredentialRelationship relationship = new ResourceRequiredCredentialRelationship();
         addRequiredCredential(cred, relationship);
     }
 
     @Override
-    public List<RequiredCredentialModel> getResourceRequiredCredentials() {
+    public List<RequiredCredentialModel> getRequiredResourceCredentials() {
         RelationshipQuery<ResourceRequiredCredentialRelationship> query = getRelationshipManager().createRelationshipQuery(ResourceRequiredCredentialRelationship.class);
         query.setParameter(ResourceRequiredCredentialRelationship.REALM, realm.getName());
         List<ResourceRequiredCredentialRelationship> results = query.getResultList();
@@ -273,13 +273,13 @@ public class RealmAdapter implements RealmModel {
     }
 
     @Override
-    public void addOAuthClientRequiredCredential(RequiredCredentialModel cred) {
+    public void addRequiredOAuthClientCredential(RequiredCredentialModel cred) {
         OAuthClientRequiredCredentialRelationship relationship = new OAuthClientRequiredCredentialRelationship();
         addRequiredCredential(cred, relationship);
     }
 
     @Override
-    public List<RequiredCredentialModel> getOAuthClientRequiredCredentials() {
+    public List<RequiredCredentialModel> getRequiredOAuthClientCredentials() {
         RelationshipQuery<OAuthClientRequiredCredentialRelationship> query = getRelationshipManager().createRelationshipQuery(OAuthClientRequiredCredentialRelationship.class);
         query.setParameter(ResourceRequiredCredentialRelationship.REALM, realm.getName());
         List<OAuthClientRequiredCredentialRelationship> results = query.getResultList();
@@ -302,6 +302,7 @@ public class RealmAdapter implements RealmModel {
             model.setInput(relationship.isInput());
             model.setSecret(relationship.isSecret());
             model.setType(relationship.getCredentialType());
+            model.setFormLabel(relationship.getFormLabel());
             rtn.add(model);
         }
         return rtn;
@@ -311,9 +312,35 @@ public class RealmAdapter implements RealmModel {
         relationship.setInput(cred.isInput());
         relationship.setSecret(cred.isSecret());
         relationship.setRealm(realm.getName());
+        relationship.setFormLabel(cred.getFormLabel());
         getRelationshipManager().add(relationship);
     }
 
+    @Override
+    public void addRequiredCredential(String type) {
+        RequiredCredentialModel model = initRequiredCredentialModel(type);
+        addRequiredCredential(model);
+    }
+
+    @Override
+    public void addRequiredOAuthClientCredential(String type) {
+        RequiredCredentialModel model = initRequiredCredentialModel(type);
+        addRequiredOAuthClientCredential(model);
+    }
+
+    @Override
+    public void addRequiredResourceCredential(String type) {
+        RequiredCredentialModel model = initRequiredCredentialModel(type);
+        addRequiredResourceCredential(model);
+    }
+
+    protected RequiredCredentialModel initRequiredCredentialModel(String type) {
+        RequiredCredentialModel model = RequiredCredentialModel.BUILT_IN.get(type);
+        if (model == null) {
+            throw new RuntimeException("Unknown credential type " + type);
+        }
+        return model;
+    }
 
     @Override
     public boolean validatePassword(UserModel user, String password) {
@@ -335,13 +362,14 @@ public class RealmAdapter implements RealmModel {
     @Override
     public void updateCredential(UserModel user, UserCredentialModel cred) {
         IdentityManager idm = getIdm();
-        if (cred.getType().equals(RequiredCredentialRepresentation.PASSWORD)) {
+        if (cred.getType().equals(CredentialRepresentation.PASSWORD)) {
             Password password = new Password(cred.getValue());
             idm.updateCredential(((UserAdapter)user).getUser(), password);
-        } else if (cred.getType().equals(RequiredCredentialRepresentation.TOTP)) {
+        } else if (cred.getType().equals(CredentialRepresentation.TOTP)) {
             TOTPCredential totp = new TOTPCredential(cred.getValue());
+            totp.setDevice(cred.getDevice());
             idm.updateCredential(((UserAdapter)user).getUser(), totp);
-        } else if (cred.getType().equals(RequiredCredentialRepresentation.CLIENT_CERT)) {
+        } else if (cred.getType().equals(CredentialRepresentation.CLIENT_CERT)) {
             X509Certificate cert = null;
             try {
                 cert = org.keycloak.PemUtils.decodeCertificate(cred.getValue());
diff --git a/services/src/main/java/org/keycloak/services/models/picketlink/UserAdapter.java b/services/src/main/java/org/keycloak/services/models/picketlink/UserAdapter.java
index 324baf5818..be85c88d30 100755
--- a/services/src/main/java/org/keycloak/services/models/picketlink/UserAdapter.java
+++ b/services/src/main/java/org/keycloak/services/models/picketlink/UserAdapter.java
@@ -3,6 +3,7 @@ package org.keycloak.services.models.picketlink;
 import org.keycloak.services.models.UserModel;
 import org.picketlink.idm.IdentityManager;
 import org.picketlink.idm.model.Attribute;
+import org.picketlink.idm.model.annotation.AttributeProperty;
 import org.picketlink.idm.model.sample.User;
 
 import java.util.HashMap;
@@ -41,6 +42,39 @@ public class UserAdapter implements UserModel {
         idm.update(user);
     }
 
+    @Override
+    public String getFirstName() {
+        return user.getFirstName();
+    }
+
+    @Override
+    public void setFirstName(String firstName) {
+        user.setFirstName(firstName);
+        idm.update(user);
+    }
+
+    @Override
+    public String getLastName() {
+        return user.getLastName();
+    }
+
+    @Override
+    public void setLastName(String lastName) {
+        user.setLastName(lastName);
+        idm.update(user);
+    }
+
+    @Override
+    public String getEmail() {
+        return user.getEmail();
+    }
+
+    @Override
+    public void setEmail(String email) {
+        user.setEmail(email);
+        idm.update(user);
+    }
+
     @Override
     public void setAttribute(String name, String value) {
         user.setAttribute(new Attribute<String>(name, value));
diff --git a/services/src/main/java/org/keycloak/services/models/picketlink/relationships/RequiredCredentialRelationship.java b/services/src/main/java/org/keycloak/services/models/picketlink/relationships/RequiredCredentialRelationship.java
index 4434a19964..c24b128ecb 100755
--- a/services/src/main/java/org/keycloak/services/models/picketlink/relationships/RequiredCredentialRelationship.java
+++ b/services/src/main/java/org/keycloak/services/models/picketlink/relationships/RequiredCredentialRelationship.java
@@ -68,4 +68,14 @@ public class RequiredCredentialRelationship extends AbstractAttributedType imple
     public void setSecret(boolean secret) {
         setAttribute(new Attribute<Boolean>("secret", secret));
     }
+
+    @AttributeProperty
+    public String getFormLabel() {
+        return (String)getAttribute("formLabel").getValue();
+    }
+
+    public void setFormLabel(String label) {
+        setAttribute(new Attribute<String>("formLabel", label));
+    }
+
 }
diff --git a/services/src/main/java/org/keycloak/services/resources/SaasService.java b/services/src/main/java/org/keycloak/services/resources/SaasService.java
index 61466369f3..3665c53b20 100755
--- a/services/src/main/java/org/keycloak/services/resources/SaasService.java
+++ b/services/src/main/java/org/keycloak/services/resources/SaasService.java
@@ -6,7 +6,6 @@ import org.jboss.resteasy.spi.HttpRequest;
 import org.jboss.resteasy.spi.HttpResponse;
 import org.jboss.resteasy.spi.NotImplementedYetException;
 import org.keycloak.representations.idm.CredentialRepresentation;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
 import org.keycloak.representations.idm.UserRepresentation;
 import org.keycloak.services.managers.AuthenticationManager;
 import org.keycloak.services.managers.RealmManager;
@@ -19,6 +18,7 @@ import org.keycloak.services.resources.admin.RealmsAdminResource;
 import javax.ws.rs.*;
 import javax.ws.rs.core.*;
 import java.net.URI;
+import java.util.StringTokenizer;
 
 /**
  * @author <a href="mailto:bill@burkecentral.com">Bill Burke</a>
@@ -109,7 +109,7 @@ public class SaasService {
                 if (user == null) {
                     return Response.status(401).build();
                 }
-                return Response.ok(new WhoAmI(user.getLoginName(), user.getLoginName())).build();
+                return Response.ok(new WhoAmI(user.getLoginName(), user.getFirstName() + " " + user.getLastName())).build();
             }
         }.call();
     }
@@ -295,7 +295,7 @@ public class SaasService {
     @Path("registrations")
     @POST
     @Consumes(MediaType.APPLICATION_FORM_URLENCODED)
-    public Response processRegister(final @FormParam("name") String name,
+    public Response processRegister(final @FormParam("name") String fullname,
                                     final @FormParam("email") String email,
                                     final @FormParam("username") String username,
                                     final @FormParam("password") String password,
@@ -312,7 +312,29 @@ public class SaasService {
                 RealmModel defaultRealm = realmManager.defaultRealm();
                 UserRepresentation newUser = new UserRepresentation();
                 newUser.setUsername(username);
-                newUser.credential(RequiredCredentialRepresentation.PASSWORD, password, false);
+                newUser.setEmail(email);
+                if (fullname != null) {
+                    StringTokenizer tokenizer = new StringTokenizer(fullname, " ");
+                    StringBuffer first = null;
+                    String last = "";
+                    while (tokenizer.hasMoreTokens()) {
+                        String token = tokenizer.nextToken();
+                        if (tokenizer.hasMoreTokens()) {
+                            if (first == null) {
+                                first = new StringBuffer();
+                            } else {
+                                first.append(" ");
+                            }
+                            first.append(token);
+                        } else {
+                            last = token;
+                        }
+                    }
+                    if (first == null) first = new StringBuffer();
+                    newUser.setFirstName(first.toString());
+                    newUser.setLastName(last);
+                }
+                newUser.credential(CredentialRepresentation.PASSWORD, password);
                 UserModel user = registerMe(defaultRealm, newUser);
                 if (user == null) {
                     request.setAttribute("KEYCLOAK_LOGIN_ERROR_MESSAGE", "Username already exists.");
@@ -340,6 +362,9 @@ public class SaasService {
         }
 
         user = defaultRealm.addUser(newUser.getUsername());
+        user.setFirstName(newUser.getFirstName());
+        user.setLastName(newUser.getLastName());
+        user.setEmail(newUser.getEmail());
         for (CredentialRepresentation cred : newUser.getCredentials()) {
             UserCredentialModel credModel = new UserCredentialModel();
             credModel.setType(cred.getType());
diff --git a/services/src/main/java/org/keycloak/services/resources/admin/RealmAdminResource.java b/services/src/main/java/org/keycloak/services/resources/admin/RealmAdminResource.java
index bf2a7caa33..564aa50145 100755
--- a/services/src/main/java/org/keycloak/services/resources/admin/RealmAdminResource.java
+++ b/services/src/main/java/org/keycloak/services/resources/admin/RealmAdminResource.java
@@ -7,6 +7,7 @@ import org.keycloak.representations.idm.RoleRepresentation;
 import org.keycloak.representations.idm.UserRepresentation;
 import org.keycloak.services.managers.RealmManager;
 import org.keycloak.services.models.RealmModel;
+import org.keycloak.services.models.RequiredCredentialModel;
 import org.keycloak.services.models.RoleModel;
 import org.keycloak.services.models.UserModel;
 import org.keycloak.services.resources.PublicRealmResource;
@@ -60,21 +61,12 @@ public class RealmAdminResource {
         return new Transaction() {
             @Override
             protected RealmRepresentation callImpl() {
-                RealmRepresentation rep = new RealmRepresentation();
-                rep.setId(realm.getId());
-                rep.setRealm(realm.getName());
-                rep.setEnabled(realm.isEnabled());
-                rep.setSslNotRequired(realm.isSslNotRequired());
-                rep.setCookieLoginAllowed(realm.isCookieLoginAllowed());
-                rep.setPublicKey(realm.getPublicKeyPem());
-                rep.setTokenLifespan(realm.getTokenLifespan());
-                rep.setAccessCodeLifespan(realm.getAccessCodeLifespan());
-                return rep;
+                return new RealmManager(session).toRepresentation(realm);
             }
         }.call();
-
     }
 
+
     @Path("roles")
     @GET
     @NoCache
diff --git a/services/src/test/java/org/keycloak/test/AdapterTest.java b/services/src/test/java/org/keycloak/test/AdapterTest.java
index 68c7be80b8..25ef03dfd5 100755
--- a/services/src/test/java/org/keycloak/test/AdapterTest.java
+++ b/services/src/test/java/org/keycloak/test/AdapterTest.java
@@ -6,7 +6,7 @@ import org.junit.Before;
 import org.junit.FixMethodOrder;
 import org.junit.Test;
 import org.junit.runners.MethodSorters;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
+import org.keycloak.representations.idm.CredentialRepresentation;
 import org.keycloak.services.managers.RealmManager;
 import org.keycloak.services.models.KeycloakSession;
 import org.keycloak.services.models.KeycloakSessionFactory;
@@ -19,6 +19,7 @@ import org.keycloak.services.resources.KeycloakApplication;
 
 
 import java.util.List;
+import java.util.StringTokenizer;
 
 /**
  * @author <a href="mailto:bill@burkecentral.com">Bill Burke</a>
@@ -52,6 +53,16 @@ public class AdapterTest {
 
     }
 
+    @Test
+    public void testMe() {
+        String hello = "Bill     Burke";
+        StringTokenizer tokenizer = new StringTokenizer(hello, " ");
+        while (tokenizer.hasMoreTokens()) {
+            System.out.println("token: " + tokenizer.nextToken());
+        }
+    }
+
+
     @Test
     public void test1CreateRealm() throws Exception {
         realmModel = adapter.createRealm("JUGGLER");
@@ -77,25 +88,22 @@ public class AdapterTest {
     @Test
     public void test2RequiredCredential() throws Exception {
         test1CreateRealm();
-        RequiredCredentialModel creds = new RequiredCredentialModel();
-        creds.setSecret(true);
-        creds.setType(RequiredCredentialRepresentation.PASSWORD);
-        creds.setInput(true);
-        realmModel.addRequiredCredential(creds);
-        creds = new RequiredCredentialModel();
-        creds.setSecret(true);
-        creds.setType(RequiredCredentialRepresentation.TOTP);
-        creds.setInput(true);
-        realmModel.addRequiredCredential(creds);
+        realmModel.addRequiredCredential(CredentialRepresentation.PASSWORD);
+        realmModel.addRequiredCredential(CredentialRepresentation.TOTP);
         List<RequiredCredentialModel> storedCreds = realmModel.getRequiredCredentials();
         Assert.assertEquals(2, storedCreds.size());
         boolean totp = false;
         boolean password = false;
         for (RequiredCredentialModel cred : storedCreds) {
-            if (cred.getType().equals(RequiredCredentialRepresentation.PASSWORD)) password = true;
-            else if (cred.getType().equals(RequiredCredentialRepresentation.TOTP)) totp = true;
             Assert.assertTrue(cred.isInput());
-            Assert.assertTrue(cred.isSecret());
+            if (cred.getType().equals(CredentialRepresentation.PASSWORD)) {
+                password = true;
+                Assert.assertTrue(cred.isSecret());
+            }
+            else if (cred.getType().equals(CredentialRepresentation.TOTP)) {
+                totp = true;
+                Assert.assertFalse(cred.isSecret());
+            }
         }
         Assert.assertTrue(totp);
         Assert.assertTrue(password);
@@ -106,7 +114,7 @@ public class AdapterTest {
         test1CreateRealm();
         UserModel user = realmModel.addUser("bburke");
         UserCredentialModel cred = new UserCredentialModel();
-        cred.setType(RequiredCredentialRepresentation.PASSWORD);
+        cred.setType(CredentialRepresentation.PASSWORD);
         cred.setValue("geheim");
         realmModel.updateCredential(user, cred);
         Assert.assertTrue(realmModel.validatePassword(user, "geheim"));
diff --git a/services/src/test/java/org/keycloak/test/ImportTest.java b/services/src/test/java/org/keycloak/test/ImportTest.java
index 373041e3c3..02218d848c 100755
--- a/services/src/test/java/org/keycloak/test/ImportTest.java
+++ b/services/src/test/java/org/keycloak/test/ImportTest.java
@@ -70,6 +70,8 @@ public class ImportTest {
         realm.addRealmAdmin(admin);
         List<RequiredCredentialModel> creds = realm.getRequiredCredentials();
         Assert.assertEquals(1, creds.size());
+        RequiredCredentialModel cred = creds.get(0);
+        Assert.assertEquals("Password", cred.getFormLabel());
 
         UserModel user = realm.getUser("loginclient");
         Assert.assertNotNull(user);
@@ -83,6 +85,29 @@ public class ImportTest {
 
     }
 
+    @Test
+    public void install2() throws Exception {
+        RealmModel defaultRealm = manager.createRealm(RealmModel.DEFAULT_REALM, RealmModel.DEFAULT_REALM);
+        defaultRealm.setName(RealmModel.DEFAULT_REALM);
+        defaultRealm.setEnabled(true);
+        defaultRealm.setTokenLifespan(300);
+        defaultRealm.setAccessCodeLifespan(60);
+        defaultRealm.setSslNotRequired(false);
+        defaultRealm.setCookieLoginAllowed(true);
+        defaultRealm.setRegistrationAllowed(true);
+        manager.generateRealmKeys(defaultRealm);
+        defaultRealm.addRequiredCredential(RequiredCredentialModel.PASSWORD);
+        RoleModel role = defaultRealm.addRole(SaasService.REALM_CREATOR_ROLE);
+        UserModel admin = defaultRealm.addUser("admin");
+        defaultRealm.grantRole(admin, role);
+
+        RealmRepresentation rep = KeycloakTestBase.loadJson("testrealm-demo.json");
+        RealmModel realm = manager.createRealm("demo", rep.getRealm());
+        manager.importRealm(rep, realm);
+        realm.addRealmAdmin(admin);
+    }
+
+
 
 
 
diff --git a/services/src/test/java/org/keycloak/test/RealmCreationTest.java b/services/src/test/java/org/keycloak/test/RealmCreationTest.java
index 9fb4aa0d3a..0d446ff2f6 100755
--- a/services/src/test/java/org/keycloak/test/RealmCreationTest.java
+++ b/services/src/test/java/org/keycloak/test/RealmCreationTest.java
@@ -8,8 +8,8 @@ import org.junit.BeforeClass;
 import org.junit.Test;
 import org.keycloak.SkeletonKeyContextResolver;
 import org.keycloak.representations.AccessTokenResponse;
+import org.keycloak.representations.idm.CredentialRepresentation;
 import org.keycloak.representations.idm.RealmRepresentation;
-import org.keycloak.representations.idm.RequiredCredentialRepresentation;
 import org.keycloak.representations.idm.UserRepresentation;
 import org.keycloak.services.managers.AuthenticationManager;
 import org.keycloak.services.managers.RealmManager;
@@ -61,7 +61,7 @@ public class RealmCreationTest {
     public void testRegisterLoginAndCreate() throws Exception {
         UserRepresentation user = new UserRepresentation();
         user.setUsername("bburke");
-        user.credential(RequiredCredentialRepresentation.PASSWORD, "geheim", false);
+        user.credential(CredentialRepresentation.PASSWORD, "geheim");
 
         WebTarget target = client.target(generateURL("/"));
         Response response = target.path("saas/registrations").request().post(Entity.json(user));
@@ -73,14 +73,14 @@ public class RealmCreationTest {
         try {
             Form form = new Form();
             form.param(AuthenticationManager.FORM_USERNAME, "bburke");
-            form.param(RequiredCredentialRepresentation.PASSWORD, "badpassword");
+            form.param(CredentialRepresentation.PASSWORD, "badpassword");
             tokenResponse = target.path("realms").path(RealmModel.DEFAULT_REALM).path("tokens/grants/identity-token").request().post(Entity.form(form), AccessTokenResponse.class);
             Assert.fail();
         } catch (NotAuthorizedException e) {
         }
         Form form = new Form();
         form.param(AuthenticationManager.FORM_USERNAME, "bburke");
-        form.param(RequiredCredentialRepresentation.PASSWORD, "geheim");
+        form.param(CredentialRepresentation.PASSWORD, "geheim");
         tokenResponse = target.path("realms").path(RealmModel.DEFAULT_REALM).path("tokens/grants/identity-token").request().post(Entity.form(form), AccessTokenResponse.class);
         Assert.assertNotNull(tokenResponse);
         System.out.println(tokenResponse.getToken());
diff --git a/services/src/test/resources/testrealm-demo.json b/services/src/test/resources/testrealm-demo.json
new file mode 100755
index 0000000000..e7d458049a
--- /dev/null
+++ b/services/src/test/resources/testrealm-demo.json
@@ -0,0 +1,86 @@
+{
+    "realm": "demo",
+    "enabled": true,
+    "tokenLifespan": 300,
+    "accessCodeLifespan": 10,
+    "sslNotRequired": true,
+    "cookieLoginAllowed": true,
+    "privateKey": "MIICXAIBAAKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQABAoGAfmO8gVhyBxdqlxmIuglbz8bcjQbhXJLR2EoS8ngTXmN1bo2L90M0mUKSdc7qF10LgETBzqL8jYlQIbt+e6TH8fcEpKCjUlyq0Mf/vVbfZSNaVycY13nTzo27iPyWQHK5NLuJzn1xvxxrUeXI6A2WFpGEBLbHjwpx5WQG9A+2scECQQDvdn9NE75HPTVPxBqsEd2z10TKkl9CZxu10Qby3iQQmWLEJ9LNmy3acvKrE3gMiYNWb6xHPKiIqOR1as7L24aTAkEAtyvQOlCvr5kAjVqrEKXalj0Tzewjweuxc0pskvArTI2Oo070h65GpoIKLc9jf+UA69cRtquwP93aZKtW06U8dQJAF2Y44ks/mK5+eyDqik3koCI08qaC8HYq2wVl7G2QkJ6sbAaILtcvD92ToOvyGyeE0flvmDZxMYlvaZnaQ0lcSQJBAKZU6umJi3/xeEbkJqMfeLclD27XGEFoPeNrmdx0q10Azp4NfJAY+Z8KRyQCR2BEG+oNitBOZ+YXF9KCpH3cdmECQHEigJhYg+ykOvr1aiZUMFT72HU0jnmQe2FVekuG+LJUt2Tm7GtMjTFoGpf0JwrVuZN39fOYAlo+nTixgeW7X8Y=",
+    "publicKey": "MIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQCrVrCuTtArbgaZzL1hvh0xtL5mc7o0NqPVnYXkLvgcwiC3BjLGw1tGEGoJaXDuSaRllobm53JBhjx33UNv+5z/UMG4kytBWxheNVKnL6GgqlNabMaFfPLPCF8kAgKnsi79NMo+n6KnSY8YeUmec/p2vjO2NjsSAVcWEQMVhJ31LwIDAQAB",
+    "requiredCredentials": [ "password" ],
+    "requiredResourceCredentials": [ "password" ],
+    "requiredOAuthClientCredentials": [ "password" ],
+    "users" : [
+        {
+            "username" : "bburke@redhat.com",
+            "enabled" : true,
+            "attributes" : {
+                "email" : "bburke@redhat.com"
+            },
+            "credentials" : [
+                { "type" : "Password",
+                    "value" : "password" }
+            ]
+        },
+        {
+            "username" : "third-party",
+            "enabled" : true,
+            "credentials" : [
+                { "type" : "Password",
+                    "value" : "password" }
+            ]
+        }
+    ],
+    "roles": [
+        {
+            "name": "user",
+            "description": "Have User privileges"
+        },
+        {
+            "name": "admin",
+            "description": "Have Administrator privileges"
+        }
+    ],
+    "roleMappings": [
+        {
+            "username": "bburke@redhat.com",
+            "roles": ["user"]
+        },
+        {
+            "username": "third-party",
+            "roles": ["KEYCLOAK_IDENTITY_REQUESTER"]
+        }
+    ],
+    "scopeMappings": [
+        {
+            "username": "third-party",
+            "roles": ["user"]
+        }
+    ],
+    "resources": [
+        {
+            "name": "customer-portal",
+            "enabled": true,
+            "adminUrl": "http://localhost:8080/customer-portal/j_admin_request",
+            "useRealmMappings": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "password"
+                }
+            ]
+        },
+        {
+            "name": "product-portal",
+            "enabled": true,
+            "adminUrl": "http://localhost:8080/product-portal/j_admin_request",
+            "useRealmMappings": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "password"
+                }
+            ]
+        }
+    ]
+}
\ No newline at end of file
diff --git a/services/src/test/resources/testrealm.json b/services/src/test/resources/testrealm.json
index 72390867d9..4750169a55 100755
--- a/services/src/test/resources/testrealm.json
+++ b/services/src/test/resources/testrealm.json
@@ -1,123 +1,121 @@
 {
-   "realm" : "test-realm",
-   "enabled" : true,
-   "tokenLifespan" : 6000,
-   "accessCodeLifespan" : 30,
-   "requiredCredentials" : [
+    "realm": "test-realm",
+    "enabled": true,
+    "tokenLifespan": 6000,
+    "accessCodeLifespan": 30,
+    "requiredCredentials": [ "password" ],
+    "requiredResourceCredentials": [ "password" ],
+    "requiredOAuthClientCredentials": [ "password" ],
+    "users": [
         {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-   ],
-    "requiredResourceCredentials" : [
-        {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-    ],
-    "requiredOAuthClientCredentials" : [
-        {
-            "type" : "Password",
-            "input" : true,
-            "secret" : true
-        }
-    ],
-   "users" : [
-      {
-            "username" : "wburke",
-            "enabled" : true,
-            "attributes" : {
-                "email" : "bburke@redhat.com"
+            "username": "wburke",
+            "enabled": true,
+            "attributes": {
+                "email": "bburke@redhat.com"
             },
-            "credentials" : [
-                { "type" : "Password",
-                 "value" : "userpassword" }
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "userpassword"
+                }
             ]
-      },
-      {
-            "username" : "loginclient",
-            "enabled" : true,
-            "credentials" : [
-                { "type" : "Password",
-                 "value" : "clientpassword" }
+        },
+        {
+            "username": "loginclient",
+            "enabled": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "clientpassword"
+                }
             ]
-      },
-      {
-            "username" : "admin",
-            "enabled" : true,
-            "credentials" : [
-                { "type" : "Password",
-                 "value" : "adminpassword" }
+        },
+        {
+            "username": "admin",
+            "enabled": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "adminpassword"
+                }
             ]
-      },
-      {
-            "username" : "oauthclient",
-            "enabled" : true,
-            "credentials" : [
-                { "type" : "Password",
-                 "value" : "clientpassword" }
+        },
+        {
+            "username": "oauthclient",
+            "enabled": true,
+            "credentials": [
+                {
+                    "type": "password",
+                    "value": "clientpassword"
+                }
             ]
-      }
-   ],
-   "roleMappings" : [
-       {
-          "username" : "admin",
-          "roles" : ["admin"]
-       }
-   ],
-   "scopeMappings" : [
-       {
-          "username" : "loginclient",
-          "roles" : ["*"]
-       }
-   ],
-   "resources" : [
-       {
-          "name" : "Application",
-          "enabled" : true,
-          "roles" : [
-              { "name" : "admin" },
-              { "name" : "user" }
-          ],
-          "roleMappings" : [
-             {
-                "username" : "wburke",
-                "roles" : ["user"]
-             },
-             {
-                "username" : "admin",
-                "roles" : ["admin"]
-             }
-          ],
-          "scopeMappings" : [
-             {
-                "username" : "oauthclient",
-                "roles" : ["user"]
-             }
-          ]
-       },
-       {
-                 "name" : "OtherApp",
-                  "enabled" : true,
-          "roles" : [
-              { "name" : "admin" },
-              { "name" : "user" }
-          ],
-                 "roleMappings" : [
-                    {
-                       "username" : "wburke",
-                       "roles" : ["user"]
-                    },
-                    {
-                       "username" : "admin",
-                       "roles" : ["admin"]
-                    }
-                 ]
-              }
+        }
+    ],
+    "roleMappings": [
+        {
+            "username": "admin",
+            "roles": ["admin"]
+        }
+    ],
+    "scopeMappings": [
+        {
+            "username": "loginclient",
+            "roles": ["*"]
+        }
+    ],
+    "resources": [
+        {
+            "name": "Application",
+            "enabled": true,
+            "roles": [
+                {
+                    "name": "admin"
+                },
+                {
+                    "name": "user"
+                }
+            ],
+            "roleMappings": [
+                {
+                    "username": "wburke",
+                    "roles": ["user"]
+                },
+                {
+                    "username": "admin",
+                    "roles": ["admin"]
+                }
+            ],
+            "scopeMappings": [
+                {
+                    "username": "oauthclient",
+                    "roles": ["user"]
+                }
+            ]
+        },
+        {
+            "name": "OtherApp",
+            "enabled": true,
+            "roles": [
+                {
+                    "name": "admin"
+                },
+                {
+                    "name": "user"
+                }
+            ],
+            "roleMappings": [
+                {
+                    "username": "wburke",
+                    "roles": ["user"]
+                },
+                {
+                    "username": "admin",
+                    "roles": ["admin"]
+                }
+            ]
+        }
 
-   ]
+    ]
 
 
 }
\ No newline at end of file